#include "/lib/shaderSettings/materials.glsl" #include "/lib/shaderSettings/water.glsl" #include "/lib/shaderSettings/blueScreen.glsl" #include "/lib/shaderSettings/emissiveFlowers.glsl" if (mat >= 10000) { if (mat < 11024) { if (mat < 10512) { if (mat < 10256) { if (mat < 10126) { // MV: Normal Mycelium if (mat < 10064) { if (mat < 10032) { if (mat < 10014) { // MV: Foliage if (mat < 10006) { // MV: Leaves if (mat < 10002) { // No directional shading, MV: Flowers noDirectionalShading = true; sandNoiseIntensity = 0.4, mossNoiseIntensity = 0.0, isFoliage = true; } else /*if (mat < 10006)*/ { // Grounded Waving Foliage subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; #ifdef GBUFFERS_TERRAIN DoFoliageColorTweaks(color.rgb, shadowMult, snowMinNdotU, viewPos, nViewPos, lViewPos, dither); #ifdef COATED_TEXTURES doTileRandomisation = false; #endif #endif #if SHADOW_QUALITY == -1 shadowMult *= 1.0 - 0.3 * (signMidCoordPos.y + 1.0) * (1.0 - abs(signMidCoordPos.x)) + 0.5 * (1.0 - signMidCoordPos.y) * invNoonFactor; // consistency357381 #endif sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; #if EMISSIVE_FLOWERS > 0 || defined EMISSIVE_BLOOD_MOON_FLOWERS if (mat == 10003 && max(color.b, color.r * 1.3) > color.g) { // Flowers emission = 2.0 * skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif #if EMISSIVE_FLOWERS > 0 #if EMISSIVE_FLOWERS_TYPE == 1 if (color.b < max(color.r, color.g * 1.1) * 0.95) emission = 0.0; #elif EMISSIVE_FLOWERS_TYPE == 2 if (color.r < max(color.b * 1.15, color.g * 1.1) * 0.95) emission = 0.0; #endif #else emission *= int(color.r > max(color.b * 1.15, color.g * 2.5) * 0.95) * getBloodMoon(moonPhase, sunVisibility); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif } } else { if (mat < 10012) { // Leaves #include "/lib/materials/specificMaterials/terrain/leaves.glsl" #if EMISSIVE_FLOWERS > 0 && EMISSIVE_FLOWERS_TYPE < 2 if (mat == 10011 && max(color.b, color.r * 0.7) > color.g) { // Flowering Azalea Leaves emission = skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif #ifdef PINKER_CHERRY_LEAVES if (mat == 10007 && color.b > 0.5 && color.r > 0.85) { color.rgb *= vec3(1.0, 0.66, 0.87) + 0.2; color.rgb = clamp01(color.rgb); } #endif } else /*if (mat < 10014)*/ { // Vine subsurfaceMode = 3, centerShadowBias = true; noSmoothLighting = true; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif float factor = color.g; smoothnessG = factor * 0.5; highlightMult = factor * 4.0 + 2.0; float fresnel = clamp(1.0 + dot(normalM, normalize(viewPos)), 0.0, 1.0); highlightMult *= 1.0 - pow2(pow2(fresnel)); sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; } } } else { if (mat < 10024) { if (mat < 10020) { // Non-waving Foliage subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; if (mat == 10019) { #if EMISSIVE_FLOWERS > 0 && EMISSIVE_FLOWERS_TYPE < 2 if (max(color.b * 1.25, color.r * 0.91) > color.g) { // Flowers emission = 1.5 * skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif #ifdef PINKER_CHERRY_LEAVES if (color.b > 0.5 && color.r > 0.85) color.rgb *= vec3(1.0, 0.87, 0.97); // Pink Petals #endif } } else /*if (mat < 10024)*/ { // Upper Waving Foliage subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; #ifdef GBUFFERS_TERRAIN DoFoliageColorTweaks(color.rgb, shadowMult, snowMinNdotU, viewPos, nViewPos, lViewPos, dither); #ifdef COATED_TEXTURES doTileRandomisation = false; #endif #endif #if SHADOW_QUALITY == -1 shadowMult *= 1.0 + invNoonFactor; // consistency357381 #endif sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; #if EMISSIVE_FLOWERS > 0 || defined EMISSIVE_BLOOD_MOON_FLOWERS if (mat == 10023 && max(color.b, color.r * 1.25) > color.g) { // Large Flowers Upper Half #if EMISSIVE_FLOWERS > 0 emission = 2.0 * skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif #if EMISSIVE_FLOWERS_TYPE == 1 if (color.b < max(color.r, color.g * 1.1) * 0.95) emission = 0.0; #elif EMISSIVE_FLOWERS_TYPE == 2 if (color.r < max(color.b * 1.15, color.g * 1.1) * 0.95) emission = 0.0; #endif #else emission *= int(color.r > max(color.b * 1.15, color.g * 2.5) * 0.95) * getBloodMoon(moonPhase, sunVisibility); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif } } else { if (mat < 10025) { // Auto Modded Ores - Stone #ifdef GLOWING_ORE_MODDED #include "/lib/materials/specificMaterials/terrain/autoModdedOres.glsl" if (emission < 0.1) { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } emission *= GLOWING_ORE_MULT; //color.rgb = avgBorderColor; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else if (mat < 10026) { // Short Foliage / Foliage Lower Half - No Subsurface Scattering noSmoothLighting = true; #ifdef GBUFFERS_TERRAIN DoFoliageColorTweaks(color.rgb, shadowMult, snowMinNdotU, viewPos, nViewPos, lViewPos, dither); #endif #if SHADOW_QUALITY == -1 shadowMult *= 1.0 - 0.3 * (signMidCoordPos.y + 1.0) * (1.0 - abs(signMidCoordPos.x)) + 0.5 * (1.0 - signMidCoordPos.y) * invNoonFactor; // consistency357381 #endif sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; } else if (mat < 10027) { // Auto Modded Ores - Netherrack #ifdef GLOWING_ORE_MODDED #include "/lib/materials/specificMaterials/terrain/autoModdedOres.glsl" if (emission < 0.1) { #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" } emission *= GLOWING_ORE_MULT; //color.rgb = avgBorderColor; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else if (mat < 10028) { // Tall Foliage / Foliage Upper Half - No Subsurface Scattering noSmoothLighting = true; #ifdef GBUFFERS_TERRAIN DoFoliageColorTweaks(color.rgb, shadowMult, snowMinNdotU, viewPos, nViewPos, lViewPos, dither); #endif #if SHADOW_QUALITY == -1 shadowMult *= 1.0 + invNoonFactor; // consistency357381 #endif sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; } else if (mat < 10029) { // Auto Modded Ores - Endstone #ifdef GLOWING_ORE_MODDED #include "/lib/materials/specificMaterials/terrain/autoModdedOres.glsl" if (emission < 0.1) { #include "/lib/materials/specificMaterials/terrain/endStone.glsl" } emission *= GLOWING_ORE_MULT; //color.rgb = avgBorderColor; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else if (mat < 10030) { // Crimson Roots subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; #ifdef GBUFFERS_TERRAIN DoFoliageColorTweaks(color.rgb, shadowMult, snowMinNdotU, viewPos, nViewPos, lViewPos, dither); #endif #if SHADOW_QUALITY == -1 shadowMult *= 1.0 - 0.3 * (signMidCoordPos.y + 1.0) * (1.0 - abs(signMidCoordPos.x)) + 0.5 * (1.0 - signMidCoordPos.y) * invNoonFactor; // consistency357381 #endif #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = mix(color.rgb, saturateColors(color.rgb * vec3(0.9, 0.7, 0.1), 0.85), inSoulValley); // Color curve to make it look better #endif sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; } else if (mat < 10032) { // Short foliage - no interactive foliage subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; #ifdef GBUFFERS_TERRAIN DoFoliageColorTweaks(color.rgb, shadowMult, snowMinNdotU, viewPos, nViewPos, lViewPos, dither); #ifdef COATED_TEXTURES doTileRandomisation = false; #endif #endif #if SHADOW_QUALITY == -1 shadowMult *= 1.0 - 0.3 * (signMidCoordPos.y + 1.0) * (1.0 - abs(signMidCoordPos.x)) + 0.5 * (1.0 - signMidCoordPos.y) * invNoonFactor; // consistency357381 #endif sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; } } } } else { if (mat < 10048) { if (mat < 10040) { if (mat < 10035) { // Stone Bricks++ #include "/lib/materials/specificMaterials/terrain/stone.glsl" #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else if (mat < 10036){ // Sugar Cane subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; } else /*if (mat < 10040)*/ { // Anvil+ #include "/lib/materials/specificMaterials/terrain/anvil.glsl" } } else { if (mat < 10044) { // Rails #if ANISOTROPIC_FILTER == 0 color = texture2DLod(tex, texCoord, 0); #endif noSmoothLighting = true; if (color.r > 0.1 && color.g + color.b < 0.1) { // Redstone Parts noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); if (color.r > 0.5) { color.rgb *= color.rgb; emission = 8.0 * color.r; overlayNoiseIntensity = 0.35, overlayNoiseEmission = 0.2; } else if (color.r > color.g * 2.0) { materialMask = OSIEBCA * 5.0; // Redstone Fresnel float factor = pow2(color.r); smoothnessG = 0.4; highlightMult = factor + 0.4; smoothnessD = factor * 0.7 + 0.3; } } else if (abs(color.r - color.b) < 0.15) { // Iron Parts #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" } else if (color.g > color.b * 2.0) { // Gold Parts #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } else { // Wood Parts #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" } } else /*if (mat < 10048)*/ { // Empty Cauldron, Hopper noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.9333); #include "/lib/materials/specificMaterials/terrain/anvil.glsl" if (mat == 10047) { // Disabled Hopper redstoneIPBR(color.rgb, emission); } } } } else { if (mat < 10056) { if (mat < 10052) { // Water Cauldron noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.9333); vec3 worldPos = playerPos + cameraPosition; vec3 fractPos = fract(worldPos.xyz); vec2 coordM = abs(fractPos.xz - 0.5); if (max(coordM.x, coordM.y) < 0.375 && fractPos.y > 0.3 && NdotU > 0.9) { #ifdef SHADER_WATER #if WATER_STYLE < 3 || PIXEL_WATER == 1 vec3 colorP = color.rgb / glColor.rgb; smoothnessG = min(pow2(pow2(dot(colorP.rgb, colorP.rgb) * 0.4)), 1.0); highlightMult = 3.25; smoothnessD = 0.8; #else smoothnessG = 0.3; smoothnessD = 1.0; #endif #include "/lib/materials/specificMaterials/translucents/water.glsl" #ifdef COATED_TEXTURES noiseFactor = 0.0; #endif #endif overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/anvil.glsl" } } else /*if (mat < 10056)*/ { // Powder Snow Cauldron noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.9333); vec3 worldPos = playerPos + cameraPosition; vec3 fractPos = fract(worldPos.xyz); vec2 coordM = abs(fractPos.xz - 0.5); if (max(coordM.x, coordM.y) < 0.375 && fractPos.y > 0.3 && NdotU > 0.9) { #include "/lib/materials/specificMaterials/terrain/snow.glsl" overlayNoiseIntensity = 0.4; } else { #include "/lib/materials/specificMaterials/terrain/anvil.glsl" } } } else { if (mat < 10060) { // Lava Cauldron noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.9333); vec3 worldPos = playerPos + cameraPosition; vec3 fractPos = fract(worldPos.xyz); vec2 coordM = abs(fractPos.xz - 0.5); if (max(coordM.x, coordM.y) < 0.375 && fractPos.y > 0.3 && NdotU > 0.9) { #include "/lib/materials/specificMaterials/terrain/lava.glsl" sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/anvil.glsl" } } else /*if (mat < 10061)*/ { // Lever if (color.r > color.g + color.b) { color.rgb *= color.rgb; emission = 4.0; overlayNoiseIntensity = 0.1, overlayNoiseEmission = 0.3; } else { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } } } } } } else { if (mat < 10096) { if (mat < 10080) { if (mat < 10072) { if (mat < 10068) { // Lectern #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" } else /*if (mat < 10072)*/ { // Lava #include "/lib/materials/specificMaterials/terrain/lava.glsl" #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 4.5, lViewPos); #endif sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } } else { if (mat < 10076) { // Fire noSmoothLighting = true, noDirectionalShading = true; emission = 2.35; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; #if (defined SOUL_SAND_VALLEY_OVERHAUL_INTERNAL || defined PURPLE_END_FIRE_INTERNAL) && defined GBUFFERS_TERRAIN float uniformValue = 1.0; vec3 colorFire = vec3(0.0); #ifdef NETHER uniformValue = inSoulValley; colorFire = colorSoul; float gradient = mix(1.0, 0.0, clamp01(blockUV.y + 3.0 * blockUV.y)); #endif #ifdef END uniformValue = 1.0; colorFire = colorEndBreath * 1.5; float gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.15 - 1.1 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * blockUV.y))); #endif color.rgb = mix(color.rgb, mix(color.rgb, vec3(GetLuminance(color.rgb)), 0.88), uniformValue * gradient); color.rgb *= mix(vec3(1.0), colorFire * 2.0, uniformValue * gradient); #endif } else /*if (mat < 10080)*/ { // Soul Fire noSmoothLighting = true, noDirectionalShading = true; emission = 1.5; color.rgb = pow1_5(color.rgb); overlayNoiseIntensity = 0.0; } } } else { if (mat < 10088) { if (mat < 10084) { // Stone+, Coal Ore, Smooth Stone+, Grindstone, Stonecutter #include "/lib/materials/specificMaterials/terrain/stone.glsl" if (mat == 10083) { // Powered Stone Pressure Plate and Stone Button redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10088)*/ { // Granite+ smoothnessG = pow2(pow2(color.r)) * 0.75; smoothnessD = smoothnessG; } } else { if (mat < 10092) { // Diorite+ smoothnessG = pow2(pow2(color.g)) * 0.5; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.75, shadowMult, highlightMult); #endif } else /*if (mat < 10096)*/ { // Andesite+ smoothnessG = pow2(pow2(color.g)) * 1.3; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; } } } } else { if (mat < 10112) { if (mat < 10104) { if (mat < 10100) { // Polished Granite+ smoothnessG = 0.1 + color.r * 0.4; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 10104)*/ { // Polished Diorite+ smoothnessG = pow2(color.g) * 0.7; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.75, shadowMult, highlightMult); #endif #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else { if (mat < 10108) { // Polished Andesite+, Packed Mud, Mud Bricks+, Bricks+ smoothnessG = pow2(color.g); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 10112)*/ { // Deepslate:Non-polished Variants, Deepslate Coal Ore #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else { if (mat < 10120) { if (mat < 10116) { // Deepslate:Polished Variants, Mud, Mangrove Roots, Muddy Mangrove Roots #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 10120)*/ { // Calcite highlightMult = pow2(color.g) + 1.0; smoothnessG = 1.0 - color.g * 0.5; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.75, shadowMult, highlightMult); #endif } } else { if (mat < 10124) { // Dripstone+, Daylight Detector smoothnessG = color.r * 0.35 + 0.2; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif #ifdef REDSTONE_IPBR if (mat == 10123) { // Daylight Detector if (color.r > 0.5 && color.g > 0.5 && color.b > 0.5) smoothnessD = 1.0; redstoneIPBR(color.rgb, emission); } #endif } else /*if (mat < 10128)*/ { // Snowy Variants of Grass Block, Podzol, Mycelium float dotColor = dot(color.rgb, color.rgb); if (dotColor > 1.5) { // Snowy Variants:Snowy Part #include "/lib/materials/specificMaterials/terrain/snow.glsl" overlayNoiseIntensity = 0.0; } else { // Snowy Variants:Dirt Part #include "/lib/materials/specificMaterials/terrain/dirt.glsl" } } } } } } } else { if (mat < 10192) { if (mat < 10160) { if (mat < 10144) { if (mat < 10136) { if (mat < 10132) { // Dirt, Coarse Dirt, Rooted Dirt, Podzol:Normal, Mycelium:Normal, Farmland:Dry #include "/lib/materials/specificMaterials/terrain/dirt.glsl" } else /*if (mat < 10136)*/ { // Grass Block:Normal if (glColor.b < 0.999) { // Grass Block:Normal:Grass Part smoothnessG = pow2(color.g); #ifdef SNOWY_WORLD snowMinNdotU = min(pow2(pow2(color.g)) * 1.9, 0.1); color.rgb = color.rgb * 0.5 + 0.5 * (color.rgb / glColor.rgb); #endif } else { //Grass Block:Normal:Dirt Part #include "/lib/materials/specificMaterials/terrain/dirt.glsl" } } } else { if (mat < 10140) { // Farmland:Wet if (NdotU > 0.99) { // Farmland:Wet:Top Part #if MC_VERSION >= 11300 smoothnessG = clamp(pow2(pow2(1.0 - color.r)) * 2.5, 0.5, 1.0); highlightMult = 0.5 + smoothnessG * smoothnessG * 2.0; smoothnessD = smoothnessG * 0.75; #else smoothnessG = 0.5 * (1.0 + abs(color.r - color.b) + color.b); smoothnessD = smoothnessG * 0.5; #endif } else { // Farmland:Wet:Dirt Part #include "/lib/materials/specificMaterials/terrain/dirt.glsl" } } else /*if (mat < 10144)*/ { // Netherrack #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" } } } else { if (mat < 10151) { // MV: Piston, Dispenser, Dropper if (mat < 10148) { // Warped Nylium, Warped Wart Block if (color.g == color.b && color.g > 0.0001) { // Warped Nylium:Netherrack Part #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" } else { // Warped Nylium:Nylium Part, Warped Wart Block smoothnessG = color.g * 0.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (mat == 10146 && color.g > 0.7) { // Warped Wart Block overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.8; emission = 2.4; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif } #endif } } else /*if (mat < 10152)*/ { // Crimson Nylium, Nether Wart Block if (color.g == color.b && color.g > 0.0001 && color.r < 0.522) { // Crimson Nylium:Netherrack Part #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" } else { // Crimson Nylium:Nylium Part, Nether Wart Block smoothnessG = color.r * 0.5; smoothnessD = smoothnessG; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL if (mat == 10148) color.rgb = mix(color.rgb, saturateColors(color.rgb * vec3(1.2, 0.7, 0.8) * 0.7, 0.8), inSoulValley); // Color curve to make it look better #endif #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (mat == 10150 && color.r > 0.6) { // Nether Wart Block overlayNoiseEmission = 0.28; emission = 16.0 * color.g; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif } #endif } } } else { if (mat < 10156) { // Cobblestone+, Mossy Cobblestone+, Furnace:Unlit, Smoker:Unlit, Blast Furnace:Unlit, Moss Block+, Lodestone, Piston, Sticky Piston, Dispenser, Dropper #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" if (mat == 10151) { // Extended Piston and Sticky Piston and Powered Dispenser and Dropper redstoneIPBR(color.rgb, emission); } else if (mat == 10154 || mat == 10155) { // Moss Block+ mossNoiseIntensity = 0.0; } } else /*if (mat < 10160)*/ { // Oak Planks++:Clean Variants, Bookshelf, Crafting Table, Tripwire Hook #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" if (mat == 10159) { // Powered Oak Button, Pressure Plate, Fence Gate and Tripwire Hook redstoneIPBR(color.rgb, emission); } } } } } else { if (mat < 10176) { if (mat < 10168) { if (mat < 10164) { // Oak Log, Oak Wood if (color.g > 0.48 || CheckForColor(color.rgb, vec3(126, 98, 55)) || CheckForColor(color.rgb, vec3(150, 116, 65))) { // Oak Log:Clean Part #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" } else { // Oak Log:Wood Part, Oak Wood #include "/lib/materials/specificMaterials/terrain/oakWood.glsl" } } else /*if (mat < 10168)*/ { // Spruce Planks++:Clean Variants #include "/lib/materials/specificMaterials/planks/sprucePlanks.glsl" if (mat == 10167) { // Powered Spruce Redstone Components redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10172) { // Spruce Log, Spruce Wood if (color.g > 0.25) { // Spruce Log:Clean Part #include "/lib/materials/specificMaterials/planks/sprucePlanks.glsl" } else { // Spruce Log:Wood Part, Spruce Wood smoothnessG = pow2(color.g) * 2.5; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; } } else /*if (mat < 10176)*/ { // Birch Planks++:Clean Variants, Scaffolding, Loom #include "/lib/materials/specificMaterials/planks/birchPlanks.glsl" if (mat == 10175) { // Powered Birch Redstone Components redstoneIPBR(color.rgb, emission); } } } } else { if (mat < 10184) { if (mat < 10180) { // Birch Log, Birch Wood if (color.r - color.b > 0.15) { // Birch Log:Clean Part #include "/lib/materials/specificMaterials/planks/birchPlanks.glsl" } else { // Birch Log:Wood Part, Birch Wood smoothnessG = pow2(color.g) * 0.25; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 1.25; #endif } } else /*if (mat < 10184)*/ { // Jungle Planks++:Clean Variants, Composter #include "/lib/materials/specificMaterials/planks/junglePlanks.glsl" if (mat == 10183) { // Powered Jungle Redstone Components redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10188) { // Jungle Log, Jungle Wood if (color.g > 0.405) { // Jungle Log:Clean Part #include "/lib/materials/specificMaterials/planks/junglePlanks.glsl" } else { // Jungle Log:Wood Part, Jungle Wood smoothnessG = pow2(pow2(color.g)) * 5.0; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else /*if (mat < 10192)*/ { // Acacia Planks++:Clean Variants #include "/lib/materials/specificMaterials/planks/acaciaPlanks.glsl" if (mat == 10191) { // Powered Acacia Redstone Components redstoneIPBR(color.rgb, emission); } } } } } } else { if (mat < 10224) { if (mat < 10208) { if (mat < 10200) { if (mat < 10196) { // Acacia Log, Acacia Wood if (color.r - color.b > 0.2) { // Acacia Log:Clean Part #include "/lib/materials/specificMaterials/planks/acaciaPlanks.glsl" } else { // Acacia Log:Wood Part, Acacia Wood smoothnessG = pow2(color.b) * 1.3; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } else /*if (mat < 10200)*/ { // Dark Oak Planks++:Clean Variants #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" if (mat == 10199) { // Powered Dark Oak Redstone Components redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10204) { // Dark Oak Log, Dark Oak Wood if (color.r - color.g > 0.08 || CheckForColor(color.rgb, vec3(48, 30, 14))) { // Dark Oak Log:Clean Part #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" } else { // Dark Oak Log:Wood Part, Dark Oak Wood smoothnessG = color.r * 0.4; smoothnessD = smoothnessG; } } else /*if (mat < 10208)*/ { // Mangrove Planks++:Clean Variants #include "/lib/materials/specificMaterials/planks/mangrovePlanks.glsl" if (mat == 10207) { // Powered Mangrove Redstone Components redstoneIPBR(color.rgb, emission); } } } } else { if (mat < 10216) { if (mat < 10212) { // Mangrove Log, Mangrove Wood if (color.r - color.g > 0.2) { // Mangrove Log:Clean Part #include "/lib/materials/specificMaterials/planks/mangrovePlanks.glsl" } else { // Mangrove Log:Wood Part, Mangrove Wood smoothnessG = pow2(color.r) * 0.6; smoothnessD = smoothnessG; } } else /*if (mat < 10216)*/ { // Crimson Planks++:Clean Variants #include "/lib/materials/specificMaterials/planks/crimsonPlanks.glsl" if (mat == 10215) { // Powered Crimson Redstone Components redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10220) { // Crimson Stem, Crimson Hyphae if (color.r / color.b <= 2.5) { // Flat Part #include "/lib/materials/specificMaterials/planks/crimsonPlanks.glsl" #ifdef GLOWING_NETHER_TREES } else { // Emissive Part emission = pow2(color.r) * 6.5; color.gb *= 0.5; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.15; #endif } } else /*if (mat < 10224)*/ { // Warped Planks++:Clean Variants #include "/lib/materials/specificMaterials/planks/warpedPlanks.glsl" if (mat == 10223) { // Powered Warped Redstone Components redstoneIPBR(color.rgb, emission); } } } } } else { if (mat < 10240) { if (mat < 10232) { if (mat < 10228) { // Warped Stem, Warped Hyphae //if (color.r < 0.12 || color.r + color.g * 3.0 < 3.4 * color.b) { // Emissive Part if (color.r >= 0.37 * color.b && color.r + color.g * 3.0 >= 3.4 * color.b) { // Flat Part #include "/lib/materials/specificMaterials/planks/warpedPlanks.glsl" #ifdef GLOWING_NETHER_TREES } else { // Emissive Part emission = pow2(color.g + 0.2 * color.b) * 4.5 + 0.15; overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.3; #endif } } else /*if (mat < 10232)*/ { // Bedrock smoothnessG = color.b * 0.2 + 0.1; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 1.5; #endif } } else { if (mat < 10236) { // Sand, Suspicious Sand smoothnessG = pow(color.g, 16.0) * 2.0; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; highlightMult = 2.0; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); DoOceanBlockTweaks(smoothnessD); #endif #if RAIN_PUDDLES >= 1 || defined SPOOKY_RAIN_PUDDLE_OVERRIDE noPuddles = 1.0; #endif } else /*if (mat < 10240)*/ { // Red Sand smoothnessG = pow(color.r * 1.08, 16.0) * 2.0; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; highlightMult = 2.0; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #if RAIN_PUDDLES >= 1 || defined SPOOKY_RAIN_PUDDLE_OVERRIDE noPuddles = 1.0; #endif } } } else { if (mat < 10248) { if (mat < 10244) { // Sandstone+ highlightMult = 2.0; smoothnessG = pow2(pow2(color.g)) * 0.5; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 10248)*/ { // Red Sandstone+ highlightMult = 2.0; smoothnessG = pow2(pow2(color.r * 1.08)) * 0.5; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } } else { if (mat < 10252) { // Netherite Block #include "/lib/materials/specificMaterials/terrain/netheriteBlock.glsl" } else /*if (mat < 10256)*/ { // Ancient Debris smoothnessG = pow2(color.r); smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 1.5; #endif #ifdef GLOWING_ORE_ANCIENTDEBRIS emission = min(pow2(color.g * 6.0), 8.0); overlayNoiseIntensity = 0.2, overlayNoiseEmission = 0.8; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } } } } } } } else { if (mat < 10384) { if (mat < 10320) { if (mat < 10288) { if (mat < 10272) { if (mat < 10264) { if (mat < 10260) { // Iron Bars noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" } else /*if (mat < 10264)*/ { // ACL solid blocks with no properties } } else { if (mat < 10268) { // Iron Block, Heavy Weighted Pressure Plate #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" color.rgb *= max(color.r, 0.85) * 0.9; // color.rgb = vec3(0); // smoothnessD = 1.0; // smoothnessG = smoothnessD; // noGeneratedNormals = true; // overlayNoiseIntensity = 0.0; if (mat == 10267) { // Powered Heavy Weighted Pressure Plate redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10272)*/ { // Raw Iron Block #include "/lib/materials/specificMaterials/terrain/rawIronBlock.glsl" #ifdef GLOWING_RAW_BLOCKS emission = pow1_5(color.r) * 1.5; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } } } else { if (mat < 10280) { if (mat < 10276) { // Iron Ore if (color.r != color.g) { // Iron Ore:Raw Iron Part #include "/lib/materials/specificMaterials/terrain/rawIronBlock.glsl" #ifdef GLOWING_ORE_IRON if (color.r - color.b > 0.15) { emission = pow1_5(color.r) * 1.5; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Iron Ore:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } else /*if (mat < 10280)*/ { // Deepslate Iron Ore if (color.r != color.g) { // Deepslate Iron Ore:Raw Iron Part #include "/lib/materials/specificMaterials/terrain/rawIronBlock.glsl" #ifdef GLOWING_ORE_IRON if (color.r - color.b > 0.15) { emission = pow1_5(color.r) * 1.5; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Deepslate Iron Ore:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else { if (mat < 10284) { // Raw Copper Block #include "/lib/materials/specificMaterials/terrain/rawCopperBlock.glsl" #ifdef GLOWING_RAW_BLOCKS emission = pow2(color.r) * 1.5 + color.g * 1.3 + 0.2; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else /*if (mat < 10288)*/ { // Copper Ore if (color.r != color.g) { // Copper Ore:Raw Copper Part #include "/lib/materials/specificMaterials/terrain/rawCopperBlock.glsl" #ifdef GLOWING_ORE_COPPER if (max(color.r * 0.5, color.g) - color.b > 0.05) { emission = color.r * 2.0 + 0.7; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Copper Ore:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } } } } else { if (mat < 10304) { if (mat < 10296) { if (mat < 10292) { // Deepslate Copper Ore if (color.r != color.g) { // Deepslate Copper Ore:Raw Copper Part #include "/lib/materials/specificMaterials/terrain/rawCopperBlock.glsl" #ifdef GLOWING_ORE_COPPER if (max(color.r * 0.5, color.g) - color.b > 0.05) { emission = color.r * 2.0 + 0.7; overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Deepslate Copper Ore:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } else /*if (mat < 10296)*/ { // Copper Block++:All Non-raw Variants #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" } } else { if (mat < 10300) { // Raw Gold Block #include "/lib/materials/specificMaterials/terrain/rawGoldBlock.glsl" #ifdef GLOWING_RAW_BLOCKS emission = color.g * 1.5; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else if (mat < 10302) { // Gold Ore if (color.r != color.g || color.r > 0.99) { // Gold Ore:Raw Gold Part #include "/lib/materials/specificMaterials/terrain/rawGoldBlock.glsl" #ifdef GLOWING_ORE_GOLD if (color.g - color.b > 0.15 || color.r > 0.99) { emission = color.r + 1.0; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Gold Ore:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } else /*if (mat < 10302)*/ { // Deepslate Gold Ore if (color.r != color.g || color.r > 0.99) { // Deepslate Gold Ore:Raw Gold Part #include "/lib/materials/specificMaterials/terrain/rawGoldBlock.glsl" #ifdef GLOWING_ORE_GOLD if (color.g - color.b > 0.15 || color.r > 0.99) { emission = color.r + 1.0; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Deepslate Gold Ore:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } } else { if (mat < 10312) { if (mat < 10308) { // Pink and Purple Modded Ores // if (mat < 10306) { // Pink Modded Ores if (color.r - color.g > 0.1) { // Redstone Ore:Lit:Redstone Part #ifdef GLOWING_ORE_MODDED emission = min(1.5, pow2(color.r) * color.r * 4.5 * color.b); overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else { // Redstone Ore:Lit:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } noSmoothLighting = true; // } else { // Purple Modded Ores // } } else /*if (mat < 10312)*/ { // Nether Gold Ore if (color.g != color.b) { // Nether Gold Ore:Raw Gold Part #include "/lib/materials/specificMaterials/terrain/rawGoldBlock.glsl" #ifdef GLOWING_ORE_NETHERGOLD emission = color.g * 1.5; emission *= GLOWING_ORE_MULT; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else { // Nether Gold Ore:Netherrack Part #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" } } } else { if (mat < 10316) { // Gold Block, Light Weighted Pressure Plate #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" if (mat == 10315) { // Powered Light Weighted Pressure Plate redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10320)*/ { // Diamond Block #include "/lib/materials/specificMaterials/terrain/diamondBlock.glsl" } } } } } else { if (mat < 10352) { if (mat < 10336) { if (mat < 10328) { if (mat < 10324) { // Diamond Ore if (color.b / color.r > 1.5 || color.b > 0.75) { // Diamond Ore:Diamond Part #include "/lib/materials/specificMaterials/terrain/diamondBlock.glsl" #ifdef GLOWING_ORE_DIAMOND emission = color.g + 1.5; overlayNoiseIntensity = 0.75, overlayNoiseEmission = 0.4; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Diamond Ore:Stone Part, Diamond Ore:StoneToDiamond part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } else /*if (mat < 10328)*/ { // Deepslate Diamond Ore if (color.b / color.r > 1.5 || color.b > 0.8) { // Deepslate Diamond Ore:Diamond Part #include "/lib/materials/specificMaterials/terrain/diamondBlock.glsl" #ifdef GLOWING_ORE_DIAMOND emission = color.g + 1.5; overlayNoiseIntensity = 0.75, overlayNoiseEmission = 0.4; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Deepslate Diamond Ore:Deepslate Part, Deepslate Diamond Ore:DeepslateToDiamond part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else { if (mat < 10332) { // Amethyst Block, Budding Amethyst materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.r); highlightMult = factor * 3.0; color.rgb *= 0.7 + 0.3 * GetLuminance(color.rgb); #if GLOWING_AMETHYST >= 2 emission = dot(color.rgb, color.rgb) * 0.3; overlayNoiseEmission = 0.5; #endif #if ALTERNATIVE_AMETHYST_STYLE == 0 smoothnessG = 0.8 - factor * 0.3; smoothnessD = factor; #elif ALTERNATIVE_AMETHYST_STYLE == 1 smoothnessG = max(sqrt(1.0 - factor), 0.04); smoothnessD = factor * 2; color.rgb *= 1.75 - 0.4 * GetLuminance(color.rgb); color.g *= 0.85 * pow2(color.g); color.rgb = saturateColors(color.rgb, 0.6); #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 10336)*/ { // Amethyst Cluster, Amethyst Buds materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.r); smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.85; #if GLOWING_AMETHYST >= 1 #if defined GBUFFERS_TERRAIN && !defined IPBR_COMPATIBILITY_MODE vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos = abs(fract(worldPos) - vec3(0.5)); float maxBlockPos = max(blockPos.x, max(blockPos.y, blockPos.z)); emission = pow2(max0(1.0 - maxBlockPos * 1.85) * color.g) * 7.0; if (CheckForColor(color.rgb, vec3(254, 203, 230))) emission = pow(emission, max0(1.0 - 0.2 * max0(emission - 1.0))); color.g *= 1.0 - emission * 0.07; emission *= 1.3; #else emission = pow2(color.g + color.b) * 0.4; #endif overlayNoiseIntensity = 0.5; #endif #if ALTERNATIVE_AMETHYST_STYLE == 1 color.rgb = pow1_5(color.rgb); color.rgb *= 1.5; color.g *= 0.6; color.rgb = saturateColors(color.rgb, 0.7); #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } } else { if (mat < 10344) { if (mat < 10340) { // Emerald Block #include "/lib/materials/specificMaterials/terrain/emeraldBlock.glsl" #ifdef GLOWING_EMERALD_BLOCK emission = pow2(pow(color.g, 2.8)) * 3.0 + 0.3; color.rgb *= color.rgb; overlayNoiseIntensity = 0.5; #endif } else /*if (mat < 10344)*/ { // Emerald Ore float dif = GetMaxColorDif(color.rgb); if (dif > 0.25 || color.b > 0.85) { // Emerald Ore:Emerald Part #include "/lib/materials/specificMaterials/terrain/emeraldBlock.glsl" #ifdef GLOWING_ORE_EMERALD emission = 2.0; overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.3; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Emerald Ore:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } } else { if (mat < 10348) { // Deepslate Emerald Ore float dif = GetMaxColorDif(color.rgb); if (dif > 0.25 || color.b > 0.85) { // Deepslate Emerald Ore:Emerald Part #include "/lib/materials/specificMaterials/terrain/emeraldBlock.glsl" #ifdef GLOWING_ORE_EMERALD emission = 2.0; overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.3; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Deepslate Emerald Ore:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } else /*if (mat < 10352)*/ { // Azalea, Flowering Azalea #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; #if EMISSIVE_FLOWERS > 0 && EMISSIVE_FLOWERS_TYPE < 2 if (max(color.b, color.r * 0.7) > color.g) { emission = skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif } } } } else { if (mat < 10368) { if (mat < 10360) { if (mat < 10356) { // Lapis Block #include "/lib/materials/specificMaterials/terrain/lapisBlock.glsl" #ifdef EMISSIVE_LAPIS_BLOCK emission = pow2(dot(color.rgb, color.rgb)) * 10.0; overlayNoiseIntensity = 0.4, overlayNoiseEmission = 0.28; #endif } else /*if (mat < 10360)*/ { // Lapis Ore if (color.r != color.g) { // Lapis Ore:Lapis Part #include "/lib/materials/specificMaterials/terrain/lapisBlock.glsl" smoothnessG *= 0.5; smoothnessD *= 0.5; #ifdef GLOWING_ORE_LAPIS if (color.b - color.r > 0.2) { emission = 2.0; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Lapis Ore:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } } else { if (mat < 10364) { // Deepslate Lapis Ore if (color.r != color.g) { // Deepslate Lapis Ore:Lapis Part #include "/lib/materials/specificMaterials/terrain/lapisBlock.glsl" smoothnessG *= 0.5; smoothnessD *= 0.5; #ifdef GLOWING_ORE_LAPIS if (color.b - color.r > 0.2) { emission = 2.0; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; } #endif } else { // Deepslate Lapis Ore:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } else /*if (mat < 10368)*/ { // Quartz Block++ #include "/lib/materials/specificMaterials/terrain/quartzBlock.glsl" } } } else { if (mat < 10376) { if (mat < 10372) { // Nether Quartz Ore if (color.g != color.b) { // Nether Quartz Ore:Quartz Part #include "/lib/materials/specificMaterials/terrain/quartzBlock.glsl" #ifdef GLOWING_ORE_NETHERQUARTZ emission = pow2(color.b * 1.6); emission *= GLOWING_ORE_MULT; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else { // Nether Quartz Ore:Netherrack Part #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" } } else /*if (mat < 10376)*/ { // Obsidian #include "/lib/materials/specificMaterials/terrain/obsidian.glsl" } } else { if (mat < 10380) { // Purpur Block+ highlightMult = 2.0; smoothnessG = pow2(color.r) * 0.6; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } else /*if (mat < 10384)*/ { // 8 Layer Snow, Snow Block, Powder Snow #include "/lib/materials/specificMaterials/terrain/snow.glsl" overlayNoiseIntensity = 0.0; } } } } } } else { if (mat < 10448) { if (mat < 10416) { if (mat < 10400) { if (mat < 10392) { if (mat < 10388) { // Packed Ice materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.g); float factor2 = pow2(factor); smoothnessG = 1.0 - 0.5 * factor; highlightMult = factor2 * 3.5; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif #ifdef SSS_SNOW_ICE subsurfaceMode = 3, noSmoothLighting = true, noDirectionalShading = true; #endif } else /*if (mat < 10392)*/ { // Blue Ice materialMask = OSIEBCA; // Intense Fresnel float factor = min1(pow2(color.g) * 1.38); float factor2 = pow2(factor); smoothnessG = 1.0 - 0.5 * factor; highlightMult = factor2 * 3.5; smoothnessD = pow1_5(color.g); #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif #ifdef SSS_SNOW_ICE subsurfaceMode = 3, noSmoothLighting = true, noDirectionalShading = true; #endif } } else { if (mat < 10396) { // Pumpkin, Carved Pumpkin #include "/lib/materials/specificMaterials/terrain/pumpkin.glsl" } else /*if (mat < 10400)*/ { // Jack o'Lantern #include "/lib/materials/specificMaterials/terrain/pumpkin.glsl" noSmoothLighting = true, noDirectionalShading = true; lmCoordM.y = 0.0; lmCoordM.x = 1.0; #if MC_VERSION >= 11300 if (color.b > 0.28 && color.r > 0.9) { float factor = pow2(color.g); emission = pow2(factor) * factor * 5.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 1.5, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 1.5, colorEndBreath, 1.0); #endif } #else if (color.b < 0.4) emission = clamp01(color.g * 1.3 - color.r) * 5.0; #endif overlayNoiseIntensity = 0.3; #ifdef SPOOKY float noiseAdd = 0.0; #ifdef GBUFFERS_TERRAIN noiseAdd = hash13(mod(floor(worldPos + atMidBlock / 64) + frameTimeCounter * 0.000001, vec3(100))); #endif emission *= mix(0.0, 1.0, smoothstep(0.2, 0.9, texture2D(noisetex, vec2(frameTimeCounter * 0.025 + noiseAdd)).r)); #endif } } } else { if (mat < 10408) { if (mat < 10404) { // Sea Pickle:Not Waterlogged noSmoothLighting = true; overlayNoiseIntensity = 0.3; } else /*if (mat < 10408)*/ { // Sea Pickle:Waterlogged noSmoothLighting = true; overlayNoiseIntensity = 0.3; if (color.b > 0.5) { // Sea Pickle:Emissive Part #ifdef GBUFFERS_TERRAIN color.g *= 1.1; emission = 5.0; #endif } } } else { if (mat < 10412) { // Basalt+ smoothnessG = color.r * 0.45; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 10416)*/ { // Glowstone noSmoothLighting = true; noDirectionalShading = true; lmCoordM = vec2(0.9, 0.0); emission = max0(color.g - 0.3) * 4.6; color.rg += emission * vec2(0.15, 0.05); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif sandNoiseIntensity = 0.6, mossNoiseIntensity = 0.6; } } } } else { if (mat < 10432) { if (mat < 10424) { if (mat < 10420) { // Nether Bricks+ float factor = smoothstep1(min1(color.r * 1.5)); factor = factor > 0.12 ? factor : factor * 0.5; smoothnessG = factor; smoothnessD = factor; } else /*if (mat < 10424)*/ { // Red Nether Bricks+ float factor = color.r * 0.9; factor = color.r > 0.215 ? factor : factor * 0.25; smoothnessG = factor; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else { if (mat < 10428) { // Melon smoothnessG = color.r * 0.75; smoothnessD = color.r * 0.5; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 10432)*/ { // End Stone++, #include "/lib/materials/specificMaterials/terrain/endStone.glsl" } } } else { if (mat < 10440) { if (mat < 10436) { // Terracotta+ smoothnessG = 0.25; highlightMult = 1.5; smoothnessD = 0.17; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } else /*if (mat < 10440)*/ { // Glazed Terracotta+ smoothnessG = 0.75; smoothnessD = 0.35; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } } else { if (mat < 10444) { // Prismarine+, Prismarine Bricks+ smoothnessG = pow2(color.g) * 0.8; highlightMult = 1.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 10448)*/ { // Dark Prismarine+ smoothnessG = min1(pow2(color.g) * 2.0); highlightMult = 1.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } } } } else { if (mat < 10480) { if (mat < 10464) { if (mat < 10456) { if (mat < 10452) { // Sea Lantern noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = 0.85; smoothnessD = min1(max0(0.5 - color.r) * 2.0); smoothnessG = color.g; #ifndef IPBR_COMPATIBILITY_MODE float blockRes = absMidCoordPos.x * atlasSize.x; vec2 signMidCoordPosM = (floor((signMidCoordPos + 1.0) * blockRes) + 0.5) / blockRes - 1.0; float dotsignMidCoordPos = dot(signMidCoordPosM, signMidCoordPosM); float factor = pow2(max0(1.0 - 1.7 * pow2(pow2(dotsignMidCoordPos)))); #else float factor = pow2(pow2(min(dot(color.rgb, color.rgb), 2.5) / 2.5)); #endif emission = pow2(color.b) * 1.6 + 2.2 * factor; emission *= 0.4 + max0(0.6 - 0.006 * lViewPos); color.rb *= vec2(1.13, 1.1); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif overlayNoiseIntensity = 0.5; } else /*if (mat < 10456)*/ { // Magma Block noSmoothLighting = true; noDirectionalShading = true; lmCoordM = vec2(0.75, 0.0); if (color.g > 0.22) { // Emissive Part emission = pow2(pow2(color.r)) * 4.0; #if RAIN_PUDDLES >= 1 || defined SPOOKY_RAIN_PUDDLE_OVERRIDE noPuddles = color.g * 4.0; #endif color.gb *= max(2.0 - 11.0 * pow2(color.g), 0.5); maRecolor = vec3(emission * 0.075); overlayNoiseIntensity = 0.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif } else { // Netherrack Part #include "/lib/materials/specificMaterials/terrain/netherrack.glsl" emission = 0.2; } } } else { if (mat < 10460) { // Command Block+ color = texture2DLod(tex, texCoord, 0); vec2 coord = signMidCoordPos; float blockRes = absMidCoordPos.x * atlasSize.x; vec2 absCoord = abs(coord); float maxCoord = max(absCoord.x, absCoord.y); float dif = GetMaxColorDif(color.rgb); if ( // This mess exists because Iris' midCoord is slightly inaccurate dif > 0.1 && maxCoord < 0.375 && !CheckForColor(color.rgb, vec3(111, 73, 43)) && !CheckForColor(color.rgb, vec3(207, 166, 139)) && !CheckForColor(color.rgb, vec3(155, 139, 207)) && !CheckForColor(color.rgb, vec3(161, 195, 180)) && !CheckForColor(color.rgb, vec3(201, 143, 107)) && !CheckForColor(color.rgb, vec3(135, 121, 181)) && !CheckForColor(color.rgb, vec3(131, 181, 145)) ) { emission = 6.0; color.rgb *= color.rgb; highlightMult = 2.0; maRecolor = vec3(0.5); overlayNoiseIntensity = 0.1; } else { smoothnessG = dot(color.rgb, color.rgb) * 0.33; smoothnessD = smoothnessG; } } else /*if (mat < 10464)*/ { // Concrete+ except Lime smoothnessG = 0.4; highlightMult = 1.5; smoothnessD = 0.3; #ifdef COATED_TEXTURES noiseFactor = 0.2; #endif } } } else { if (mat < 10472) { if (mat < 10468) { // Concrete Powder+ smoothnessG = 0.2; smoothnessD = 0.1; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } else /*if (mat < 10472)*/ { // Coral Block+ #include "/lib/materials/specificMaterials/terrain/coral.glsl" // if (abs(color.r - color.g - color.b) < lColor * 0.49 || color.b > color.g) emission = (GetLuminance(color.rgb) - color.g * 0.6) * 2.5; } } else { if (mat < 10476) { // Coral Fan+, Coral+ noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/coral.glsl" isFoliage = false; } else /*if (mat < 10480)*/ { // Crying Obsidian #include "/lib/materials/specificMaterials/terrain/cryingObsidian.glsl" #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.7; } } } } else { if (mat < 10496) { if (mat < 10488) { if (mat < 10484) { // Blackstone++ #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" if (mat == 10483) { // Powered Blackstone Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10488)*/ { // Gilded Blackstone if (color.r > color.b * 3.0) { // Gilded Blackstone:Gilded Part #include "/lib/materials/specificMaterials/terrain/rawGoldBlock.glsl" #ifdef GLOWING_ORE_GILDEDBLACKSTONE emission = color.g * 1.5; emission *= GLOWING_ORE_MULT; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else { // Gilded Blackstone:Blackstone Part #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" } } } else { if (mat < 10492) { // Lily Pad noSmoothLighting = true; subsurfaceMode = 2; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif #ifdef IPBR float factor = min1(color.g * 2.0); smoothnessG = factor * 0.5; highlightMult = factor; #endif } else /*if (mat < 10496)*/ { // Dirt Path #include "/lib/materials/specificMaterials/terrain/dirt.glsl" #ifdef GBUFFERS_TERRAIN glColor.a = sqrt(glColor.a); #endif } } } else { if (mat < 10504) { if (mat < 10500) { // Torch noDirectionalShading = true; if (color.r > 0.95) { noSmoothLighting = true; lmCoordM.x = 1.0; emission = GetLuminance(color.rgb) * 4.1; #ifndef GBUFFERS_TERRAIN emission *= 0.65; #endif color.r *= 1.4; color.b *= 0.5; overlayNoiseIntensity = 0.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL if (color.g > 0.999) color.rgb = changeColorFunction(color.rgb, 1.5, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL if (color.g > 0.5) color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif } #ifdef GBUFFERS_TERRAIN else if (abs(NdotU) < 0.5) { #ifndef IPBR_COMPATIBILITY_MODE #if MC_VERSION >= 12102 // torch model got changed in 1.21.2 lmCoordM.x = min1(0.7 + 0.3 * smoothstep1(max0(0.4 - signMidCoordPos.y))); #else lmCoordM.x = min1(0.7 + 0.3 * pow2(1.0 - signMidCoordPos.y)); #endif #else lmCoordM.x = 0.82; #endif } #else else { color.rgb *= 1.5; } #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif emission += 0.0001; // No light reducing during noon } else /*if (mat < 10504)*/ { // End Rod noDirectionalShading = true; #ifdef GBUFFERS_TERRAIN noSmoothLighting = true; lmCoordM.x = 0.92; #else lmCoordM.x = 0.9; #endif float dotColor = dot(color.rgb, color.rgb); if (dotColor > 2.0) { emission = 3.3; emission *= 0.4 + max0(0.6 - 0.006 * lViewPos); vec2 noiseAdd = vec2(0.0); #if RAINBOW_END_ROD_COORD_OFFSET > 0 && defined GBUFFERS_TERRAIN noiseAdd = texture2D(noisetex, 0.00048 * (playerPos.xz + cameraPosition.xz)).rg; noiseAdd *= RAINBOW_END_ROD_COORD_OFFSET; #endif #if END_ROD_COLOR_PROFILE == 1 color.rgb = pow2(vec3(END_ROD_R, END_ROD_G, END_ROD_B) / 255) * END_ROD_I; #elif END_ROD_COLOR_PROFILE == 2 || (END_ROD_COLOR_PROFILE == 3 && defined OVERWORLD) color.rgb = pow2(getRainbowColor(noiseAdd, END_ROD_RAINBOW_ANIMATE)); #else color.rgb = pow2(color.rgb); color.g *= 0.95; #endif } #ifdef GBUFFERS_TERRAIN else { // Directional Self-light Effect vec3 fractPos = abs(fract(playerPos + cameraPosition) - 0.5); float maxCoord = max(fractPos.x, max(fractPos.y, fractPos.z)); if (maxCoord < 0.4376) { lmCoordM.x = 1.0; color.rgb *= 1.8; } } #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 4.0, lViewPos); #endif overlayNoiseIntensity = 0.3; } } else { if (mat < 10508) { // Chorus Plant } else /*if (mat < 10512)*/ { // Chorus Flower:Alive float dotColor = dot(color.rgb, color.rgb); if (dotColor > 1.0) { emission = pow2(pow2(pow2(dotColor * 0.33))) + 0.2 * dotColor; overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.6; } } } } } } } } } else { if (mat < 10768) { if (mat < 10640) { if (mat < 10576) { if (mat < 10544) { if (mat < 10528) { if (mat < 10520) { if (mat < 10516) { // Chorus Flower:Dead vec3 checkColor = texture2DLod(tex, texCoord, 0).rgb; if (CheckForColor(checkColor, vec3(164, 157, 126)) || CheckForColor(checkColor, vec3(201, 197, 176)) || CheckForColor(checkColor, vec3(226, 221, 188)) || CheckForColor(checkColor, vec3(153, 142, 95)) ) { emission = min(GetLuminance(color.rgb), 0.75) / 0.75; emission = pow2(pow2(emission)) * 6.5; color.gb *= 0.85; overlayNoiseIntensity = 0.1, overlayNoiseEmission = 0.8; } else emission = max0(GetLuminance(color.rgb) - 0.5) * 3.0; } else /*if (mat < 10520)*/ { // Furnace:Lit lmCoordM.x *= 0.95; #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" float dotColor = dot(color.rgb, color.rgb); emission = 2.5 * dotColor * max0(pow2(pow2(pow2(color.r))) - color.b) + pow(dotColor * 0.35, 32.0); color.r *= 1.0 + 0.1 * emission; if (color.r > color.b * 2.0 && dotColor > 0.7) { #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif overlayNoiseIntensity = 0.0; } } } else { if (mat < 10524) { // Cactus float factor = sqrt1(color.r); smoothnessG = factor * 0.5; highlightMult = factor; mossNoiseIntensity = 0.0, sandNoiseIntensity = 0.3; } else /*if (mat < 10528)*/ { // Note Block, Jukebox float factor = color.r * 0.5; smoothnessG = factor; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif if (mat == 10526) { // Powered Note Block redstoneIPBR(color.rgb, emission); } } } } else { if (mat < 10536) { if (mat < 10532) { // Soul Torch noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); if (color.b > 0.6) { emission = 2.7; color.rgb = pow1_5(color.rgb); color.r = min1(color.r + 0.1); overlayNoiseIntensity = 0.0; } emission += 0.0001; // No light reducing during noon #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(0.5, 1.0, 1.0, 1.0), emission, 3.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } else /*if (mat < 10536)*/ { // Brown Mushroom Block if (color.r > color.g && color.g > color.b && color.b > 0.37) { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } else { float factor = pow2(color.r) * color.r * 0.8; highlightMult = 1.5; smoothnessG = factor; smoothnessD = factor * 0.9; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } } else { if (mat < 10540) { // Red Mushroom Block if (color.r > color.g && color.g > color.b && color.b > 0.37) { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } else { float factor = min1(pow2(color.g) + 0.25); highlightMult = 1.5; smoothnessG = factor; smoothnessD = factor * 0.7; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } else /*if (mat < 10544)*/ { // Mushroom Stem, if (color.r > color.g && color.g > color.b && color.b < 0.6) { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } else { float factor = pow2(pow2(color.g)); highlightMult = 1.5; smoothnessG = factor; smoothnessD = factor * 0.5; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } } } } else { if (mat < 10560) { if (mat < 10552) { if (mat < 10548) { // Glow Lichen noSmoothLighting = true; #if GLOWING_LICHEN > 0 float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(dotColor) * dotColor) * 1.4 + dotColor * 0.9, 6.0); emission = mix(emission, dotColor * 1.5, min1(lViewPos / 96.0)); // Less noise in the distance #if GLOWING_LICHEN == 1 float skyLightFactor = pow2(1.0 - min1(lmCoord.y * 2.9)); emission *= skyLightFactor; color.r *= 1.0 + 0.15 * skyLightFactor; #else color.r *= 1.15; #endif #endif sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else /*if (mat < 10552)*/ { // Enchanting Table:Base float dotColor = dot(color.rgb, color.rgb); if (dotColor < 0.19 && color.r < color.b) { #include "/lib/materials/specificMaterials/terrain/obsidian.glsl" } else if (color.g >= color.r) { #include "/lib/materials/specificMaterials/terrain/diamondBlock.glsl" #ifdef EMISSIVE_ENCHANTING_TABLE emission = color.b + 0.4 + (1.0 - pow2(color.g)) * 0.8; #endif } else { smoothnessG = color.r * 0.3 + 0.1; } #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } } else { if (mat < 10556) { // End Portal Frame:Inactive noSmoothLighting = true; if (abs(color.r - color.g - 0.05) < 0.10) { #include "/lib/materials/specificMaterials/terrain/endStone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/endPortalFrame.glsl" } #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } else /*if (mat < 10560)*/ { // End Portal Frame:Active noSmoothLighting = true; if (abs(color.r - color.g - 0.05) < 0.10) { #include "/lib/materials/specificMaterials/terrain/endStone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/endPortalFrame.glsl" vec2 absCoord = abs(fract(playerPos.xz + cameraPosition.xz) - 0.5); float maxCoord = max(absCoord.x, absCoord.y); if (maxCoord < 0.2505) { // End Portal Frame:Eye of Ender smoothnessG = 0.5; smoothnessD = 0.5; emission = pow2(min(color.g, 0.25)) * 170.0 * (0.28 - maxCoord); overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; } else { float minCoord = min(absCoord.x, absCoord.y); if (CheckForColor(color.rgb, vec3(153, 198, 147)) && minCoord > 0.25) { // End Portal Frame:Emissive Corner Bits emission = 1.4; color.rgb = vec3(0.45, 1.0, 0.6); overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; } } } #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } } } else { if (mat < 10568) { if (mat < 10564) { // Lantern noSmoothLighting = true; lmCoordM.x = 0.77; #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" emission = 4.3 * max0(color.r - color.b); emission += min(pow2(pow2(0.75 * dot(color.rgb, color.rgb))), 5.0); color.gb *= pow(vec2(0.8, 0.7), vec2(sqrt(emission) * 0.5)); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.0; #ifdef SS_BLOCKLIGHT // fix lanterns with custom models emitting blue light if (emission < 0.01) emission = 0.0; #endif #if defined SOUL_SAND_VALLEY_OVERHAUL_INTERNAL || defined PURPLE_END_FIRE_INTERNAL if(color.g > color.b){ float uniformValue = 1.0; float gradient = 1.0; vec3 colorFire = vec3(0.0); #if defined NETHER #ifdef GBUFFERS_TERRAIN float lanternOffset = 0.0; if (mat == 10562) lanternOffset = 0.1; // Hanging Lantern gradient = mix(1.0, 0.0, clamp01(blockUV.y - lanternOffset + 3.0 * blockUV.y - lanternOffset)); #else gradient = 0.0; #endif uniformValue = inSoulValley; colorFire = colorSoul; #endif #ifdef END colorFire = colorEndBreath; #endif color.rgb = mix(color.rgb, mix(color.rgb, vec3(GetLuminance(color.rgb)), 0.88), uniformValue * gradient); color.rgb *= mix(vec3(1.0), colorFire * 2.0, uniformValue * gradient); } #endif } else /*if (mat < 10568)*/ { // Soul Lantern noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.77); // consistency748523 #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" emission = 1.45 * max0(color.g - color.r * 2.0); emission += 1.17 * min(pow2(pow2(0.55 * dot(color.rgb, color.rgb))), 3.5); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(0.5, 1.0, 1.0, 1.0), emission, 3.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } } else { if (mat < 10572) { // Turtle Egg, Sniffer Egg smoothnessG = (color.r + color.g) * 0.35; smoothnessD = (color.r + color.g) * 0.25; } else /*if (mat < 10576)*/ { // Dragon Egg #ifdef EMISSIVE_DRAGON_EGG emission = float(color.b > 0.1) * 10.0 + 1.25; #endif } } } } } else { if (mat < 10608) { if (mat < 10592) { if (mat < 10584) { if (mat < 10580) { // Smoker:Lit lmCoordM.x *= 0.95; float dotColor = dot(color.rgb, color.rgb); if (color.r > color.b * 2.0 && dotColor > 0.7) { emission = 2.5 * dotColor; color.r *= 1.5; overlayNoiseIntensity = 0.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif } else { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } } else /*if (mat < 10584)*/ { // Blast Furnace:Lit lmCoordM.x *= 0.95; float dotColor = dot(color.rgb, color.rgb); if (color.r > color.b * 2.0 && dotColor > 0.7) { emission = pow2(color.g) * (20.0 - 13.7 * float(color.b > 0.25)); color.r *= 1.5; overlayNoiseIntensity = 0.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif } else { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } } } else { if (mat < 10588) { // Coal Block smoothnessG = dot(color.rgb, vec3(0.5)); smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; } else /*if (mat < 10592)*/ { // Respawn Anchor:Unlit noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/cryingObsidian.glsl" emission += 0.2; #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } } } else { if (mat < 10600) { if (mat < 10596) { // Respawn Anchor:Lit noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/cryingObsidian.glsl" vec2 absCoord = abs(signMidCoordPos); if (NdotU > 0.9 && max(absCoord.x, absCoord.y) < 0.754) { // Portal highlightMult = 0.0; smoothnessD = 0.0; emission = pow2(color.r) * color.r * 16.0; maRecolor = vec3(0.0); overlayNoiseIntensity = 0.0; } else if (color.r + color.g > 1.3) { // Respawn Anchor:Glowstone Part emission = 4.5 * sqrt3(max0(color.r + color.g - 1.3)); } emission += 0.3; #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } else /*if (mat < 10600)*/ { // Redstone Wire:Lit #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" #if COLORED_LIGHTING_INTERNAL == 0 emission = pow2(min(color.r, 0.9)) * 4.0; #else vec3 colorP = color.rgb / glColor.rgb; emission = pow2((colorP.r + color.r) * 0.5) * 3.5; #endif color.gb *= 0.25; overlayNoiseIntensity = 0.0; } } else { if (mat < 10604) { // Redstone Wire:Unlit #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" overlayNoiseIntensity = 0.0; } else /*if (mat < 10608)*/ { // Redstone Torch noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); #include "/lib/materials/specificMaterials/terrain/redstoneTorch.glsl" emission += 0.0001; // No light reducing during noon #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.0, 0.0, 1.0), emission, 5.0, lViewPos); #endif overlayNoiseIntensity = 0.0; } } } } else { if (mat < 10624) { if (mat < 10616) { if (mat < 10612) { // Redstone Block #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" #ifdef EMISSIVE_REDSTONE_BLOCK emission = 0.75 + 3.0 * pow2(pow2(color.r)); color.gb *= 0.65; #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.5, sandNoiseIntensity = 0.5, mossNoiseIntensity = 0.5; #endif } else /*if (mat < 10616)*/ { // Redstone Ore:Unlit if (color.r - color.g > 0.2) { // Redstone Ore:Unlit:Redstone Part #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" #ifdef GLOWING_ORE_REDSTONE emission = color.r * pow1_5(color.r) * 4.0; overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.gb = mix(color.gb, color.gb * (1.0 - 0.9 * min1(GLOWING_ORE_MULT)), skyLightCheck); #else color.gb *= 1.0 - 0.9 * min1(GLOWING_ORE_MULT); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Redstone Ore:Unlit:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } } else { if (mat < 10620) { // Redstone Ore:Lit if (color.r - color.g > 0.2) { // Redstone Ore:Lit:Redstone Part #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" emission = pow2(color.r) * color.r * 5.5; color.gb *= 0.1; overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.5; } else { // Redstone Ore:Lit:Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } noSmoothLighting = true; } else /*if (mat < 10624)*/ { // Deepslate Redstone Ore:Unlit if (color.r - color.g > 0.2) { // Deepslate Redstone Ore:Unlit:Redstone Part #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" #ifdef GLOWING_ORE_REDSTONE emission = color.r * pow1_5(color.r) * 4.0; overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.gb = mix(color.gb, color.gb * (1.0 - 0.9 * min1(GLOWING_ORE_MULT)), skyLightCheck); #else color.gb *= 1.0 - 0.9 * min1(GLOWING_ORE_MULT); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Deepslate Redstone Ore:Unlit:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } } else { if (mat < 10632) { if (mat < 10628) { // Deepslate Redstone Ore:Lit if (color.r - color.g > 0.2) { // Deepslate Redstone Ore:Lit:Redstone Part #include "/lib/materials/specificMaterials/terrain/redstoneBlock.glsl" emission = pow2(color.r) * color.r * 6.0; color.gb *= 0.05; overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.5; } else { // Deepslate Redstone Ore:Lit:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } noSmoothLighting = true; } else /*if (mat < 10632)*/ { // Cave Vines:No Glow Berries subsurfaceMode = 1; lmCoordM.x *= 0.875; sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0, isFoliage = true; } } else { if (mat < 10636) { // Cave Vines:With Glow Berries subsurfaceMode = 1; lmCoordM.x *= 0.875; if (color.r > 0.64) { emission = color.r < 0.75 ? 2.5 : 8.0; color.rgb = color.rgb * vec3(1.0, 0.8, 0.6); isFoliage = false; } else { isFoliage = true; } sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else /*if (mat < 10640)*/ { // Redstone Lamp:Unlit materialMask = OSIEBCA; // Intense Fresnel smoothnessG = color.r * 0.5 + 0.2; float factor = pow2(smoothnessG); highlightMult = factor * 2.0 + 1.0; smoothnessD = min1(factor * 2.0); overlayNoiseIntensity = 0.3; } } } } } } else { if (mat < 10704) { if (mat < 10672) { if (mat < 10656) { if (mat < 10648) { if (mat < 10644) { // Redstone Lamp:Lit noDirectionalShading = true; lmCoordM.x = 0.84; materialMask = OSIEBCA; // Intense Fresnel smoothnessG = color.r * 0.35 + 0.2; float factor = pow2(smoothnessG); highlightMult = factor * 2.0 + 1.0; smoothnessD = min1(factor * 2.0); if (color.b > 0.1) { float dotColor = dot(color.rgb, color.rgb); #if MC_VERSION >= 11300 emission = pow2(dotColor) * 1.0; #else emission = dotColor * 1.2; #endif color.rgb = pow1_5(color.rgb); maRecolor = vec3(emission * 0.2); overlayNoiseIntensity = 0.3; } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 5.0, lViewPos); #endif } else /*if (mat < 10648)*/ { // Repeater, Comparator noSmoothLighting = true; #if ANISOTROPIC_FILTER > 0 color = texture2D(tex, texCoord); // Fixes artifacts color.rgb *= glColor.rgb; #endif vec3 absDif = abs(vec3(color.r - color.g, color.g - color.b, color.r - color.b)); float maxDif = max(absDif.r, max(absDif.g, absDif.b)); if (maxDif > 0.125 || color.b > 0.99) { // Redstone Parts if (color.r < 0.999 && color.b > 0.4) color.gb *= 0.5; // Comparator:Emissive Wire #include "/lib/materials/specificMaterials/terrain/redstoneTorch.glsl" overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.2; } else { // Quartz Base float factor = pow2(color.g) * 0.6; smoothnessG = factor; highlightMult = 1.0 + 2.5 * factor; smoothnessD = factor; } } } else { if (mat < 10652) { // Shroomlight noSmoothLighting = true; noDirectionalShading = true; lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(dotColor * 0.6))), 6.0) * 0.8 + 0.5; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif overlayNoiseIntensity = 0.3; } else /*if (mat < 10656)*/ { // Campfire:Lit #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); #ifdef LIGHTMAP_CURVES float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif #endif float dotColor = dot(color.rgb, color.rgb); if (color.r > color.b && color.r - color.g < 0.15 && dotColor < 1.4) { #include "/lib/materials/specificMaterials/terrain/oakWood.glsl" } else if (color.r > color.b || dotColor > 2.9) { noDirectionalShading = true; emission = 3.5; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; #if defined SOUL_SAND_VALLEY_OVERHAUL_INTERNAL || defined PURPLE_END_FIRE_INTERNAL float uniformValue = 1.0; vec3 colorFire = vec3(0.0); float gradient = 0.0; #if defined NETHER uniformValue = inSoulValley; colorFire = colorSoul; #ifdef GBUFFERS_TERRAIN gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.5 * blockUV.y)); #elif defined GBUFFERS_HAND float handUV = gl_FragCoord.y / viewHeight; gradient = mix(1.0, 0.0, handUV + 0.4); #endif #endif #ifdef END colorFire = colorEndBreath; #ifdef GBUFFERS_TERRAIN gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.07 - 1.1 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * blockUV.y))); #elif defined GBUFFERS_HAND float handUV = gl_FragCoord.y / viewHeight; gradient = mix(1.0, 0.0, clamp01(handUV + 0.3 - 1.3 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * handUV))); #endif #endif color.rgb = mix(color.rgb, mix(color.rgb, vec3(GetLuminance(color.rgb)), 0.88), uniformValue * gradient); color.rgb *= mix(vec3(1.0), colorFire * 2.0, uniformValue * gradient); #endif } } } } else { if (mat < 10664) { if (mat < 10660) { // Soul Campfire:Lit #if COLORED_LIGHTING_INTERNAL == 0 noSmoothLighting = true; #else #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); lmCoordM.x *= 0.95; #endif #endif float dotColor = dot(color.rgb, color.rgb); if (color.r > color.b) { #include "/lib/materials/specificMaterials/terrain/oakWood.glsl" } else if (color.g - color.r > 0.1 || dotColor > 2.9) { noDirectionalShading = true; emission = 2.1; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; } #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } else /*if (mat < 10664)*/ { // Campfire:Unlit, Soul Campfire:Unlit noSmoothLighting = true; if (color.r > color.b) { #include "/lib/materials/specificMaterials/terrain/oakWood.glsl" } } } else { if (mat < 10668) { // Observer if (color.r > 0.1 && color.g + color.b < 0.1) { #include "/lib/materials/specificMaterials/terrain/redstoneTorch.glsl" overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.15; } else { #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } } else if (mat < 10671) { // Wool+, Carpet+ except Lime, MV: Tripwire #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*(mat == )*/ { // Tripwire redstoneIPBR(color.rgb, emission); } } } } else { if (mat < 10688) { if (mat < 10680) { if (mat < 10676) { // Bone Block smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } else /*if (mat < 10680)*/ { // Barrel, Beehive, Bee Nest, Honeycomb Block #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } else { if (mat < 10684) { // Ochre Froglight float frogPow = 8.0; #include "/lib/materials/specificMaterials/terrain/froglights.glsl" overlayNoiseIntensity = 0.3; } else /*if (mat < 10688)*/ { // Verdant Froglight float frogPow = 16.0; #include "/lib/materials/specificMaterials/terrain/froglights.glsl" overlayNoiseIntensity = 0.3; } } } else { if (mat < 10696) { if (mat < 10692) { // Pearlescent Froglight float frogPow = 24.0; #include "/lib/materials/specificMaterials/terrain/froglights.glsl" overlayNoiseIntensity = 0.3; } else /*if (mat < 10696)*/ { // Reinforced Deepslate if (abs(color.r - color.g) < 0.01) { // Reinforced Deepslate:Deepslate Part #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } else { // Reinforced Deepslate:Sculk float boneFactor = max0(color.r * 1.25 - color.b); if (boneFactor < 0.0001) emission = 0.15; smoothnessG = min1(boneFactor * 1.7); smoothnessD = smoothnessG; } } } else { //#define INTENSE_DEEP_DARK if (mat < 10700) { // Sculk, Sculk Catalyst, Sculk Vein, Sculk Sensor:Unlit float boneFactor = max0(color.r * 1.25 - color.b); float sculkEmission = pow2(max0(color.g - color.r)) * 1.7; if (boneFactor < 0.0001) { overlayNoiseIntensity = 0.0; #ifdef INTENSE_DEEP_DARK emission = mix(sculkEmission, sculkEmission * 5.0, darknessFactor); #else emission = sculkEmission; #endif #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.501) + floor(playerPos.y + cameraPosition.y + 0.501); bpos = bpos * 0.01 + 0.003 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 6.0; #endif } smoothnessG = min1(boneFactor * 1.7); smoothnessD = smoothnessG; #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } else /*if (mat < 10704)*/ { // Sculk Shrieker float boneFactor = max0(color.r * 1.25 - color.b); if (boneFactor < 0.0001) { overlayNoiseIntensity = 0.0; float sculkEmission = pow2(max0(color.g - color.r)) * 2.0; #ifdef INTENSE_DEEP_DARK emission = mix(sculkEmission, sculkEmission * 3.0, darknessFactor); #else emission = sculkEmission; #endif #ifdef GBUFFERS_TERRAIN vec2 coordFactor = abs(fract(playerPos.xz + cameraPosition.xz) - 0.5); float coordFactorM = max(coordFactor.x, coordFactor.y); if (coordFactorM < 0.43) emission += color.g * 7.0; #endif } smoothnessG = min1(boneFactor * 1.7); smoothnessD = smoothnessG; #ifdef SNOWY_WORLD snowFactor = 0.0; #endif } } } } } else { if (mat < 10736) { if (mat < 10720) { if (mat < 10712) { if (mat < 10708) { // Sculk Sensor:Lit lmCoordM = vec2(0.0, 0.0); emission = pow2(max0(color.g - color.r)) * 7.0 + 0.7; overlayNoiseIntensity = 0.0; redstoneIPBR(color.rgb, emission); } else /*if (mat < 10712)*/ { // Spawner smoothnessG = color.b + 0.2; smoothnessD = smoothnessG; emission = 7.0 * float(CheckForColor(color.rgb, vec3(110, 4, 83))); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.15; } } else { if (mat < 10716) { // Tuff++ smoothnessG = color.r * 0.4; smoothnessD = smoothnessG; } else /*if (mat < 10720)*/ { // Clay highlightMult = 2.0; smoothnessG = pow2(pow2(color.g)) * 0.5; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG * 0.7; #ifdef GBUFFERS_TERRAIN DoOceanBlockTweaks(smoothnessD); #endif #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } } else { if (mat < 10728) { if (mat < 10724) { // Ladder noSmoothLighting = true; } else /*if (mat < 10728)*/ { // Gravel, Suspicious Gravel #include "/lib/materials/specificMaterials/terrain/stone.glsl" #ifdef GBUFFERS_TERRAIN DoOceanBlockTweaks(smoothnessD); #endif #ifdef COATED_TEXTURES noiseFactor = 1.25; #endif } } else { if (mat < 10732) { // Flower Pot, Potted Stuff:Without Subsurface noSmoothLighting = true; sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } else /*if (mat < 10736)*/ { // Potted Stuff:With Subsurface noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; #if defined GBUFFERS_TERRAIN && (EMISSIVE_FLOWERS > 0 || defined EMISSIVE_BLOOD_MOON_FLOWERS) if (mat == 10735 && blockUV.y > 0.4 && max(color.b, color.r * 1.3) > color.g) { // Potted Flowers isFoliage = false; #if EMISSIVE_FLOWERS > 0 emission = 2.0 * skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif #if EMISSIVE_FLOWERS_TYPE == 1 if (color.b < max(color.r, color.g * 1.1) * 0.95) emission = 0.0; #elif EMISSIVE_FLOWERS_TYPE == 2 if (color.r < max(color.b * 1.15, color.g * 1.1) * 0.95) emission = 0.0; #endif #else emission *= int(color.r > max(color.b * 1.15, color.g * 2.5) * 0.95) * getBloodMoon(moonPhase, sunVisibility); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif } } } } else { if (mat < 10752) { if (mat < 10744) { if (mat < 10738) { // Pitcher Crop noSmoothLighting = true; sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; #if EMISSIVE_FLOWERS > 0 && EMISSIVE_FLOWERS_TYPE < 2 if (max(color.b * 1.25, color.r * 0.91) > color.g) { // Flowers emission = 1.5 * skyLightCheck; #if EMISSIVE_FLOWERS == 2 emission = max(emission, rainFactor + 1.0 * rainFactor); #endif emission *= EMISSIVE_FLOWERS_STRENGTH; } #endif float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; } else { emission = 0.0; } } else if (mat < 10740) { // Structure Block, Jigsaw Block, Test Block, Test Instance Block float blockRes = absMidCoordPos.x * atlasSize.x; vec2 signMidCoordPosM = (floor((signMidCoordPos + 1.0) * blockRes) + 0.5) / blockRes - 1.0; float dotsignMidCoordPos = dot(signMidCoordPosM, signMidCoordPosM); float lBlockPosM = pow2(max0(1.0 - 1.125 * pow2(dotsignMidCoordPos))); emission = 2.5 * lBlockPosM + 1.0; color.rgb = mix(color.rgb, pow2(color.rgb), 0.5); overlayNoiseIntensity = 0.45, overlayNoiseEmission = 0.2; } else /*if (mat < 10744)*/ { // Chain noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.77); // consistency748523 #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" } } else { if (mat < 10748) { // Soul Sand, Soul Soil smoothnessG = color.r * 0.4; smoothnessD = color.r * 0.25; #if defined GBUFFERS_TERRAIN && defined EMISSIVE_SOUL_SAND if (mat == 10744) { vec3 playerPosM = playerPos + relativeEyePosition; if (length(playerPosM) < 3.0 && length(playerPosM.y) > 1.1) if (color.r < 0.26 && color.r > 0.257 && color.g < 0.2 && color.b < 0.17 && blockUV.y > 0.9999 // A lot of hardcoded stuff &&(blockUV.x > 0.625 && blockUV.z < 0.5 && blockUV.z > 0.375 || blockUV.x < 0.5 && blockUV.x > 0.25 && blockUV.z < 0.1875 || blockUV.x < 0.375 && blockUV.z > 0.8125)) { float randomPos = step(0.5, hash13(mod(floor(worldPos + atMidBlock / 64) + frameTimeCounter * 0.0001, vec3(100)))); vec2 flickerNoiseBlock = texture2D(noisetex, vec2(frameTimeCounter * 0.04)).rb; float noise = mix(1.0, min1(max(flickerNoiseBlock.r, flickerNoiseBlock.g) * 1.7), 0.6) * (clamp(3.0 / length(vec3(playerPosM.x * 1.5, playerPosM.y, playerPosM.z * 1.5)) - 1.0, 0.0, 0.25) * 2.0) * randomPos; color.rgb = changeColorFunction(color.rgb, 80.0, colorSoul, noise); emission = 4.0 * noise; overlayNoiseIntensity = 1.0 - noise; } } #endif } else /*if (mat < 10752)*/ { // Dried Kelp Block smoothnessG = pow2(color.b) * 0.8; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } } } else { if (mat < 10760) { if (mat < 10756) { // Bamboo if (absMidCoordPos.x > 0.005) subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; // No further material properties as bamboo jungles are already slow sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; } else /*if (mat < 10760)*/ { // Block of Bamboo, Bamboo Planks++ #include "/lib/materials/specificMaterials/planks/bambooPlanks.glsl" if (mat == 10759) { // Powered Bamboo Blocks redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10764) { // Cherry Planks++ #include "/lib/materials/specificMaterials/planks/cherryPlanks.glsl" if (mat == 10763) { // Powered Cherry Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10768)*/ { // Cherry Log, Cherry Wood if (color.g > 0.33) { // Cherry Log:Clean Part #include "/lib/materials/specificMaterials/planks/cherryPlanks.glsl" } else { // Cherry Log:Wood Part, Cherry Wood smoothnessG = pow2(color.r); smoothnessD = smoothnessG; } } } } } } } } else { if (mat < 10896) { if (mat < 10832) { if (mat < 10800) { if (mat < 10784) { if (mat < 10776) { if (mat < 10772) { // Torchflower #include "/lib/materials/specificMaterials/terrain/torchflower.glsl" } else /*if (mat < 10776)*/ { // Potted Torchflower noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { #include "/lib/materials/specificMaterials/terrain/torchflower.glsl" } } } else { if (mat < 10780) { // Crimson Fungus, Warped Fungus noSmoothLighting = true; if (color.r > 0.91) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); overlayNoiseIntensity = 0.5; } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; isFoliage = false; } else /*if (mat < 10784)*/ { // Potted Crimson Fungus, Potted Warped Fungus noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { if (color.r > 0.91) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); } } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } } } else { if (mat < 10792) { if (mat < 10788) { // Calibrated Sculk Sensor:Unlit #if ANISOTROPIC_FILTER == 0 vec4 checkColor = color; #else vec4 checkColor = texture2D(tex, texCoord); // Fixes artifacts #endif if (checkColor.r + checkColor.b > checkColor.g * 2.2 || checkColor.r > 0.99) { // Amethyst Part #if GLOWING_AMETHYST >= 1 #if defined GBUFFERS_TERRAIN && !defined IPBR_COMPATIBILITY_MODE vec2 absCoord = abs(signMidCoordPos); float maxBlockPos = max(absCoord.x, absCoord.y); emission = pow2(max0(1.0 - maxBlockPos) * color.g) * 5.4 + 1.2 * color.g; color.g *= 1.0 - emission * 0.07; color.rgb *= color.g; #else emission = pow2(color.g + color.b) * 0.32; #endif #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else { // Sculk Part float boneFactor = max0(color.r * 1.25 - color.b); if (boneFactor < 0.0001) emission = pow2(max0(color.g - color.r)); smoothnessG = min1(boneFactor * 1.7); smoothnessD = smoothnessG; } #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.0; } else /*if (mat < 10792)*/ { // Calibrated Sculk Sensor:Lit lmCoordM = vec2(0.0, 0.0); #if ANISOTROPIC_FILTER == 0 vec4 checkColor = color; #else vec4 checkColor = texture2D(tex, texCoord); // Fixes artifacts #endif if (checkColor.r + checkColor.b > checkColor.g * 2.2 || checkColor.r > 0.99) { // Amethyst Part lmCoordM.x = 1.0; #if GLOWING_AMETHYST >= 1 #if defined GBUFFERS_TERRAIN && !defined IPBR_COMPATIBILITY_MODE vec2 absCoord = abs(signMidCoordPos); float maxBlockPos = max(absCoord.x, absCoord.y); emission = pow2(max0(1.0 - maxBlockPos) * color.g) * 5.4 + 1.2 * color.g; color.g *= 1.0 - emission * 0.07; color.rgb *= color.g; #else emission = pow2(color.g + color.b) * 0.32; #endif #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else { // Sculk Part emission = pow2(max0(color.g - color.r)) * 7.0 + 0.7; } overlayNoiseIntensity = 0.0; redstoneIPBR(color.rgb, emission); } } else { if (mat < 10796) { // Oak Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" if (mat == 10795) { // Powered Oak Door redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10800)*/ { // Spruce Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/sprucePlanks.glsl" if (mat == 10799) { // Powered Spruce Door redstoneIPBR(color.rgb, emission); } } } } } else { if (mat < 10816) { if (mat < 10808) { if (mat < 10804) { // Birch Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/birchPlanks.glsl" if (mat == 10803) { // Powered Birch Door redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10808)*/ { // Jungle Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/junglePlanks.glsl" if (mat == 10807) { // Powered Jungle Door redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10812) { // Acacia Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/acaciaPlanks.glsl" if (mat == 10811) { // Powered Acacia Door redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10816)*/ { // Dark Oak Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" if (mat == 10815) { // Powered Dark Oak Door redstoneIPBR(color.rgb, emission); } } } } else { if (mat < 10824) { if (mat < 10820) { // Mangrove Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/mangrovePlanks.glsl" if (mat == 10819) { // Powered Mangrove Door redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10824)*/ { // Crimson Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/crimsonPlanks.glsl" if (mat == 10823) { // Powered Crimson Door redstoneIPBR(color.rgb, emission); } } } else { if (mat < 10828) { // Warped Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/warpedPlanks.glsl" if (mat == 10827) { // Powered Warped Door redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10832)*/ { // Bamboo Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/bambooPlanks.glsl" if (mat == 10831) { // Powered Bamboo Door redstoneIPBR(color.rgb, emission); } } } } } } else { if (mat < 10864) { if (mat < 10848) { if (mat < 10840) { if (mat < 10836) { // Cherry Door, Cherry Trapdoor noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/cherryPlanks.glsl" if (mat == 10835) { // Powered Cherry Door and Cherry Trapdoor redstoneIPBR(color.rgb, emission); } } else /*if (mat < 10840)*/ { // Brewing Stand #ifdef GBUFFERS_TERRAIN vec3 worldPos = playerPos + cameraPosition; vec3 fractPos = fract(worldPos.xyz); vec3 coordM = abs(fractPos.xyz - 0.5); float cLength = dot(coordM, coordM) * 1.3333333; cLength = pow2(1.0 - cLength); if (color.r + color.g > color.b * 3.0 && max(coordM.x, coordM.z) < 0.07) { emission = 2.5 * pow1_5(cLength); } else { lmCoordM.x = max(lmCoordM.x * 0.9, cLength); #include "/lib/materials/specificMaterials/terrain/cobblestone.glsl" } #else emission = max0(color.r + color.g - color.b * 1.8 - 0.3) * 2.2; #endif overlayNoiseIntensity = 0.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif } } else { if (mat < 10841) { // Lime Concrete smoothnessG = 0.4; highlightMult = 1.5; smoothnessD = 0.3; #ifdef COATED_TEXTURES noiseFactor = 0.2; #endif #ifdef GREEN_SCREEN_LIME materialMask = OSIEBCA * 240.0; // Green Screen Lime Blocks #endif } else if (mat < 10844) { // Blue Carpet, Blue Wool #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef BLUE_SCREEN materialMask = OSIEBCA * 239.0; // Blue Screen Blue Blocks #endif } else if (mat < 10846) { // Lime Carpet, Lime Wool, MV: Green stuff #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GREEN_SCREEN_LIME materialMask = OSIEBCA * 240.0; // Green Screen Lime Blocks #endif } else /*if (mat < 10847)*/ { // Blue Concrete smoothnessG = 0.4; highlightMult = 1.5; smoothnessD = 0.3; #ifdef COATED_TEXTURES noiseFactor = 0.2; #endif #ifdef BLUE_SCREEN materialMask = OSIEBCA * 239.0; // Blue Screen Blue Blocks #endif } } } else { if (mat < 10856) { if (mat < 10852) { // Crafter smoothnessG = pow2(color.b); smoothnessD = max(smoothnessG, 0.2); if (color.r > 2.5 * (color.g + color.b)) { emission = 4.0; color.rgb *= color.rgb; } } else /*if (mat < 10856)*/ { // Copper Bulb:BrighterOnes #include "/lib/materials/specificMaterials/terrain/copperBulb.glsl" } } else { if (mat < 10860) { // Copper Bulb:DimmerOnes #include "/lib/materials/specificMaterials/terrain/copperBulb.glsl" emission *= 0.85; } else /*if (mat < 10864)*/ { // Copper Door+, Copper Trapdoor+ noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" if (mat == 10863) { // Powered Copper Door+, Copper Trapdoor+ redstoneIPBR(color.rgb, emission); } } } } } else { if (mat < 10880) { if (mat < 10872) { if (mat < 10868) { // Copper Trapdoor+ #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" } else /*if (mat < 10872)*/ { // Trial Spawner:NotOminous:Active, Vault:NotOminous:Active smoothnessG = max0(color.b - color.r * 0.5); smoothnessD = smoothnessG; emission = max0(color.r - color.b) * 3.0; color.rgb = pow(color.rgb, vec3(1.0 + 0.5 * sqrt(emission))); } } else { if (mat < 10876) { // Trial Spawner:Inactive, Vault:Inactive smoothnessG = max0(color.b - color.r * 0.5); smoothnessD = smoothnessG; } else /*if (mat < 10880)*/ { // Trial Spawner:Ominous:Active, Vault:Ominous:Active float maxComponent = max(max(color.r, color.g), color.b); float minComponent = min(min(color.r, color.g), color.b); float saturation = (maxComponent - minComponent) / (1.0 - abs(maxComponent + minComponent - 1.0)); smoothnessG = max0(color.b - pow2(saturation) * 0.5) * 0.5 + 0.1; smoothnessD = smoothnessG; emission = saturation > 0.5 ? 4.0 : 0.0; color.rgb = pow(color.rgb, vec3(1.0 + (0.3 + 0.5 * color.r) * emission)); } } } else { if (mat < 10888) { if (mat < 10884) { // } else /*if (mat < 10888)*/ { // Weeping Vines, Twisting Vines noSmoothLighting = true; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif if (color.r > 0.91 && mat == 10884) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); } isFoliage = false; } } else { if (mat < 10891) { // Hay Block smoothnessG = pow2(color.r) * 0.5; highlightMult *= 1.5; smoothnessD = float(color.r > color.g * 2.0) * 0.3; } else /*if (mat < 10896)*/ { // Iron Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" color.rgb *= 0.9; if (mat == 10893) { // Powered Iron Door and Iron Trapdoor redstoneIPBR(color.rgb, emission); } } } } } } } else { if (mat < 10960) { if (mat < 10928) { if (mat < 10900) { // Iron Trapdoor #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" color.rgb *= 0.9; if (mat == 10899) { // Powered Iron Door and Iron Trapdoor redstoneIPBR(color.rgb, emission); } } else if (mat < 10923) { // Candles:Lit, Candle Cakes:Lit #include "/lib/materials/specificMaterials/terrain/candle.glsl" } else if (mat < 10924) { // Pale Hanging Moss subsurfaceMode = 3, centerShadowBias = true; noSmoothLighting = true; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif float factor = color.g; smoothnessG = factor * 0.5; highlightMult = factor * 4.0 + 2.0; float fresnel = clamp(1.0 + dot(normalM, normalize(viewPos)), 0.0, 1.0); highlightMult *= 1.0 - pow2(pow2(fresnel)); sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; } else /*if (mat < 10928)*/ { // } } else { if (mat < 10944) { if (mat < 10936) { if (mat < 10932) { // Pale Oak Planks++ #include "/lib/materials/specificMaterials/planks/paleOakPlanks.glsl" } else /*if (mat < 10936)*/ { // // Pale Oak Log, Pale Oak Wood if (color.g > 0.45) { // Pale Oak Log:Clean Part #include "/lib/materials/specificMaterials/planks/paleOakPlanks.glsl" } else { // Pale Oak Log:Wood Part, Pale Oak Wood #include "/lib/materials/specificMaterials/terrain/paleOakWood.glsl" } } } else { if (mat < 10940) { // Pale Oak Door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/paleOakPlanks.glsl" } else /*if (mat < 10944)*/ { // Resin++ smoothnessG = color.r * 0.25; smoothnessD = smoothnessG; } } } else { if (mat < 10952) { if (mat < 10948) { // Creaking Heart: Inactive #include "/lib/materials/specificMaterials/terrain/paleOakWood.glsl" } else /*if (mat < 10952)*/ { // Creaking Heart: Active #include "/lib/materials/specificMaterials/terrain/paleOakWood.glsl" if (color.r + color.g > color.b * 4.0) { emission = pow2(color.r) * 2.5 + 0.2; } } } else { if (mat < 10956) { // Snow: Layers 1 to 7 #include "/lib/materials/specificMaterials/terrain/snow.glsl" #if defined GBUFFERS_TERRAIN && defined TAA float snowFadeOut = 0.0; snowFadeOut = clamp01((playerPos.y) * 0.1); snowFadeOut *= clamp01((lViewPos - 64.0) * 0.01); if (dither + 0.25 < snowFadeOut) discard; #endif overlayNoiseIntensity = 0.0; } else /*if (mat < 10960)*/ { // Target Block: Inactive smoothnessG = pow2(color.r) * 0.5; smoothnessD = smoothnessG * 0.5; } } } } } else { if (mat < 10992) { if (mat < 10976) { if (mat < 10968) { if (mat < 10964) { // Target Block: Active smoothnessG = pow2(color.r) * 0.5; smoothnessD = smoothnessG * 0.5; if (color.r > color.g + color.b) { if (CheckForColor(color.rgb, vec3(220, 74, 74))) { emission = 5.0; color.rgb *= mix(vec3(1.0), pow2(color.rgb), 0.9); } else { emission = 3.0; color.rgb *= pow2(color.rgb); } } } else /*if (mat < 10968)*/ { // Sponge smoothnessG = pow2(color.g) * 0.2; smoothnessD = smoothnessG * 0.5; } } else { if (mat < 10972) { // Wet Sponge smoothnessG = color.g * 0.75; highlightMult = 0.3; smoothnessD = smoothnessG * 0.25; } else /*if (mat < 10976)*/ { // Firefly Bush subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif color.rgb *= 1.5; } } } else { if (mat < 10984) { if (mat < 10980) { // Open Eyeblossom #include "/lib/materials/specificMaterials/terrain/openEyeblossom.glsl" } else /*if (mat < 10984)*/ { // noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { #include "/lib/materials/specificMaterials/terrain/openEyeblossom.glsl" } } } else { if (mat < 10988) { // } else /*if (mat < 10992)*/ { // } } } } else { if (mat < 11008) { if (mat < 11000) { if (mat < 10996) { // } else /*if (mat < 11000)*/ { // } } else { if (mat < 11004) { // } else /*if (mat < 11008)*/ { // } } } else { if (mat < 11016) { if (mat < 11012) { // } else /*if (mat < 11016)*/ { // } } else { if (mat < 11020) { // } else /*if (mat < 11024)*/ { // } } } } } } } } } else { if (mat < 11112) { // No Properties Blocks isFoliage = false; } else if (mat > 20999 && mat < 21025) { #ifdef GBUFFERS_TERRAIN emission = DoAutomaticEmission(noSmoothLighting, noDirectionalShading, color.rgb, lmCoord.x, blockLightEmission, 1.0); #else bool doesNothing; emission = DoAutomaticEmission(noSmoothLighting, doesNothing, color.rgb, 0.0, 15, 1.0); #endif } else if (mat < 13312) { if (mat < 12800) { if (mat < 12544) { if (mat < 12416) { if (mat < 12352) { // block.12288 = vigil_candle noSmoothLighting = true; if ( CheckForColor(color.rgb, vec3(140, 161, 163)) || CheckForColor(color.rgb, vec3(116, 137, 145)) || CheckForColor(color.rgb, vec3(98, 119, 112)) || CheckForColor(color.rgb, vec3(180, 189, 189)) ) { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" if (mat % 2 == 0) lmCoordM.x *= 0.88; } else if (mat % 2 == 0) { vec3 originalColor = color.rgb; emission = 1.2 * max(color.r, max(color.g, color.b)); color.rgb *= pow(originalColor, vec3(0.7)); #ifdef GBUFFERS_TERRAIN if (abs(NdotU) < 0.1) { lmCoordM.x += 0.2 * (signMidCoordPos.y + 0.5); } #endif } #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } else /*if (mat < 12416)*/ { if (mat < 12384) { if (mat < 12368) { // block.12352 = corundum_clusters float factor; if (mat % 16 < 8) { factor = color.b; } else if (mat % 8 < 4) { factor = 0.8 * color.g + 0.2 * color.r; } else if (mat % 2 == 0) { factor = color.g; } else { factor = (color.r + color.b + color.g) / 3; } #include "/lib/materials/specificMaterials/terrain/corundumCluster.glsl" } else /*if (mat < 12384)*/ { if (mat < 12376) { if (mat < 12372) { // block.12368 = black_sand if (color.g - color.r > 0.06) { smoothnessG = pow(5.0 * color.r, 8); smoothnessG = min(smoothnessG, 0.05); smoothnessD = smoothnessG; highlightMult = 2.5; } else { smoothnessG = pow2(color.g); } #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #if RAIN_PUDDLES >= 1 || defined SPOOKY_RAIN_PUDDLE_OVERRIDE noPuddles = 1.0; #endif } else /*if (mat < 12376)*/ { // block.12372 = black_sand if (color.g - color.r > 0.06) { smoothnessG = pow(5.0 * color.r, 8); smoothnessG = min(smoothnessG, 0.05); smoothnessD = smoothnessG; highlightMult = 2.5; } else { smoothnessG = pow2(color.g); } #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #if RAIN_PUDDLES >= 1 || defined SPOOKY_RAIN_PUDDLE_OVERRIDE noPuddles = 1.0; #endif } } else /*if (mat < 12384)*/ { if (mat < 12380) { // block.12376 = blackstone_bulb emission = pow2(pow2(color.r)); } else /*if (mat < 12384)*/ { // block.12380 = brimstone smoothnessG = 0.3 * pow3(color.r); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } } } else /*if (mat < 12416)*/ { if (mat < 12400) { if (mat < 12392) { if (mat < 12388) { // block.12384 = burning_blossom subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; if (color.r > 0.78 || color.r - color.g > 0.1) { emission = 5.0 * color.r * color.g; color.rgb *= color.rgb; #ifdef GBUFFERS_TERRAIN lmCoordM.x += 0.5 - 0.7 * pow2(length(signMidCoordPos)); lmCoordM.x = min1(lmCoordM.x); #endif } sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else /*if (mat < 12392)*/ { // block.12388 = flesh const uint voxelNumbers[4] = uint[](356u, 357u, 358u, 359u); uint voxelNumber = voxelNumbers[mat % 4]; smoothnessG = 1.2 * color.r * (0.8 - color.r); smoothnessD = smoothnessG; if (mat % 4 == 1) { subsurfaceMode = 1, isFoliage = true; } } } else /*if (mat < 12400)*/ { if (mat < 12396) { // block.12392 = glowflower subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; emission = 2.0 * pow2(5.0 * max0(color.r - 0.8)); color.rgb = pow1_5(color.rgb); } else /*if (mat < 12400)*/ { // block.12396 = glowshroom if (color.b - color.r > 0.35) { emission = 2.0 * pow2(color.b); } else { lmCoordM.x *= 0.88; } } } } else /*if (mat < 12416)*/ { if (mat < 12408) { if (mat < 12404) { // block.12400 = glowworm_silk emission = 2.0 * pow2(pow2(pow2(color.b))) + color.r; if ((mat % 4 == 0 && color.r > 0.5) || (mat % 4 == 2 && color.r > 0.24)) { overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.8; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.001 + 0.001 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 10.0; #endif } sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else /*if (mat < 12408)*/ { // block.12404 = potted_burning_blossom noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; if (color.r > 0.78 || color.r - color.g > 0.1) { emission = 5.0 * color.r * color.g; color.rgb *= color.rgb; #ifdef GBUFFERS_TERRAIN lmCoordM.x += 0.5 - 0.7 * pow2(length(signMidCoordPos)); #endif } } } } else /*if (mat < 12416)*/ { if (mat < 12412) { // block.12408 = potted_glowflower noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; emission = 2.0 * pow2(5.0 * max0(color.r - 0.8)); color.rgb = pow1_5(color.rgb); } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } else /*if (mat < 12416)*/ { // block.12412 = potted_glowshroom noSmoothLighting = true; float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { if (color.b - color.r > 0.35) { emission = 3.0 * pow2(color.b); } else { lmCoordM.x *= 0.88; } } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } } } } } } else /*if (mat < 12544)*/ { if (mat < 12480) { if (mat < 12448) { if (mat < 12432) { if (mat < 12424) { if (mat < 12420) { // block.12416 = rose_quartz_block materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.g); highlightMult = factor * 3.0; color.rgb *= 0.7 + 0.3 * GetLuminance(color.rgb); //#if GLOWING_ALLURITE >= 2 // emission = dot(color.rgb, color.rgb) * 0.3; // overlayNoiseEmission = 0.5; //#endif smoothnessG = 0.8 - factor * 0.3; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 12424)*/ { // block.12420 = rose_quartz_cluster materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.b); smoothnessG = 1.0 - factor * 0.4; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; #if defined GBUFFERS_TERRAIN vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos = abs(fract(worldPos) - vec3(0.5)); float maxBlockPos = max(blockPos.x, max(blockPos.y, blockPos.z)); emission = pow2(max0(1.0 - maxBlockPos * 1.85) * color.b) * 7.0; color.b *= 1.0 - emission * 0.07; emission *= 1.3; overlayNoiseIntensity = 0.5; #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } else /*if (mat < 12432)*/ { if (mat < 12428) { // block.12424 = spider_egg if (color.r - color.b > 0.2) { emission = 0.7 * sqrt1(color.r) + 0.3; } } else /*if (mat < 12432)*/ { // block.12428 = cupric_candle #include "/lib/materials/specificMaterials/terrain/candle.glsl" } } } else /*if (mat < 12448)*/ { if (mat < 12440) { if (mat < 12436) { // block.12432 = ender_candle #include "/lib/materials/specificMaterials/terrain/candle.glsl" } else /*if (mat < 12440)*/ { // block.12436 = honeycomb_bricks smoothnessG = 0.5 * pow3(color.r); smoothnessD = smoothnessG; if (mat % 4 == 2) { smoothnessG *= 1.3 * sqrt1(color.r); smoothnessD = smoothnessG; highlightMult = 2.5; } } } else /*if (mat < 12448)*/ { if (mat < 12444) { // block.12440 = ender_candle #include "/lib/materials/specificMaterials/terrain/candle.glsl" } else /*if (mat < 12448)*/ { // block.12444 = azalea_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/blueAzaleaPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } } } else /*if (mat < 12480)*/ { if (mat < 12464) { if (mat < 12456) { if (mat < 12452) { // block.12448 = azalea_log if (color.b > color.r) { // Azalea Log:Clean Part #include "/lib/materials/specificMaterials/planks/blueAzaleaPlanks.glsl" } else { // Azalea Log:Wood Part, Azalea Wood smoothnessG = pow2(color.r) * 0.5; smoothnessD = smoothnessG; mossNoiseIntensity = 0.45; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else /*if (mat < 12456)*/ { // block.12452 = azalea_wood #include "/lib/materials/specificMaterials/planks/blueAzaleaPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } else /*if (mat < 12464)*/ { if (mat < 12460) { // block.12456 = brazier [silver] #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif float dotColor = dot(color.rgb, color.rgb); if (color.r - color.b > 0.1 || dotColor > 2.9) { noDirectionalShading = true; emission = 3.5; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; #if defined SOUL_SAND_VALLEY_OVERHAUL_INTERNAL || defined PURPLE_END_FIRE_INTERNAL float uniformValue = 1.0; vec3 colorFire = vec3(0.0); float gradient = 0.0; #if defined NETHER uniformValue = inSoulValley; colorFire = colorSoul; #ifdef GBUFFERS_TERRAIN gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.5 * blockUV.y)); #elif defined GBUFFERS_HAND float handUV = gl_FragCoord.y / viewHeight; gradient = mix(1.0, 0.0, handUV + 0.4); #endif #endif #ifdef END colorFire = colorEndBreath; #ifdef GBUFFERS_TERRAIN gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.07 - 1.1 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * blockUV.y))); #elif defined GBUFFERS_HAND float handUV = gl_FragCoord.y / viewHeight; gradient = mix(1.0, 0.0, clamp01(handUV + 0.3 - 1.3 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * handUV))); #endif #endif color.rgb = mix(color.rgb, mix(color.rgb, vec3(GetLuminance(color.rgb)), 0.88), uniformValue * gradient); color.rgb *= mix(vec3(1.0), colorFire * 2.0, uniformValue * gradient); #endif } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else /*if (mat < 12464)*/ { // block.12460 = copper_bars / copper_button #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" if (mat % 4 == 1) { noSmoothLighting = true; } else if (mat % 4 == 3) { redstoneIPBR(color.rgb, emission); } } } } else /*if (mat < 12480)*/ { if (mat < 12472) { if (mat < 12468) { // block.12464 = cupric_brazier [silver] #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif if (color.g - color.r > 0.1 || (color.r > 0.8 && color.g > color.r)) { noDirectionalShading = true; emission = 2.60; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else /*if (mat < 12472)*/ { // block.12468 = cupric_campfire #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif if (color.g - color.r > 0.1 || (color.r > 0.6 && color.g > color.r)) { noDirectionalShading = true; emission = 2.50; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/oakWood.glsl" } } } else /*if (mat < 12480)*/ { if (mat < 12476) { // block.12472 = cupric_fire noSmoothLighting = true, noDirectionalShading = true; emission = 1.90; color.rgb = pow1_5(color.rgb); overlayNoiseIntensity = 0.0; } else /*if (mat < 12480)*/ { // block.12476 = cupric_lantern noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.77); // consistency748523 #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" if (color.g > 0.65) { emission = 2.5 * pow2(color.g) + 0.5; } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 3.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } } } } } else /*if (mat < 12544)*/ { if (mat < 12512) { if (mat < 12496) { if (mat < 12488) { if (mat < 12484) { // block.12480 = cupric_torch noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); if (color.g - color.r > 0.1 || color.g > 0.7) { emission = 3.0; color.rgb = pow1_5(color.rgb); color.r = min1(color.r + 0.1); overlayNoiseIntensity = 0.0; } emission += 0.0001; // No light reducing during noon } else /*if (mat < 12488)*/ { // block.12484 = lapis_lamp #include "/lib/materials/specificMaterials/terrain/lapisBlock.glsl" if (color.r > 0.5) { emission = 3.0 * color.r; } } } else /*if (mat < 12496)*/ { if (mat < 12492) { // block.12488 = lava_lamp if ( CheckForColor(color.rgb, vec3(237, 72, 53)) || CheckForColor(color.rgb, vec3(253, 227, 117)) || CheckForColor(color.rgb, vec3(252, 198, 98)) || CheckForColor(color.rgb, vec3(252, 153, 88)) || CheckForColor(color.rgb, vec3(251, 106, 62)) || CheckForColor(color.rgb, vec3(200, 51, 43)) ) { #include "/lib/materials/specificMaterials/terrain/lava.glsl" emission *= 1.5; } else { lmCoordM.x *= 0.95; #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; if (mat % 4 == 2) fractPos.zxy = fractPos.xyz; if ( max(abs(fractPos.x), abs(fractPos.z)) > 0.25 && abs(fractPos.y) < 0.45 && abs(fractPos.y) > 0.35 ) { float dist = min( length(abs(fractPos.xz) - vec2(min(abs(fractPos.x), 0.25), 0.25)), length(abs(fractPos.xz) - vec2(0.25, min(abs(fractPos.z), 0.25))) ); lmCoordM.x += 40.0 * (0.45 - abs(fractPos.y)) * pow2(0.25 - dist); } #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 3.5, lViewPos); #endif } else /*if (mat < 12496)*/ { // block.12492 = lava_lamp_2 if ( CheckForColor(color.rgb, vec3(237, 72, 53)) || CheckForColor(color.rgb, vec3(253, 227, 117)) || CheckForColor(color.rgb, vec3(252, 198, 98)) || CheckForColor(color.rgb, vec3(252, 153, 88)) || CheckForColor(color.rgb, vec3(251, 106, 62)) || CheckForColor(color.rgb, vec3(200, 51, 43)) ) { #include "/lib/materials/specificMaterials/terrain/lava.glsl" emission *= 1.5; } else { lmCoordM.x *= 0.95; #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; fractPos.xzy = fractPos.xyz; if ( max(abs(fractPos.x), abs(fractPos.z)) > 0.25 && abs(fractPos.y) < 0.45 && abs(fractPos.y) > 0.35 ) { float dist = min( length(abs(fractPos.xz) - vec2(min(abs(fractPos.x), 0.25), 0.25)), length(abs(fractPos.xz) - vec2(0.25, min(abs(fractPos.z), 0.25))) ); lmCoordM.x += 40.0 * (0.45 - abs(fractPos.y)) * pow2(0.25 - dist); } #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 3.5, lViewPos); #endif } } } else /*if (mat < 12512)*/ { if (mat < 12504) { if (mat < 12500) { // block.12496 = necronium #include "/lib/materials/specificMaterials/terrain/necroniumBlock.glsl" } else /*if (mat < 12504)*/ { // block.12500 = rocky_dirt if (abs(color.r - color.b) < 0.02) { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/dirt.glsl" } } } else /*if (mat < 12512)*/ { if (mat < 12508) { // block.12504 = sanguine if (color.r > color.b) { #include "/lib/materials/specificMaterials/terrain/sanguineBlock.glsl" } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else /*if (mat < 12512)*/ { // block.12508 = silver_ore if (abs(color.b - color.r) > 0.05 || color.b > 0.8) { // Raw Silver Part #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_ORE_SILVER_C emission = 2.0 * pow1_5(color.b) + min(0.6 * color.r, 0.1); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Stone Part if (mat % 4 == 0) { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } } } } else /*if (mat < 12544)*/ { if (mat < 12528) { if (mat < 12520) { if (mat < 12516) { // block.12512 = soul_brazier [silver] float dotColor = dot(color.rgb, color.rgb); if (color.g - color.r > 0.1 || dotColor > 2.9) { noDirectionalShading = true; emission = 2.1; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else /*if (mat < 12520)*/ { // block.12516 = soul_silver_ore if (color.b > 0.4) { // Raw Silver Part #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_ORE_SOULSILVER emission = 2.0 * pow1_5(color.b) + min(0.6 * color.r, 0.1); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Soul Soil Part smoothnessG = color.r * 0.4; smoothnessD = color.r * 0.25; #if defined GBUFFERS_TERRAIN && defined EMISSIVE_SOUL_SAND vec3 playerPosM = playerPos + relativeEyePosition; if (length(playerPosM) < 3.0 && length(playerPosM.y) > 1.1) if ( color.r < 0.26 && color.r > 0.257 && color.g < 0.2 && color.b < 0.17 && blockUV.y > 0.9999 // A lot of hardcoded stuff && ( blockUV.x > 0.625 && blockUV.z < 0.5 && blockUV.z > 0.375 || blockUV.x < 0.5 && blockUV.x > 0.25 && blockUV.z < 0.1875 || blockUV.x < 0.375 && blockUV.z > 0.8125 ) ) { float randomPos = step(0.5, hash13(mod(floor(worldPos + atMidBlock / 64) + frameTimeCounter * 0.0001, vec3(100)))); vec2 flickerNoiseBlock = texture2D(noisetex, vec2(frameTimeCounter * 0.04)).rb; float noise = mix(1.0, min1(max(flickerNoiseBlock.r, flickerNoiseBlock.g) * 1.7), 0.6) * (clamp(3.0 / length(vec3(playerPosM.x * 1.5, playerPosM.y, playerPosM.z * 1.5)) - 1.0, 0.0, 0.25) * 2.0) * randomPos; color.rgb = changeColorFunction(color.rgb, 80.0, colorSoul, noise); emission = 4.0 * noise; overlayNoiseIntensity = 1.0 - noise; } #endif } } } else /*if (mat < 12528)*/ { if (mat < 12524) { // block.12520 = spiked_rail #if ANISOTROPIC_FILTER == 0 color = texture2DLod(tex, texCoord, 0); #endif noSmoothLighting = true; if (color.r > 0.1 && color.g + color.b < 0.1) { // Redstone Parts noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); if (color.r > 0.5) { color.rgb *= color.rgb; emission = 8.0 * color.r; overlayNoiseIntensity = 0.35, overlayNoiseEmission = 0.2; } else if (color.r > color.g * 2.0) { materialMask = OSIEBCA * 5.0; // Redstone Fresnel float factor = pow2(color.r); smoothnessG = 0.4; highlightMult = factor + 0.4; smoothnessD = factor * 0.7 + 0.3; } } else if (color.b > color.r) { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } else if (abs(color.r - color.b) < 0.15) { // Iron Parts #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" } else if (color.g > color.b * 2.0) { // Gold Parts #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } else { // Wood Parts #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" } } else /*if (mat < 12528)*/ { // block.12524 = spinel_block #include "/lib/materials/specificMaterials/terrain/spinelBlock.glsl" } } } else /*if (mat < 12544)*/ { if (mat < 12536) { if (mat < 12532) { // block.12528 = spinel_lamp #include "/lib/materials/specificMaterials/terrain/spinelBlock.glsl" if (color.g > 0.78) { emission = 3.0 * color.g; } } else /*if (mat < 12536)*/ { // block.12532 = spinel_ore if (color.r - color.g > 0.03) { // Raw Spinel Part #include "/lib/materials/specificMaterials/terrain/spinelBlock.glsl" #ifdef GLOWING_ORE_SPINEL emission = 0.45 * (1.6 * sqrt2(color.r) + 2.2 * pow2(color.r)); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Stone Part if (mat % 4 == 0) { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } } else /*if (mat < 12544)*/ { if (mat < 12540) { // block.12536 = sugilite materialMask = OSIEBCA; // Intense Fresnel float factor = 0.6 * pow2(pow2(color.r + color.b)); highlightMult = factor * 4.0; color.rgb *= 0.7 + 0.3 * GetLuminance(color.rgb); if (mat % 4 >= 2) factor *= 1.5; smoothnessG = factor * 0.3; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 12544)*/ { // block.12540 = acidian_lantern if (color.b < 0.4) { // obsidian part lmCoordM.x *= 0.88; #include "/lib/materials/specificMaterials/terrain/obsidian.glsl" } else { emission = 2.0 * (0.5 * color.b + color.g); color.rgb *= pow(color.rgb, vec3(0.1 * emission)); } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 3.0, lViewPos); #endif } } } } } } } else /*if (mat < 12800)*/ { if (mat < 12672) { if (mat < 12608) { if (mat < 12576) { if (mat < 12560) { if (mat < 12552) { if (mat < 12548) { // block.12544 = ender_brazier [silver] #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif if ( (color.r - color.g > 0.1 && color.b - color.g > 0.1) || (color.r > 0.85 && color.b > 0.85 && color.g > 0.85) ) { noDirectionalShading = true; emission = 3.50; color.rgb *= color.rgb; overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else /*if (mat < 12552)*/ { // block.12548 = ender_campfire #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif if ( (color.r - color.g > 0.1 && color.b - color.g > 0.1) || (color.r > 0.85 && color.b > 0.85 && color.g > 0.85) || CheckForColor(color.rgb, vec3(81, 56, 168)) ) { noDirectionalShading = true; emission = 3.50; color.rgb *= color.rgb; overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } } else /*if (mat < 12560)*/ { if (mat < 12556) { // block.12552 = ender_fire noSmoothLighting = true, noDirectionalShading = true; emission = 2.35; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; } else /*if (mat < 12560)*/ { // block.12556 = ender_lantern noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.77); // consistency748523 #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" if (color.b > 0.5) { emission = 2.5 * pow2(color.b) + 0.5; } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 3.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } } } else /*if (mat < 12576)*/ { if (mat < 12568) { if (mat < 12564) { // block.12560 = ender_torch noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); if (color.g - color.r > 0.1 || color.b > 0.8) { emission = 3.0; overlayNoiseIntensity = 0.0; } #ifdef GBUFFERS_TERRAIN else if (abs(NdotU) < 0.5) { #if MC_VERSION >= 12102 // torch model got changed in 1.21.2 lmCoordM.x = min1(0.7 + 0.3 * smoothstep1(max0(0.4 - signMidCoordPos.y))); #else lmCoordM.x = min1(0.7 + 0.3 * pow2(1.0 - signMidCoordPos.y)); #endif } #else else { color.rgb *= 1.5; } #endif emission += 0.0001; // No light reducing during noon } else /*if (mat < 12568)*/ { // block.12564 = eumus if (mat % 4 < 2) { smoothnessG = color.r * 0.1 + 0.1; smoothnessD = smoothnessG; if (color.g > 0.5) { #include "/lib/materials/specificMaterials/terrain/endstone.glsl" } } else { // bricks float factor = 1.5 * smoothstep1(clamp01(color.r * 2.5)); smoothnessG = pow2(factor); smoothnessD = smoothnessG; highlightMult = 1.5 * smoothnessG; } } } else /*if (mat < 12576)*/ { if (mat < 12572) { // block.12568 = mystical_obsidian if (color.g > 0.4 && abs(color.r - color.g) < 0.16) { // endstone #include "/lib/materials/specificMaterials/terrain/endstone.glsl" } else { // obsidian #include "/lib/materials/specificMaterials/terrain/obsidian.glsl" emission = color.r > 0.5 ? 2.7 * sqrt(color.r) : 0.0; overlayNoiseIntensity = 0.65; overlayNoiseEmission = 0.6; } } else /*if (mat < 12576)*/ { // block.12572 = poise_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/poisePlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } } } else /*if (mat < 12608)*/ { if (mat < 12592) { if (mat < 12584) { if (mat < 12580) { // block.12576 = poise_stem #include "/lib/materials/specificMaterials/planks/poisePlanks.glsl" if (mat % 4 == 2) { if (color.r < 0.4 || CheckForColor(color.rgb, vec3(124, 67, 125))) { lmCoordM.x *= 0.88; } else { emission = 2.0 * pow2(min1(color.r * 1.8)); color.rgb *= pow(color.rgb, vec3(emission * 0.4)); } } } else /*if (mat < 12584)*/ { // block.12580 = poise_wood #include "/lib/materials/specificMaterials/planks/poisePlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } else /*if (mat < 12592)*/ { if (mat < 12588) { // block.12584 = alluring_magnia if (mat % 4 < 3) { if (color.b < 0.99) { #include "/lib/materials/specificMaterials/terrain/alluringMagnia.glsl" } else { emission = 2.0 * color.r; color.rgb *= color.rgb; } } else { float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { #include "/lib/materials/specificMaterials/terrain/alluringMagnia.glsl" } } } else /*if (mat < 12592)*/ { // block.12588 = blinklamp smoothnessG = 0.7; smoothnessD = smoothnessG; emission = 2.0 * pow2(pow2(max(color.r, color.b))); color.rgb *= pow(color.rgb, vec3(0.5 * emission)); } } } else /*if (mat < 12608)*/ { if (mat < 12600) { if (mat < 12596) { // block.12592 = blinklight_vines const uint voxelNumbers[4] = uint[](185u, -1u, 186u, -1u); uint voxelNumber = voxelNumbers[mat % 4]; if (mat % 2 == 0 && ((color.r - color.g > 0.05 && color.b - color.r > 0.15) || color.b > 0.83)) { smoothnessG = 0.7; smoothnessD = smoothnessG; emission = 4.0 * pow2(pow2(min(color.r, color.b))); color.rgb *= color.rgb; } else { subsurfaceMode = 1, noDirectionalShading = true, noSmoothLighting = true; isFoliage = true; } } else /*if (mat < 12600)*/ { // block.12596 = bulb_flower if (color.r > 0.94) { emission = 1.3; color.rgb *= color.rgb; } #ifdef GBUFFERS_TERRAIN float temp = 0.4 + 0.3 * min1(pow2(max0(1.5 - length(signMidCoordPos - vec2(0.0, -0.5))))); lmCoordM.x = max(lmCoordM.x, min1(temp)); #endif } } else /*if (mat < 12608)*/ { if (mat < 12604) { // block.12600 = bulb_lantern noSmoothLighting = true; if (color.b - color.r < 0.1) { #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" } if (color.g - color.r < 0.05) { emission = 4.3 * max0(color.r - color.b); emission += min(pow2(pow2(0.75 * dot(color.rgb, color.rgb))), 4.7); color.gb *= pow(vec2(0.8, 0.7), vec2(sqrt(emission))); } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif #ifdef GBUFFERS_TERRAIN if (abs(NdotU) < 0.1 && color.g > 0.6) { // lantern side float factor = max0(1.4 - length(signMidCoordPos - vec2(0.0, 1.0))); lmCoordM.x += smoothstep1(0.4 * factor); } else if (NdotU < -0.9 && color.g > 0.8) { // lantern base float factor = max0(1.6 - length(signMidCoordPos)); lmCoordM.x += smoothstep1(factor); } #endif } else /*if (mat < 12608)*/ { // block.12604 = celestial_growth const uint voxelNumbers[4] = uint[](187u, 187u, 187u, 187u); uint voxelNumber = voxelNumbers[mat % 4]; subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; #ifdef GLOWING_CELESTIAL_GROWTHS if (color.r > 0.8) emission = 0.9 * sqrt(color.r); #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } } } } else /*if (mat < 12672)*/ { if (mat < 12640) { if (mat < 12624) { if (mat < 12616) { if (mat < 12612) { // block.12608 = chorus_flower #ifndef NOT_GLOWING_CHORUS_FLOWER vec3 checkColor = texture2DLod(tex, texCoord, 0).rgb; if ( CheckForColor(checkColor, vec3(164, 157, 126)) || CheckForColor(checkColor, vec3(201, 197, 176)) || CheckForColor(checkColor, vec3(226, 221, 188)) || CheckForColor(checkColor, vec3(153, 142, 95)) ) { emission = min(GetLuminance(color.rgb), 0.75) / 0.75; emission = pow2(pow2(emission)) * 6.5; color.gb *= 0.85; overlayNoiseIntensity = 0.1, overlayNoiseEmission = 0.8; } else emission = max0(GetLuminance(color.rgb) - 0.5) * 3.0; #endif } else /*if (mat < 12616)*/ { // block.12612 = chorus_sprouts subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; #ifndef NOT_GLOWING_CHORUS_FLOWER if (color.r < color.g * 1.2 || color.r > 0.78) { emission = 1.2; } #endif } } else /*if (mat < 12624)*/ { if (mat < 12620) { // block.12616 = corrupt_growth subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; emission = color.b > 0.4 ? 0.2 : 0.0; } else /*if (mat < 12624)*/ { // block.12620 = end_lamp vec2 coord = floor(signMidCoordPos * 8.0) / 8.0; emission = 0.6; color.rgb *= pow2(pow2(color.rgb)); #ifdef ANIMATED_END_LAMP float factor = color.b > 0.94 ? 0.5 : 0.0; color.rgb *= ((1 - factor) + factor * Noise3D(vec3(0.5 * coord, frameTimeCounter * 0.008))); lmCoordM.x = max(lmCoordM.x, 1.0); #endif smoothnessG = 1.5 * factor; smoothnessD = smoothnessG; highlightMult = 1.0 + 1.5 * factor; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif } } } else /*if (mat < 12640)*/ { if (mat < 12632) { if (mat < 12628) { // block.12624 = end_trial_spawner float maxComponent = max(max(color.r, color.g), color.b); float minComponent = min(min(color.r, color.g), color.b); float saturation = (maxComponent - minComponent) / (1.0 - abs(maxComponent + minComponent - 1.0)); smoothnessG = max0(color.b - pow2(saturation) * 0.5) * 0.5 + 0.1; smoothnessD = smoothnessG; emission = saturation > 0.5 ? 2.5 : 0.0; color.rgb = pow(color.rgb, vec3(1.0 + 0.75 * emission)); } else /*if (mat < 12632)*/ { // block.12628 = mirestone #include "/lib/materials/specificMaterials/terrain/mirestone.glsl" } } else /*if (mat < 12640)*/ { if (mat < 12636) { // block.12632 = nebulite_block #include "/lib/materials/specificMaterials/terrain/nebuliteBlock.glsl" } else /*if (mat < 12640)*/ { // block.12636 = nebulite_ore if (color.r > color.g * 1.5) { // Raw Nebulite Part #include "/lib/materials/specificMaterials/terrain/nebuliteBlock.glsl" #ifdef GLOWING_ORE_NEBULITE emission = 2.0 * sqrt(color.r); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Endstone / Mirestone Part if (mat % 4 == 0) { #include "/lib/materials/specificMaterials/terrain/endstone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/mirestone.glsl" } } } } } } else /*if (mat < 12672)*/ { if (mat < 12656) { if (mat < 12648) { if (mat < 12644) { // block.12640 = potted_blinklight_vines if (mat % 2 == 0 && ((color.r - color.g > 0.05 && color.b - color.r > 0.15) || color.b > 0.83)) { smoothnessG = 0.7; smoothnessD = smoothnessG; emission = 4.0 * pow2(pow2(min(color.r, color.b))); color.rgb *= color.rgb; } else { subsurfaceMode = 1, noDirectionalShading = true, noSmoothLighting = true; isFoliage = true; } } else /*if (mat < 12648)*/ { // block.12644 = potted_bulb_flower float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { if (color.r > 0.94) { emission = 1.0; color.rgb *= color.rgb; } #ifdef GBUFFERS_TERRAIN float temp = 0.4 + 0.3 * min1(pow2(max0(1.5 - length(signMidCoordPos - vec2(0.0, -0.5))))); lmCoordM.x = max(lmCoordM.x, min1(temp)); #endif } } } else /*if (mat < 12656)*/ { if (mat < 12652) { // block.12648 = potted_celestial_growth subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; #ifdef GLOWING_CELESTIAL_GROWTHS if (color.r > 0.8) emission = 0.9 * sqrt(color.r); #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 12656)*/ { // block.12652 = chorus_sprouts subsurfaceMode = 1, noDirectionalShading = true, isFoliage = true; #ifndef NOT_GLOWING_CHORUS_FLOWER if (color.r < color.g * 1.2 || color.r > 0.78) { emission = 1.2; } #endif } } } else /*if (mat < 12672)*/ { if (mat < 12664) { if (mat < 12660) { // block.12656 = raw_shadoline_block #include "/lib/materials/specificMaterials/terrain/rawShadolineBlock.glsl" } else /*if (mat < 12664)*/ { // block.12660 = repulsive_magnia if (mat % 4 < 3) { if (color.r < 0.8) { #include "/lib/materials/specificMaterials/terrain/repulsiveMagnia.glsl" } else { emission = 2.5 * color.g; color.rgb *= color.rgb; } } else { float NdotE = dot(normalM, eastVec); if (abs(abs(NdotE) - 0.5) < 0.4) { #include "/lib/materials/specificMaterials/terrain/repulsiveMagnia.glsl" } } } } else /*if (mat < 12672)*/ { if (mat < 12668) { // block.12664 = shadoline_block #include "/lib/materials/specificMaterials/terrain/shadolineBlock.glsl" } else /*if (mat < 12672)*/ { // block.12668 = shadoline_ore if (color.g < 0.42 || CheckForColor(color.rgb, vec3(120, 146, 140))) { // Raw Shadoline Part #include "/lib/materials/specificMaterials/terrain/rawShadolineBlock.glsl" } else { // Endstone / Mirestone Part if (mat % 4 == 0) { #include "/lib/materials/specificMaterials/terrain/endstone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/mirestone.glsl" } } } } } } } } else /*if (mat < 12800)*/ { if (mat < 12736) { if (mat < 12704) { if (mat < 12688) { if (mat < 12680) { if (mat < 12676) { // block.12672 = veradite smoothnessG = 0.5 * pow2(color.g) + 0.05; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 12680)*/ { // block.12676 = wisp_flower if (color.b > 0.95 && !CheckForColor(color.rgb, vec3(238, 235, 255))) { emission = 0.8 * (color.b - color.g) + 0.7; color.rgb = saturateColors(color.rgb, 1.5); } } } else /*if (mat < 12688)*/ { if (mat < 12684) { // block.12680 = crates vec2 absCoord = abs(signMidCoordPos); if ( (absCoord.x > 0.75 || absCoord.y > 0.75 && NdotU > 0.9) || ( NdotU < 0.1 && NdotU > -0.1 && absCoord.x < 0.75 && ( absCoord.y > 0.75 || (signMidCoordPos.y < -0.25 && signMidCoordPos.y > -0.50) || (signMidCoordPos.y > 0.0 && signMidCoordPos.y < 0.25) || signMidCoordPos.y > 0.50 ) ) || NdotU < -0.9 ) { #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" if (mat % 4 == 0) lmCoordM.x -= 0.1; } else { if (mat % 4 == 0) { subsurfaceMode = 1; lmCoordM.x *= 0.875; if (color.r > 0.64) { emission = color.r < 0.75 ? 2.5: 8.0; color.rgb = color.rgb * vec3(1.0, 0.8, 0.6); } } else if (mat % 4 == 2) { #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } } } else /*if (mat < 12688)*/ { // block.12684 = food_sack if (color.r > 0.7 && color.g > 0.7 && color.b > 0.7) { smoothnessG = pow(color.g, 16.0) * 2.0; smoothnessD = smoothnessG * 0.7; highlightMult = 2.0; } else { #include "/lib/materials/specificMaterials/terrain/sack.glsl" } } } } else /*if (mat < 12704)*/ { if (mat < 12696) { if (mat < 12692) { // block.12688 = rope const uint voxelNumbers[4] = uint[](360u, 361u, 362u, 363u); uint voxelNumber = voxelNumbers[mat % 4]; #include "/lib/materials/specificMaterials/terrain/sack.glsl" } else /*if (mat < 12696)*/ { // block.12692 = stove float dotColor = dot(color.rgb, color.rgb); if (color.r < 0.4 && color.b < 0.4 && color.g < 0.4) { #include "/lib/materials/specificMaterials/terrain/anvil.glsl" } else if (color.r > color.b * 2.0 && dotColor > 0.7) { emission = 2.5 * dotColor * max0(pow2(pow2(pow2(color.r))) - color.b) + pow(dotColor * 0.35, 32.0); color.r *= 1.0 + 0.1 * emission; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif overlayNoiseIntensity = 0.0; } else { smoothnessG = pow2(color.g); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } } else /*if (mat < 12704)*/ { if (mat < 12700) { // block.12696 = icy_trial_spawner float maxComponent = max(max(color.r, color.g), color.b); float minComponent = min(min(color.r, color.g), color.b); float saturation = (maxComponent - minComponent) / (1.0 - abs(maxComponent + minComponent - 1.0)); smoothnessG = max0(color.b - pow2(saturation) * 0.5) * 0.5 + 0.1; smoothnessD = smoothnessG; emission = saturation > 0.5 ? 4.5 : 0.0; color.rgb = pow(color.rgb, vec3(1.0 + 0.3 * emission)); } else /*if (mat < 12704)*/ { // block.12700 = sun_lichen float maxComponent = max(max(color.r, color.g), color.b); float minComponent = min(min(color.r, color.g), color.b); float saturation = (maxComponent - minComponent) / (1.0 - abs(maxComponent + minComponent - 1.0)); emission = (2.5 * saturation + 0.3) * color.r; emission *= mix(1.0, 0.1, min1(lViewPos / 96.0)); // fade-off into the distance color.rgb *= pow(color.rgb, vec3(0.1 + 0.2 * emission) * vec3(1.4, 1.0, 1.0)); smoothnessG = 0.1; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } } } } else /*if (mat < 12736)*/ { if (mat < 12720) { if (mat < 12712) { if (mat < 12708) { // block.12704 = allurite_block #include "/lib/materials/specificMaterials/terrain/alluriteBlock.glsl" } else /*if (mat < 12712)*/ { // block.12708 = allurite_cluster materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(0.6 * color.b + 0.4 * color.g); smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; #if GLOWING_ALLURITE >= 1 && defined GBUFFERS_TERRAIN vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos = abs(fract(worldPos) - vec3(0.5)); float maxBlockPos = max(blockPos.x, max(blockPos.y, blockPos.z)); emission = pow2(max0(1.0 - maxBlockPos * 1.85) * (0.8 * color.r + 0.2 * color.g)) * 7.0; color.r *= 1.0 - emission * 0.07; emission *= 1.3; overlayNoiseIntensity = 0.5; #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } else /*if (mat < 12720)*/ { if (mat < 12716) { // block.12712 = allurite_lamp materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(0.6 * color.b + 0.4 * color.g); smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; emission = pow2(0.8 * color.r + 0.2 * color.g) * 5.5; color.r *= 1.0 - emission * 0.09; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif } else /*if (mat < 12720)*/ { // block.12716 = amethyst_lamp materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.r); smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; emission = pow2(color.g) * 5.5; color.g *= 1.0 - emission * 0.09; overlayNoiseIntensity = 0.5; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif } } } else /*if (mat < 12736)*/ { if (mat < 12728) { if (mat < 12724) { // block.12720 = chandelier isFoliage = false; if (color.r - color.b > 0.35 || color.r < 0.4) { #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" } else { emission = 2.0 * color.r; } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif } else /*if (mat < 12728)*/ { // block.12724 = combustion_table if (color.b > 0.8) { // Silver Part #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } else { // Wood Part #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" } } } else /*if (mat < 12736)*/ { if (mat < 12732) { // block.12728 = cured_membrane smoothnessG = 0.5 * pow3(color.r); smoothnessD = smoothnessG; } else /*if (mat < 12736)*/ { // block.12732 = deepslate_silver_ore if (color.b / color.r > 1.2 || CheckForColor(color.rgb, vec3(177, 206, 206))) { // Raw Silver Part #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_ORE_SILVER_G emission = 0.6 * (sqrt2(color.b) + 1.2 * pow1_5(color.b)); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } } } } } else /*if (mat < 12800)*/ { if (mat < 12768) { if (mat < 12752) { if (mat < 12744) { if (mat < 12740) { // block.12736 = lichen_cordyceps if (mat % 4 == 1) { subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; } else { if (color.r > 0.8) { emission = 1.3 * pow2(color.r); color.rgb *= pow(color.rgb, vec3(0.3)); } else lmCoordM.x *= 0.92; } } else /*if (mat < 12744)*/ { // block.12740 = lichen_moss if (mat % 4 == 2) lmCoordM.x -= 0.1; if (color.r > 0.5 && mat % 2 == 0) { emission = 7.0 * pow2(pow2(color.r)); } smoothnessG = 0.10; smoothnessD = smoothnessG; mossNoiseIntensity = 0.8; if (mat % 2 == 1) { subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; sandNoiseIntensity = 0.8, mossNoiseIntensity = 0.0, isFoliage = true; } } } else /*if (mat < 12752)*/ { if (mat < 12748) { // block.12744 = lumiere_block #include "/lib/materials/specificMaterials/terrain/lumiereBlock.glsl" if (mat % 4 == 2) { // charged lumiere if (color.r > 0.6 && color.g > 0.6 && color.b > 0.4) { emission += 1.5 * pow2(color.r) + 0.1; color.rgb *= color.rgb; } } } else /*if (mat < 12752)*/ { // block.12748 = lumiere_cluster materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(0.8 * color.g + 0.2 * color.r); smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; #if GLOWING_LUMIERE >= 1 && defined GBUFFERS_TERRAIN vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos = abs(fract(worldPos) - vec3(0.5)); float maxBlockPos = max(blockPos.x, max(blockPos.y, blockPos.z)); emission = pow2(max0(1.0 - maxBlockPos * 1.85) * color.b) * 7.0; color.b *= 1.0 - emission * 0.07; emission *= 1.3; overlayNoiseIntensity = 0.5; #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } } else /*if (mat < 12768)*/ { if (mat < 12760) { if (mat < 12756) { // block.12752 = lumiere_composter vec3 worldPos = playerPos + cameraPosition; vec3 fractPos = fract(worldPos.xyz); vec2 coordM = abs(fractPos.xz - 0.5); if (max(coordM.x, coordM.y) < 0.375 && NdotU > 0.9) { #ifdef GLOWING_LUMIERE >= 1 emission = 1.3 * pow2(color.r) + 3.8 * pow2(pow2(color.r)); #endif smoothnessG = 3.0; smoothnessD = smoothnessG; } else { #include "/lib/materials/specificMaterials/planks/junglePlanks.glsl" } } else /*if (mat < 12760)*/ { // block.12756 = lumiere_lamp materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(0.8 * color.g + 0.2 * color.r); smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; emission = pow2(color.b) * 5.5; color.b *= 1.0 - emission * 0.09; overlayNoiseIntensity = 0.5; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif } } else /*if (mat < 12768)*/ { if (mat < 12764) { // block.12760 = monstrometer if (mat % 4 == 0) { vec2 absCoord = abs(signMidCoordPos); if (color.r / color.b > 2.0 && NdotU > 0.9) { #include "/lib/materials/specificMaterials/terrain/lumiereBlock.glsl" float yellow = 0.5 * color.r + 0.5 * color.g; emission = 2.1 * pow2(yellow) + 0.4; } else if ( absCoord.x < 0.5 && signMidCoordPos.y > -5/8.0 && signMidCoordPos.y < 0.25 && NdotU < 0.1 ) { // Lumiere Part #include "/lib/materials/specificMaterials/terrain/lumiereBlock.glsl" float yellow = 0.5 * color.r + 0.5 * color.g; emission = 2.1 * pow2(yellow) + 0.4; } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } else /*if (mat < 12768)*/ { // block.12764 = pink_salt #include "/lib/materials/specificMaterials/terrain/pinkSalt.glsl" } } } } else /*if (mat < 12800)*/ { if (mat < 12784) { if (mat < 12776) { if (mat < 12772) { // block.12768 = pink_salt_chamber #include "/lib/materials/specificMaterials/terrain/polishedPinkSalt.glsl" vec2 absCoord = abs(signMidCoordPos); if (absCoord.x < 0.2 && absCoord.y < 0.2 && CheckForColor(color.rgb, vec3(246, 216, 212))) { emission = 6.0; } } else /*if (mat < 12776)*/ { // block.12772 = pink_salt_cluster #include "/lib/materials/specificMaterials/terrain/pinkSalt.glsl" noSmoothLighting = true; lmCoordM.x *= 0.88; #if GLOWING_PINK_SALT >= 1 emission = pow2(color.g) * 2.0; color.g *= 1.0 - emission * 0.07; emission *= 1.3; #endif smoothnessG = pow2(color.g) * 2.0; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.5; } } else /*if (mat < 12784)*/ { if (mat < 12780) { // block.12776 = pink_salt_lamp #include "/lib/materials/specificMaterials/terrain/pinkSalt.glsl" emission = 2.1 * pow2(pow2((color.r + color.b + color.g) / 3.0)); float distance = pow2(signMidCoordPos.x) + pow2(signMidCoordPos.y); emission /= (1 + 1.2 * sqrt2(distance)); color.rgb *= (1 + 0.3 * color.rgb); overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.6; } else /*if (mat < 12784)*/ { // block.12780 = polished_pink_salt #include "/lib/materials/specificMaterials/terrain/polishedPinkSalt.glsl" } } } else /*if (mat < 12800)*/ { if (mat < 12792) { if (mat < 12788) { // block.12784 = raw_silver #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_RAW_BLOCKS emission = 0.6 * (sqrt2(color.b) + 1.2 * pow1_5(color.b)); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else /*if (mat < 12792)*/ { // block.12788 = shadow_frame if (color.b > 0.9) { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } else { smoothnessG = 0.5 * pow3(color.r); smoothnessD = smoothnessG; } } } else /*if (mat < 12800)*/ { if (mat < 12796) { // block.12792 = silver #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" if (mat % 4 == 3) { // medium weighted pressure plate redstoneIPBR(color.rgb, emission); } } else /*if (mat < 12800)*/ { // block.12796 = silver_lattice noSmoothLighting = true; if (color.g > 1.3 * color.b && color.r < 0.5) { #include "/lib/materials/specificMaterials/terrain/leaves.glsl" } else if (color.r > 0.5 && color.b < 0.5) { subsurfaceMode = 1; lmCoordM.x *= 0.875; emission = color.r < 0.75 ? 2.5 : 8.0; color.rgb = color.rgb * vec3(1.0, 0.8, 0.6); isFoliage = false; } else { #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } } } } } } } } else /*if (mat < 13312)*/ { if (mat < 13056) { if (mat < 12928) { if (mat < 12864) { if (mat < 12832) { if (mat < 12816) { if (mat < 12808) { if (mat < 12804) { // block.12800 = silver_ore if (color.b / color.r > 1.1) { // Raw Silver Part #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_ORE_SILVER_G emission = 0.6 * (sqrt2(color.b) + 1.2 * pow1_5(color.b)); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Stone Part #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } else /*if (mat < 12808)*/ { // block.12804 = warped_anchor if ( ( CheckForColor(color.rgb, vec3(38, 201, 190)) || CheckForColor(color.rgb, vec3(138, 255, 255)) || CheckForColor(color.rgb, vec3(36, 246, 216)) ) && NdotU < 0.1 ) { emission = 4.5; } else if (color.r / color.b < 0.6 || color.b > 0.9) { // Allurite Part emission = 2.5 * pow2(color.b) * sqrt(color.r); color.rgb *= sqrt1(GetLuminance(color.rgb)); smoothnessD = 0; smoothnessG = 0; } else { // Silver Part #include "/lib/materials/specificMaterials/terrain/silverBlock.glsl" } } } else /*if (mat < 12816)*/ { if (mat < 12812) { // block.12808 = gelatite smoothnessG = pow2((color.r + color.b) / 2) * 0.3; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 12816)*/ { // block.12812 = jelly smoothnessG = 0.5; smoothnessD = smoothnessG; highlightMult = 2.5; } } } else /*if (mat < 12832)*/ { if (mat < 12824) { if (mat < 12820) { // block.12816 = luminous_jelly smoothnessG = 0.5; smoothnessD = smoothnessG; highlightMult = 2.5; emission = dot(color.rgb, color.rgb) * 0.3; color.rgb *= color.rgb; } else /*if (mat < 12824)*/ { // block.12820 = blackstone_cabinet if (color.r > color.b * 3.0) { // Gilded Blackstone:Gilded Part #include "/lib/materials/specificMaterials/terrain/rawGoldBlock.glsl" #ifdef GLOWING_ORE_GILDEDBLACKSTONE emission = color.g * 1.5; emission *= GLOWING_ORE_MULT; overlayNoiseIntensity = 0.65, overlayNoiseEmission = 0.6; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; #endif #endif } else { // Gilded Blackstone:Blackstone Part #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" } } } else /*if (mat < 12832)*/ { if (mat < 12828) { // block.12824 = nether_stove lmCoordM.x *= 0.88; if (color.r - color.b > 0.1) { if (color.r < 0.28) { // nether bricks float factor = smoothstep1(min1(color.r * 1.5)); factor = factor > 0.12 ? factor : factor * 0.5; smoothnessG = factor; smoothnessD = factor; } else { // fire float dotColor = dot(color.rgb, color.rgb); emission = 2.5 * dotColor * max0(pow2(pow2(pow2(color.r))) - color.b) + pow(dotColor * 0.35, 32.0); color.r *= 1.0 + 0.1 * emission; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif overlayNoiseIntensity = 0.0; } } else if (color.b - color.r > 0.1 && color.b > 0.35) { emission = 1.5; color.rgb = pow1_5(color.rgb); } else if (abs(color.r - color.b) < 0.1) { // blackstone #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" } } else /*if (mat < 12832)*/ { // block.12828 = powdery_cane bool bloomed = mat % 4 == 2; #include "/lib/materials/specificMaterials/terrain/powderyCane.glsl" if (mat % 4 == 3) { // cane plants if (absMidCoordPos.x > 0.005) subsurfaceMode = 1, noSmoothLighting = true, noDirectionalShading = true; sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0, isFoliage = true; } } } } } else /*if (mat < 12864)*/ { if (mat < 12848) { if (mat < 12840) { if (mat < 12836) { // block.12832 = powdery_torch bool bloomed = true; #include "/lib/materials/specificMaterials/terrain/powderyCane.glsl" float temp = mat % 4 == 0 ? 1.0 : 1.5; lmCoordM.x = 0.9 * min1(0.7 + 0.3 * pow2(temp - signMidCoordPos.y - 2.0 * absMidCoordPos.x)); } else /*if (mat < 12840)*/ { // block.12836 = resurgent_soil if (mat % 4 == 2) lmCoordM.x *= 0.9; smoothnessG = color.r * 0.4; smoothnessD = color.r * 0.25; float factor = color.b / color.r; if (factor > 1.1) { #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.05 + 0.004 * frameTimeCounter; emission = 12.0 * pow2(texture2D(noisetex, bpos).r * pow2(texture2D(noisetex, bpos * 0.5).r)); emission *= factor; emission = min(emission, 5.0); #endif } } } else /*if (mat < 12848)*/ { if (mat < 12844) { // block.12840 = faars subsurfaceMode = 2, isFoliage = true; sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; smoothnessG = color.g * 0.35; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 12848)*/ { // block.12844 = nears subsurfaceMode = 2, isFoliage = true; if (color.b > color.r) { // purple stem smoothnessG = 0.2 + 0.4 * color.b; smoothnessD = smoothnessG; } else { // near #ifdef GLOWING_NEARS emission = color.r > 0.35 ? 3.0 * pow2(color.r) : 0.0; #endif smoothnessG = 0.4; smoothnessD = smoothnessG; } #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } } else /*if (mat < 12864)*/ { if (mat < 12856) { if (mat < 12852) { // block.12848 = soul_berry subsurfaceMode = 1; if (color.b - color.r > 0.1) { emission = 4.5 * (color.b + 0.4); color.rgb *= color.rgb; isFoliage = false; } else { isFoliage = true; } sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else /*if (mat < 12856)*/ { // block.12852 = ancient_burning_skull_block if ( color.r > 3.0 * color.b || (color.r > 0.9 && abs(color.g - color.b) < 0.1 && color.r + color.g + color.b < 2.6) || CheckForColor(color.rgb, vec3(251, 244, 207)) ) { emission = 4.00; color.rgb *= pow(GetLuminance(color.rgb), 0.3); } else { lmCoordM.x *= 0.88; if (mat % 4 < 2) { smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif } else { smoothnessG = color.r * 2.3; smoothnessD = smoothnessG; } #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } } else /*if (mat < 12864)*/ { if (mat < 12860) { // block.12856 = ancient_campfire if (color.r > 3.0 * color.b || (color.r > 0.9 && abs(color.g - color.b) < 0.1)) { noDirectionalShading = true; emission = 4.00; color.rgb *= pow(GetLuminance(color.rgb), 0.3); overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/oakWood.glsl" } } else /*if (mat < 12864)*/ { // block.12860 = ancient_candle noSmoothLighting = true; if (mat % 4 == 0) emission = 1.5 * max0(1.2 * color.b - color.r); color.rgb *= 1.0 + 0.7 * pow2(max(-signMidCoordPos.y + 0.8, float(NdotU > 0.9) * 1.6)); #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } } } } } else /*if (mat < 12928)*/ { if (mat < 12896) { if (mat < 12880) { if (mat < 12872) { if (mat < 12868) { // block.12864 = ancient_fire noDirectionalShading = true; emission = 4.00; color.rgb *= pow(GetLuminance(color.rgb), 0.3); overlayNoiseIntensity = 0.0; } else /*if (mat < 12872)*/ { // block.12868 = ancient_lantern noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.77); // consistency748523 #include "/lib/materials/specificMaterials/terrain/lanternMetal.glsl" if (color.r > 1.7 * color.b) { emission = 3.0 * pow2(color.r) + 0.5; } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } } else /*if (mat < 12880)*/ { if (mat < 12876) { // block.12872 = ancient_skeleton_skull_candle #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos.xyz + cameraPosition.xyz); if (fractPos.y < 0.5 && abs(NdotU) < 0.1) { // side of skull if ( color.r > 3.0 * color.b || (color.r > 0.9 && abs(color.g - color.b) < 0.1 && color.r + color.g + color.b < 2.6) || CheckForColor(color.rgb, vec3(251, 244, 207)) ) { emission = 4.00; color.rgb *= pow(GetLuminance(color.rgb), 0.3); } } else if (fractPos.y > 0.55) { // candle color.rgb *= 1.0 + 0.7 * pow2(max(0.6 - signMidCoordPos.y, float(NdotU > 0.9) * 1.6)); } #endif smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif } else /*if (mat < 12880)*/ { // block.12876 = ancient_torch noSmoothLighting = true; noDirectionalShading = true; lmCoordM.x = min(lmCoordM.x * 0.9, 0.77); if ( color.r > 3.0 * color.b || (color.r > 0.9 && abs(color.g - color.b) < 0.1) ) { emission = 3.0; overlayNoiseIntensity = 0.0; } #ifdef GBUFFERS_TERRAIN else if (abs(NdotU) < 0.5) { #if MC_VERSION >= 12102 // torch model got changed in 1.21.2 lmCoordM.x = min1(0.7 + 0.3 * smoothstep1(max0(0.4 - signMidCoordPos.y))); #else lmCoordM.x = min1(0.7 + 0.3 * pow2(1.0 - signMidCoordPos.y)); #endif } #else else { color.rgb *= 1.5; } #endif emission += 0.0001; // No light reducing during noon } } } else /*if (mat < 12896)*/ { if (mat < 12888) { if (mat < 12884) { // block.12880 = basaltic_geyser if (color.r - color.b > 0.1) { emission = 6.0 * dot(color.rgb, color.rgb); } else { smoothnessG = color.r * 0.35; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } if (mat % 4 == 0) { #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos.xyz + cameraPosition.xyz) - vec3(0.5); if (NdotU > 0.9) lmCoordM.x += 0.4 * smoothstep1(max0(1.0 - 2.0 * length(fractPos))); #endif } } else /*if (mat < 12888)*/ { // block.12884 = black_ice #include "/lib/materials/specificMaterials/terrain/blackIce.glsl" } } else /*if (mat < 12896)*/ { if (mat < 12892) { // block.12888 = brazier_chest if (color.r + color.b + color.g > 2.25) { // bone part smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } else if (mat % 4 == 0 && (color.r > 3.0 * color.b || (color.r > 0.9 && abs(color.g - color.b) < 0.1))) { noDirectionalShading = true; emission = 5.00; color.rgb *= color.rgb; overlayNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/soulSlate.glsl" } #ifdef GBUFFERS_TERRAIN if (mat % 4 == 0 && NdotU > 0.9) { lmCoordM.x *= 1.0 + 0.3 * smoothstep1(max0(1.0 - length(signMidCoordPos))); } #endif } else /*if (mat < 12896)*/ { // block.12892 = burning_skull_block if (color.r > 0.98 || color.r > 1.7 * color.g) { emission = 3.5; color.rgb *= sqrt1(GetLuminance(color.rgb)); } else { lmCoordM.x *= 0.8; if (mat % 4 < 2) { smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif } else { smoothnessG = color.r * 2.3; smoothnessD = smoothnessG; } #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } } } } else /*if (mat < 12928)*/ { if (mat < 12912) { if (mat < 12904) { if (mat < 12900) { // block.12896 = cerebrage_skull if (color.r - color.b > 0.1) { // cerebrage #include "/lib/materials/specificMaterials/terrain/cerebrage.glsl" } else { // bone smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } else /*if (mat < 12904)*/ { // block.12900 = claret_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/claretPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } else /*if (mat < 12912)*/ { if (mat < 12908) { // block.12904 = claret_hyphae if (color.r < color.g * 3.0) { // Cerebrage Claret Stem #include "/lib/materials/specificMaterials/terrain/cerebrage.glsl" subsurfaceMode = 0; } else { // Claret Wood #include "/lib/materials/specificMaterials/planks/claretPlanks.glsl" } } else /*if (mat < 12912)*/ { // block.12908 = claret_wood #include "/lib/materials/specificMaterials/planks/claretPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } } else /*if (mat < 12928)*/ { if (mat < 12920) { if (mat < 12916) { // block.12912 = ecto_soul_sand smoothnessG = color.r * 0.4; smoothnessD = color.r * 0.25; if (color.b > color.r) { emission = pow1_5(max0(2.0 * color.b - color.r)) + 0.1; emission *= mix(1.0, 0.0, min1(lViewPos / 64.0)); // fade-off into the distance color.rgb = pow1_5(color.rgb); } } else /*if (mat < 12920)*/ { // block.12916 = ectoplasm const uint voxelNumbers[4] = uint[](209u, 209u, 209u, 209u); uint voxelNumber = voxelNumbers[mat % 4]; lmCoordM = vec2(0.0); emission = smoothstep1(sqrt1(color.b)) + 0.2; emission *= 2.0; color.rgb *= pow(color.rgb, vec3(0.5 + 0.3 * emission)); #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 4.5, lViewPos); #endif sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; #if ECTOPLASM_EDGE_EFFECT > 0 float easeAmount = 1.5; vec3 edgeColor = vec3(0.15, 0.6, 0.7) * 3.25; float edgeEmission = 0.8 + emission * 1.2; #if ECTOPLASM_EDGE_EFFECT == 2 edgeColor *= 0.08; edgeEmission = 0.5; easeAmount = 1.2; #endif #include "/lib/materials/specificMaterials/terrain/fluidEdgeEffect.glsl" #endif } } else /*if (mat < 12928)*/ { if (mat < 12924) { // block.12920 = glowcheese if (color.r > 0.77 && color.r < color.g * 2.0) { emission = pow2(color.r) + pow2(color.g); } } else /*if (mat < 12928)*/ { // block.12924 = nether_wart_beard subsurfaceMode = 1, isFoliage = true; smoothnessG = color.r * 0.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (color.r > 0.6) { // Nether Wart Block overlayNoiseEmission = 0.28; emission = 16.0 * color.g; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif } #endif } } } } } } else /*if (mat < 13056)*/ { if (mat < 12992) { if (mat < 12960) { if (mat < 12944) { if (mat < 12936) { if (mat < 12932) { // block.12928 = nether_wart_block smoothnessG = color.r * 0.5; smoothnessD = smoothnessG; #ifdef MOD_NETHEREXP if (color.r > 0.75) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); } #endif #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (color.r > 0.6) { // Nether Wart Block overlayNoiseEmission = 0.28; emission = 16.0 * color.g; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif } #endif } else /*if (mat < 12936)*/ { // block.12932 = soul_slate #include "/lib/materials/specificMaterials/terrain/soulSlate.glsl" if (mat % 4 == 2) { lmCoordM.x *= 0.9; } } } else /*if (mat < 12944)*/ { if (mat < 12940) { // block.12936 = rusty_netherite smoothnessG = pow2(color.r); smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 1.5; #endif } else /*if (mat < 12944)*/ { // block.12940 = rusty_netherite_grate smoothnessG = pow2(color.r); smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 1.5; #endif } } } else /*if (mat < 12960)*/ { if (mat < 12952) { if (mat < 12948) { // block.12944 = shroomnight noSmoothLighting = true; noDirectionalShading = true; lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(pow2(dotColor * 0.5)))), 5.0) * 0.4; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif overlayNoiseIntensity = 0.3; } else /*if (mat < 12952)*/ { // block.12948 = skeleton_skull_candle #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos.xyz + cameraPosition.xyz); if (fractPos.y < 0.5 && abs(NdotU) < 0.1) { // side of skull if (color.r > 0.98 || color.r > 1.7 * color.g) { emission = 4.0; color.rgb *= sqrt1(GetLuminance(color.rgb)); } } else if (fractPos.y > 0.55) { // candle color.rgb *= 1.0 + 0.3 * pow2(max(0.5 - signMidCoordPos.y, float(NdotU > 0.9) * 1.6)); } #endif smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif } } else /*if (mat < 12960)*/ { if (mat < 12956) { // block.12952 = sorrowsquatch smoothnessG = color.g * 0.05; smoothnessD = smoothnessG; if (mat % 4 == 2 && color.b - color.r > 0.1) { emission = 2.1; color.rgb *= sqrt1(GetLuminance(color.rgb)); } } else /*if (mat < 12960)*/ { // block.12956 = soul_burning_skull_block if (color.b - color.r > 0.15 || color.b > 0.98) { emission = 2.1; color.rgb *= sqrt1(GetLuminance(color.rgb)); } else { lmCoordM.x *= 0.88; if (mat % 4 < 2) { smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif } else { smoothnessG = color.r * 2.3; smoothnessD = smoothnessG; } #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } } } } else /*if (mat < 12992)*/ { if (mat < 12976) { if (mat < 12968) { if (mat < 12964) { // block.12960 = soul_candle noSmoothLighting = true; if (mat % 4 == 0) emission = 1.5 * max0(1.2 * color.b - color.r); color.rgb *= 1.0 + 0.7 * pow2(max(-signMidCoordPos.y + 0.8, float(NdotU > 0.9) * 1.6)); #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } else /*if (mat < 12968)*/ { // block.12964 = soul_magma smoothnessG = color.r * 0.4; smoothnessD = color.r * 0.25; if (color.b - color.r > 0.1) { float dotColor = dot(color.rgb, color.rgb); emission = 1.3 * dotColor; color.rgb *= color.rgb; } } } else /*if (mat < 12976)*/ { if (mat < 12972) { // block.12968 = soul_skeleton_skull_candle #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos.xyz + cameraPosition.xyz); if (fractPos.y < 0.5 && abs(NdotU) < 0.1) { // side of skull if (color.b - color.r > 0.15 || color.b > 0.98) { emission = 2.1; color.rgb *= sqrt1(GetLuminance(color.rgb)); } } else if (fractPos.y > 0.55) { // candle color.rgb *= 1.0 + 0.7 * pow2(max(0.6 - signMidCoordPos.y, float(NdotU > 0.9) * 1.6)); } #endif smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif } else /*if (mat < 12976)*/ { // block.12972 = soul_slate #include "/lib/materials/specificMaterials/terrain/soulSlate.glsl" if (mat % 4 == 2) { lmCoordM.x *= 0.9; } } } } else /*if (mat < 12992)*/ { if (mat < 12984) { if (mat < 12980) { // block.12976 = soul_swirls subsurfaceMode = 1, isFoliage = true; if (color.b > color.r) { float dotColor = dot(color.rgb, color.rgb); emission = 0.7 * dotColor; } sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else /*if (mat < 12984)*/ { // block.12980 = treacherous_candle if (mat % 4 == 0) { #ifdef GBUFFERS_TERRAIN lmCoordM.x += 0.8 * NdotU * max0(0.3 - length(absMidCoordPos)); #endif } } } else /*if (mat < 12992)*/ { if (mat < 12988) { // block.12984 = twisting_vines const uint voxelNumbers[4] = uint[](212u, -1u, 213u, -1u); uint voxelNumber = voxelNumbers[mat % 4]; noSmoothLighting = true; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif if (color.r > color.g) { emission = 1.5 * color.b; } else if (color.r > 0.4) { emission = pow2(color.r); maRecolor = vec3(0.1); #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.501) + floor(playerPos.y + cameraPosition.y + 0.501); bpos = bpos * 0.01 + 0.004 * frameTimeCounter; emission *= texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r); emission *= 16.0; #endif } isFoliage = false; } else /*if (mat < 12992)*/ { // block.12988 = warped_fungus noSmoothLighting = true; #ifdef MOD_NETHEREXP if (color.r > 0.73 && color.b > 0.73) { emission = 1.5 * color.b; overlayNoiseIntensity = 0.5; } #endif if (color.r > 0.91) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); overlayNoiseIntensity = 0.5; } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; isFoliage = false; } } } } } else /*if (mat < 13056)*/ { if (mat < 13024) { if (mat < 13008) { if (mat < 13000) { if (mat < 12996) { // block.12992 = warped_wart_beard subsurfaceMode = 1; smoothnessG = color.g * 0.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (color.g > 0.7) { // Warped Wart Block overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.8; emission = 2.4; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif } #endif } else /*if (mat < 13000)*/ { // block.12996 = warped_wart_block smoothnessG = color.g * 0.5; smoothnessD = smoothnessG; #ifdef MOD_NETHEREXP if (color.r > 0.7) { emission = 1.5 * color.b; overlayNoiseIntensity = 0.5; } #endif #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (color.g > 0.7) { // Warped Wart Block overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.8; emission = 2.4; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif } #endif } } else /*if (mat < 13008)*/ { if (mat < 13004) { // block.13000 = weeping_vines const uint voxelNumbers[4] = uint[](65u, 65u, 65u, 65u); uint voxelNumber = voxelNumbers[mat % 4]; #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif if (color.r > 0.91) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); } isFoliage = false; } else /*if (mat < 13008)*/ { // block.13004 = electrum #include "/lib/materials/specificMaterials/terrain/electrumBlock.glsl" } } } else /*if (mat < 13024)*/ { if (mat < 13016) { if (mat < 13012) { // block.13008 = glance smoothnessG = pow2(pow2(color.b)) * 3.0; smoothnessD = smoothnessG; } else /*if (mat < 13016)*/ { // block.13012 = goopy_lead float emissiveness = 3.5; #include "/lib/materials/specificMaterials/terrain/moltenLead.glsl" } } else /*if (mat < 13024)*/ { if (mat < 13020) { // block.13016 = lead #include "/lib/materials/specificMaterials/terrain/leadBlock.glsl" if (mat % 4 == 2) { smoothnessG *= 0.5; smoothnessD *= 0.5; emission = GetLuminance(color.rgb) * 3.0; emission += pow2(color.b) * 0.7; } } else /*if (mat < 13024)*/ { // block.13020 = lead_bolt_crate if (color.r > color.b) { #include "/lib/materials/specificMaterials/planks/birchPlanks.glsl" } else { #include "/lib/materials/specificMaterials/terrain/leadBlock.glsl" } } } } } else /*if (mat < 13056)*/ { if (mat < 13040) { if (mat < 13032) { if (mat < 13028) { // block.13024 = lead_bulb #include "/lib/materials/specificMaterials/terrain/leadBlock.glsl" lmCoordM.x *= 0.85; if (color.b > 0.4) { lmCoordM.x = 1.0; emission = (pow1_5(color.b) - 0.3 * color.b) * 2.0 + 1.0; color.rgb *= color.rgb; color.r *= 1.2; } } else /*if (mat < 13032)*/ { // block.13028 = lead_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/leadBlock.glsl" if (mat % 2 == 0) { if (mat % 4 == 0) { smoothnessG *= 0.5; smoothnessD *= 0.5; emission = GetLuminance(color.rgb) * 3.0; emission += pow2(color.b) * 0.7 + 0.1; } else { smoothnessG = 0.0; smoothnessD = 0.0; float emissiveness = 6.0; #include "/lib/materials/specificMaterials/terrain/moltenLead.glsl" color.rgb *= 1.1 - 0.1 * GetLuminance(color.rgb); } } } } else /*if (mat < 13040)*/ { if (mat < 13036) { // block.13032 = lead_ore if (abs(color.b - color.r) > 0.04) { // Raw Lead Part #include "/lib/materials/specificMaterials/terrain/rawLeadBlock.glsl" #ifdef GLOWING_ORE_LEAD emission = 3.0 * sqrt2(max(color.r, color.b)); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Stone Part if (mat % 4 == 0) { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else /*if (mat < 13040)*/ { // block.13036 = molten_lead const uint voxelNumbers[4] = uint[](216u, 216u, 216u, 216u); uint voxelNumber = voxelNumbers[mat % 4]; float emissiveness = 5.0; #include "/lib/materials/specificMaterials/terrain/moltenLead.glsl" #if MOLTEN_LEAD_EDGE_EFFECT > 0 float easeAmount = 1.5; vec3 edgeColor = vec3(0.45, 0.5, 0.8) * 2.1; float edgeEmission = 1.0 + emission * 1.1; #if MOLTEN_LEAD_EDGE_EFFECT == 2 edgeColor = vec3(0.18, 0.2, 0.3); edgeEmission = 0.0; easeAmount = 1.2; #endif #include "/lib/materials/specificMaterials/terrain/fluidEdgeEffect.glsl" #endif } } } else /*if (mat < 13056)*/ { if (mat < 13048) { if (mat < 13044) { // block.13040 = molten_lead_cauldron noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.9333); vec3 worldPos = playerPos + cameraPosition; vec3 fractPos = fract(worldPos.xyz); vec2 coordM = abs(fractPos.xz - 0.5); if (max(coordM.x, coordM.y) < 0.375 && fractPos.y > 0.3 && NdotU > 0.9) { float emissiveness = 5.0; #include "/lib/materials/specificMaterials/terrain/moltenLead.glsl" sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } else { #include "/lib/materials/specificMaterials/terrain/anvil.glsl" } } else /*if (mat < 13048)*/ { // block.13044 = polished_glance smoothnessG = pow2(color.b); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else /*if (mat < 13056)*/ { if (mat < 13052) { // block.13048 = raw_lead #include "/lib/materials/specificMaterials/terrain/rawLeadBlock.glsl" #ifdef GLOWING_RAW_BLOCKS emission = 3.0 * sqrt2(max(color.r, color.b)); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else /*if (mat < 13056)*/ { // block.13052 = raw_silver #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_RAW_BLOCKS emission = 2.0 * pow1_5(color.b); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } } } } } } } else /*if (mat < 13312)*/ { if (mat < 13184) { if (mat < 13120) { if (mat < 13088) { if (mat < 13072) { if (mat < 13064) { if (mat < 13060) { // block.13056 = silver_ore if (color.b - color.r > 0.05 || color.b > 0.8) { // Raw Silver Part #include "/lib/materials/specificMaterials/terrain/rawSilverBlock.glsl" #ifdef GLOWING_ORE_SILVER_O emission = 2.0 * pow1_5(color.b); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else { // Stone Part if (mat % 4 == 0) { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else /*if (mat < 13064)*/ { // block.13060 = lampear if (mat % 4 == 0) { // lampear #include "/lib/materials/specificMaterials/terrain/lampearBlock.glsl" } else { // copper lampear #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" emission = pow2(color.g) * 2.5 + 0.2; } #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos.xyz + cameraPosition.xyz); float r = length(fractPos - vec3(0.5, 0.3, 0.5)); emission *= pow2(max0(1.7 - 2.4 * r) * color.b) * (mat % 4 == 0 ? 10.0 : 13.0); color.b *= 1 - 0.1 * emission; #endif } } else /*if (mat < 13072)*/ { if (mat < 13068) { // block.13064 = lampear_block #include "/lib/materials/specificMaterials/terrain/lampearBlock.glsl" emission *= 0.7; color.rgb *= sqrt(color.rgb); } else /*if (mat < 13072)*/ { // block.13068 = pigsteel #include "/lib/materials/specificMaterials/terrain/pigsteel.glsl" } } } else /*if (mat < 13088)*/ { if (mat < 13080) { if (mat < 13076) { // block.13072 = pigsteel_chunks smoothnessG = 1.2 * color.r; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_RAW_BLOCKS emission = 3.5 * pow2(color.r); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } else /*if (mat < 13080)*/ { // block.13076 = pigsteel_lantern noSmoothLighting = true; lmCoordM.x = 0.77; #include "/lib/materials/specificMaterials/terrain/pigsteel.glsl" if (color.r - color.b > 0.3 || color.r > 0.9) { emission = 4.3 * max0(color.r - color.b); emission += min(pow2(pow2(0.75 * dot(color.rgb, color.rgb))), 5.0); color.gb *= pow(vec2(0.8, 0.7), vec2(sqrt(emission) * 0.5)); } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.0; #if defined SOUL_SAND_VALLEY_OVERHAUL_INTERNAL || defined PURPLE_END_FIRE_INTERNAL if (color.g > color.b) { float uniformValue = 1.0; float gradient = 1.0; vec3 colorFire = vec3(0.0); #if defined NETHER #ifdef GBUFFERS_TERRAIN float lanternOffset = 0.0; if (mat == 10562) lanternOffset = 0.1; // Hanging Lantern gradient = mix(1.0, 0.0, clamp01(blockUV.y - lanternOffset + 3.0 * blockUV.y - lanternOffset)); #else gradient = 0.0; #endif uniformValue = inSoulValley; colorFire = colorSoul; #endif #ifdef END colorFire = colorEndBreath; #endif color.rgb = mix(color.rgb, mix(color.rgb, vec3(GetLuminance(color.rgb)), 0.88), uniformValue * gradient); color.rgb *= mix(vec3(1.0), colorFire * 2.0, uniformValue * gradient); } #endif } } else /*if (mat < 13088)*/ { if (mat < 13084) { // block.13080 = pigsteel_soul_lantern noSmoothLighting = true; lmCoordM.x = min(lmCoordM.x, 0.77); // consistency748523 #include "/lib/materials/specificMaterials/terrain/pigsteel.glsl" if (color.b - color.r > 0.3 || color.b > 0.9) { emission = 1.45 * max0(color.g - color.r * 2.0); emission += 1.17 * min(pow2(pow2(0.55 * dot(color.rgb, color.rgb))), 3.5); } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(0.5, 1.0, 1.0, 1.0), emission, 3.0, lViewPos); #endif #ifdef SNOWY_WORLD snowFactor = 0.0; #endif overlayNoiseIntensity = 0.3; } else /*if (mat < 13088)*/ { // block.13084 = porkslag smoothnessG = 1.2 * color.r; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_PORKSLAG emission = 3.5 * pow2(color.r); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; #ifdef SITUATIONAL_ORES emission *= skyLightCheck; color.rgb = mix(color.rgb, color.rgb * pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))), skyLightCheck); #else color.rgb *= pow(color.rgb, vec3(0.5 * min1(GLOWING_ORE_MULT))); #endif emission *= GLOWING_ORE_MULT; #endif } } } } else /*if (mat < 13120)*/ { if (mat < 13104) { if (mat < 13096) { if (mat < 13092) { // block.13088 = ashen_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/ashenPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 13096)*/ { // block.13092 = ashen_log if (color.r > 0.8 && color.b > 0.8 && color.g > 0.8) { // Ashen Log:Clean Part #include "/lib/materials/specificMaterials/planks/ashenPlanks.glsl" } else { // Ashen Log:Wood Part, Ashen Wood smoothnessG = pow2(color.r) * 0.1; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 1.25; #endif } } } else /*if (mat < 13104)*/ { if (mat < 13100) { // block.13096 = ashen_wood #include "/lib/materials/specificMaterials/planks/ashenPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 13104)*/ { // block.13100 = azalea_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/azaleaPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } } else /*if (mat < 13120)*/ { if (mat < 13112) { if (mat < 13108) { // block.13104 = azalea_log if (color.g < 0.8) { // Azalea Log:Clean Part #include "/lib/materials/specificMaterials/planks/azaleaPlanks.glsl" } else { // Azalea Log:Wood Part, Azalea Wood smoothnessG = pow2(color.r) * 0.1; smoothnessD = smoothnessG; mossNoiseIntensity = 0.45; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else /*if (mat < 13112)*/ { // block.13108 = azalea_wood #include "/lib/materials/specificMaterials/planks/azaleaPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } else /*if (mat < 13120)*/ { if (mat < 13116) { // block.13112 = blackstone_furnace #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" if (mat % 4 == 0) { lmCoordM.x *= 0.98; float dotColor = dot(color.rgb, color.rgb); emission = 2.5 * dotColor * max0(pow2(pow2(pow2(color.r))) - color.b) + pow(dotColor * 0.35, 32.0); color.r *= 1.0 + 0.1 * emission; if (color.r > color.b * 2.0 && dotColor > 0.7) { #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif overlayNoiseIntensity = 0.0; } } else if (mat % 4 == 2) { lmCoordM.x *= 0.98; emission = 1.5; color.rgb = pow1_5(color.rgb); } } else /*if (mat < 13120)*/ { // block.13116 = blaze_lantern noSmoothLighting = true, noDirectionalShading = true; lmCoordM.x = 0.85; smoothnessD = min1(max0(0.5 - color.b) * 2.0); smoothnessG = color.b; float blockRes = absMidCoordPos.x * atlasSize.x; vec2 signMidCoordPosM = (floor((signMidCoordPos + 1.0) * blockRes) + 0.5) / blockRes - 1.0; float dotsignMidCoordPos = dot(signMidCoordPosM, signMidCoordPosM); float lBlockPosM = pow2(max0(1.0 - 1.7 * pow2(pow2(dotsignMidCoordPos)))); emission = pow2(color.r) * 1.6 + 2.2 * lBlockPosM; emission *= 0.4 + max0(0.6 - 0.006 * lViewPos); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif overlayNoiseIntensity = 0.5; } } } } } else /*if (mat < 13184)*/ { if (mat < 13152) { if (mat < 13136) { if (mat < 13128) { if (mat < 13124) { // block.13120 = blue_nether_bricks float factor = color.b * 0.8; factor = color.b > 0.3 ? factor : factor * 0.25; smoothnessG = factor; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 13128)*/ { // block.13124 = white_corundum_cluster float factor = (color.r + color.g + color.b) / 2; materialMask = OSIEBCA; // Intense Fresnel smoothnessG = 0.8 - factor * 0.3; highlightMult = factor * 3.0; smoothnessD = factor; noSmoothLighting = true; lmCoordM.x *= 0.88; #if GLOWING_AMETHYST >= 1 && defined GBUFFERS_TERRAIN vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos = abs(fract(worldPos) - vec3(0.65, 0.7, 0.4)); float maxBlockPos = max(blockPos.x, max(blockPos.y, blockPos.z)); emission = pow2(max0(1.0 - pow1_5(maxBlockPos) * 2.60) * pow2(pow2(min(color.r, min(color.g, color.b))))) * 6.0; if (color.r < color.b && color.r < color.g) { color.r *= 1.0 - emission * 0.07; } else if (color.g < color.r && color.g < color.b) { color.g *= 1.0 - emission * 0.07; } else { color.b *= 1.0 - emission * 0.07; } emission *= 1.3; overlayNoiseIntensity = 0.5; #endif #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } } else /*if (mat < 13136)*/ { if (mat < 13132) { // block.13128 = deepslate_furnace #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" if (mat % 4 == 1) { lmCoordM.x *= 0.95; float dotColor = dot(color.rgb, color.rgb); emission = 2.5 * dotColor * max0(pow2(pow2(pow2(color.r))) - color.b) + pow(dotColor * 0.35, 32.0); color.r *= 1.0 + 0.1 * emission; if (color.r > color.b * 2.0 && dotColor > 0.7) { #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif overlayNoiseIntensity = 0.0; } } } else /*if (mat < 13136)*/ { // block.13132 = duskbound_lantern highlightMult = 2.0; smoothnessG = pow2(pow2(color.b)); smoothnessD = smoothnessG; if (mat % 4 == 2) { if (color.b > 1.7 * color.r) { emission = 7.0 - 4.0 * pow2(color.b); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif } else { lmCoordM.x -= 0.1; } } } } } else /*if (mat < 13152)*/ { if (mat < 13144) { if (mat < 13140) { // block.13136 = ender_watcher // TODO improve ender watcher shader if (color.r > 0.5 && color.b < 0.3) { // Redstone emission = 1.0; #include "/lib/materials/specificMaterials/terrain/redstoneTorch.glsl" } else if (color.b > 0.5) { // Eye of Ender smoothnessG = 1.0; highlightMult = 2.0; smoothnessD = 1.0; } } else /*if (mat < 13144)*/ { // block.13140 = glow_shroom noSmoothLighting = true; if (color.g > color.b + 0.035 && color.g > 0.72) { emission = 1.25 * pow2(pow2(color.g)) + 0.3 * pow2(color.b); } else { sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0; } } } else /*if (mat < 13152)*/ { if (mat < 13148) { // block.13144 = glowberry_sack vec2 absCoord = abs(signMidCoordPos); if (NdotU > 0.9 && (absCoord.x < 0.875 && absCoord.y < 0.875)) { subsurfaceMode = 1; lmCoordM.x *= 0.875; if (color.r > 0.64) { emission = color.r < 0.75 ? 1.0: 3.0; color.rgb = color.rgb * vec3(1.0, 0.8, 0.6); } } else { lmCoordM.x -= 0.15; #include "/lib/materials/specificMaterials/terrain/sack.glsl" } } else /*if (mat < 13152)*/ { // block.13148 = gold_bars noSmoothLighting = true; #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } } } } else /*if (mat < 13184)*/ { if (mat < 13168) { if (mat < 13160) { if (mat < 13156) { // block.13152 = jasper smoothnessG = min(pow2(pow2(color.r)) * 2.0, 0.8); smoothnessD = smoothnessG; } else /*if (mat < 13160)*/ { // block.13156 = magnet if (color.r - color.g > 0.2 || color.b - color.g > 0.2) { if (mat % 4 == 2) { emission = 3.0 * pow2(abs(color.r - color.b)) + 1.0; color.rgb *= color.rgb; } } else { #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } } else /*if (mat < 13168)*/ { if (mat < 13164) { // block.13160 = midori_block if (mat % 4 == 2) lmCoordM.x -= 0.15; highlightMult = 2.0; smoothnessG = pow3(color.g) + 0.2 * color.g; smoothnessD = smoothnessG; mossNoiseIntensity = 0.3, sandNoiseIntensity = 0.3; if (color.r > color.g) { emission = 2.5; } } else /*if (mat < 13168)*/ { // block.13164 = myalite vec2 num = (playerPos.xz + cameraPosition.xz) + (playerPos.y + cameraPosition.y); vec2 noise = texture2D(noisetex, num / 128.0).rb; smoothnessG = 0.5 * pow2(color.b) * (0.4 + (pow2(sin(noise.r) + cos(noise.g)))); smoothnessD = smoothnessG; highlightMult = 3.0 * pow2(pow2(color.r)) * smoothnessG; } } } else /*if (mat < 13184)*/ { if (mat < 13176) { if (mat < 13172) { // block.13168 = polished_jasper smoothnessG = min(pow3(color.r) * 2.5, 1.0); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } else /*if (mat < 13176)*/ { // block.13172 = polished_shale materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.b); float factor2 = pow2(factor); smoothnessG = 1.3 - 0.7 * factor; highlightMult = factor2 * 3.0; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.20; #endif } } else /*if (mat < 13184)*/ { if (mat < 13180) { // block.13176 = quark_potted_plants noSmoothLighting = true; vec3 worldPos = playerPos + cameraPosition; float fractPos = fract(worldPos.y); if (fractPos > 0.375) { subsurfaceMode = 1, noDirectionalShading = true; if (mat % 4 == 0) { // glow berries lmCoordM.x *= 0.875; if (color.r > 0.64) { emission = color.r < 0.75 ? 2.5 : 8.0; color.rgb = color.rgb * vec3(1.0, 0.8, 0.6); isFoliage = false; } else { isFoliage = true; } } else if (mat % 4 == 2) { // glow lichen float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(dotColor) * dotColor) * 1.4 + dotColor * 0.9, 6.0); color.r *= 1.15; } } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } else /*if (mat < 13184)*/ { // block.13180 = quark_potted_plants_2 noSmoothLighting = true; vec3 worldPos = playerPos + cameraPosition; float fractPos = fract(worldPos.y); if (fractPos > 0.375) { subsurfaceMode = 1, noDirectionalShading = true; if (mat % 4 == 0) { // sea pickle if (color.b > 0.5) { // Sea Pickle:Emissive Part color.g *= 1.1; emission = 5.0; } } else if (mat % 4 == 2) { // weeping vines #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif if (color.r > 0.91) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); } isFoliage = false; } } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } } } } } } else /*if (mat < 13312)*/ { if (mat < 13248) { if (mat < 13216) { if (mat < 13200) { if (mat < 13192) { if (mat < 13188) { // block.13184 = quark_potted_plants_3 noSmoothLighting = true; vec3 worldPos = playerPos + cameraPosition; float fractPos = fract(worldPos.y); if (fractPos > 0.375) { subsurfaceMode = 1, noDirectionalShading = true; if (mat % 4 == 0) { // glow shroom if (color.g > color.b + 0.035 && color.g > 0.72) { emission = 1.25 * pow2(pow2(color.g)) + 0.3 * pow2(color.b); } } } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } else /*if (mat < 13192)*/ { // block.13188 = quark_stone_lamp if (color.r > 0.85) { noSmoothLighting = true; lmCoordM.x = 1.0; emission = GetLuminance(color.rgb) * 3.2; color.r *= 1.4; color.b *= 0.5; overlayNoiseIntensity = 0.0; #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL if (color.g > 0.999) color.rgb = changeColorFunction(color.rgb, 1.5, colorSoul, inSoulValley); #endif #ifdef PURPLE_END_FIRE_INTERNAL if (color.g > 0.5) color.rgb = changeColorFunction(color.rgb, 2.0, colorEndBreath, 1.0); #endif } else { lmCoordM.x -= 0.13; #include "/lib/materials/specificMaterials/terrain/stone.glsl" } #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif } } else /*if (mat < 13200)*/ { if (mat < 13196) { // block.13192 = redstone_randomizer #if ANISOTROPIC_FILTER > 0 color = texture2D(tex, texCoord); // Fixes artifacts color.rgb *= glColor.rgb; #endif vec3 absDif = abs(vec3(color.r - color.g, color.g - color.b, color.r - color.b)); float maxDif = max(absDif.r, max(absDif.g, absDif.b)); if (color.g - color.r > 0.1 || CheckForColor(color.rgb, vec3(229, 237, 229)) || CheckForColor(color.rgb, vec3(202, 225, 219))) { // Prismarine smoothnessG = pow2(color.g) * 0.8; highlightMult = 1.5; smoothnessD = smoothnessG; if (mat % 4 == 0) emission = pow1_5(color.r) * 2.5 + 0.2; overlayNoiseIntensity = 0.5, overlayNoiseEmission = 0.1; } else if (maxDif > 0.125 || color.b > 0.99) { // Redstone Parts if (color.r < 0.999 && color.b > 0.4) color.gb *= 0.5; // Comparator:Emissive Wire #include "/lib/materials/specificMaterials/terrain/redstoneTorch.glsl" overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.2; } else { // Quartz Base float factor = pow2(color.g) * 0.6; smoothnessG = factor; highlightMult = 1.0 + 2.5 * factor; smoothnessD = factor; } } else /*if (mat < 13200)*/ { // block.13196 = shale float factor = pow2(color.b); float factor2 = pow2(factor); smoothnessG = 0.6 * (1 - factor); highlightMult = factor2 * 3.0; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.45; #endif } } } else /*if (mat < 13216)*/ { if (mat < 13208) { if (mat < 13204) { // block.13200 = storage_crate if (color.r - color.g > 0.078) { #include "/lib/materials/specificMaterials/terrain/ironBlock.glsl" } else { #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" } } else /*if (mat < 13208)*/ { // block.13204 = trumpet_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/trumpetPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } else /*if (mat < 13216)*/ { if (mat < 13212) { // block.13208 = trumpet_log if (color.r > 0.23) { // Trumpet Log:Clean Part #include "/lib/materials/specificMaterials/planks/trumpetPlanks.glsl" } else { // Trumpet Log:Wood Part, Trumpet Wood smoothnessG = pow2(color.r) * 0.35; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } else /*if (mat < 13216)*/ { // block.13212 = trumpet_wood #include "/lib/materials/specificMaterials/planks/trumpetPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } } } } else /*if (mat < 13248)*/ { if (mat < 13232) { if (mat < 13224) { if (mat < 13220) { // block.13216 = brazier [rodspawn] float factor = smoothstep1(min1(color.r * 1.5)); factor = factor > 0.12 ? factor : factor * 0.5; smoothnessG = factor; smoothnessD = factor; if (mat % 4 == 0) { emission = color.g > 0.35 ? 2.5 * pow1_5(color.g) : 0.0; } else { emission = color.b > 0.35 ? 2.5 * pow1_5(color.b) : 0.0; } } else /*if (mat < 13224)*/ { // block.13220 = gilded_nether_bricks if (color.r > 1.6 * color.g) { float factor = smoothstep1(min1(color.r * 1.5)); factor = factor > 0.12 ? factor : factor * 0.5; smoothnessG = factor; smoothnessD = factor; } else { #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } } } else /*if (mat < 13232)*/ { if (mat < 13228) { // block.13224 = nether_spawner float factor = smoothstep1(min1(color.r * 1.5)); factor = factor > 0.12 ? factor : factor * 0.5; smoothnessG = factor; smoothnessD = factor; if (mat % 4 == 0) { // not ominous if (color.r > color.b * 10 || color.r > 0.75) { emission = dot(color.rgb, color.rgb) * 2.5; color.rgb *= color.rgb; } } else if (mat % 4 == 2) { // ominous if (color.b > 0.4) { emission = pow1_5(color.b) * 1.7 + 0.35 * pow1_5(1 - color.b); color.rgb *= GetLuminance(sqrt1(color.rgb)); } } } else /*if (mat < 13232)*/ { // block.13228 = blast_proof_plates #include "/lib/materials/specificMaterials/terrain/blastProofPlates.glsl" } } } else /*if (mat < 13248)*/ { if (mat < 13240) { if (mat < 13236) { // block.13232 = gloomy_tiles smoothnessG = pow2(pow2(color.g)) * 1.8; smoothnessG = min1(smoothnessG); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif if (mat % 4 == 2) { lmCoordM.x *= 0.88; if (color.b > color.r + 0.18) { emission = 1.5; color.rgb *= color.rgb; } } } else /*if (mat < 13240)*/ { // block.13236 = ashen_basalt smoothnessG = 0.3 * pow3(color.r); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #include "/lib/materials/specificMaterials/terrain/iridescentAsh.glsl" } } else /*if (mat < 13248)*/ { if (mat < 13244) { // block.13240 = ashen_quartz #include "/lib/materials/specificMaterials/terrain/iridescentAsh.glsl" materialMask = OSIEBCA; // Intense Fresnel highlightMult = 3.5 * pow2(color.g); smoothnessG = 0.8 * iridescence + 0.4 * pow2(color.r); smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.5; #endif } else /*if (mat < 13248)*/ { // block.13244 = ashen_snow #include "/lib/materials/specificMaterials/terrain/snow.glsl" #include "/lib/materials/specificMaterials/terrain/iridescentAsh.glsl" overlayNoiseIntensity = 0.0; } } } } } else /*if (mat < 13312)*/ { if (mat < 13280) { if (mat < 13264) { if (mat < 13256) { if (mat < 13252) { // block.13248 = fright_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/frightPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 13256)*/ { // block.13252 = fright_fungus noSmoothLighting = true; if (color.b / color.r > 1.6) { emission = 2.0 * (0.7 + 1.2 * signMidCoordPos.y); maRecolor = vec3(0.1); } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; isFoliage = false; } } else /*if (mat < 13264)*/ { if (mat < 13260) { // block.13256 = fright_stem if (abs(color.b - color.g) < 0.07 && color.b > 0.35) { // Flat Part #include "/lib/materials/specificMaterials/planks/frightPlanks.glsl" #ifdef GLOWING_NETHER_TREES } else { // Emissive Part emission = pow2(color.b) * 5.0 + 0.15; overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.3; #ifdef ANIMATED_FRIGHT_STEM #if defined GBUFFERS_TERRAIN vec3 wind = vec3(0, 0.0075, 0) * frameTimeCounter; float noise = Noise3D(0.01 * (playerPos.xyz + cameraPosition.xyz) + wind); emission *= 0.1 + 0.9 * pow2(noise); emission *= 4.0; #endif #endif #endif } } else /*if (mat < 13264)*/ { // block.13260 = fright_wart_block smoothnessG = color.b; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_WART if (color.b > 0.24) { overlayNoiseIntensity = 0.7, overlayNoiseEmission = 0.8; emission = 2.4; #ifdef GBUFFERS_TERRAIN vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); bpos = bpos * 0.01 + 0.005 * frameTimeCounter; emission *= pow2(texture2D(noisetex, bpos).r * pow1_5(texture2D(noisetex, bpos * 0.5).r)); emission *= 4.0; #endif color.gb *= 1.5; } #endif } } } else /*if (mat < 13280)*/ { if (mat < 13272) { if (mat < 13268) { // block.13264 = fright_wood #include "/lib/materials/specificMaterials/planks/frightPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 13272)*/ { // block.13268 = packed_volcanic_ice materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.g); float factor2 = pow2(factor); smoothnessG = 1.0 - 0.7 * factor; highlightMult = factor2 * 3.0; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef SSS_SNOW_ICE subsurfaceMode = 3, noSmoothLighting = true, noDirectionalShading = true; #endif } } else /*if (mat < 13280)*/ { if (mat < 13276) { // block.13272 = vines subsurfaceMode = 1; sandNoiseIntensity = 0.0, mossNoiseIntensity = 0.0, isFoliage = true; } else /*if (mat < 13280)*/ { // block.13276 = allurite_crystal_display if (color.b > 0.7 && color.g > 0.7) { emission = 1.5 * sqrt(color.b) + 0.3; } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } } } else /*if (mat < 13312)*/ { if (mat < 13296) { if (mat < 13288) { if (mat < 13284) { // block.13280 = blackstone_lamp if (color.r > 0.7) { lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(dotColor * 0.6))), 6.0) * 0.8 + 0.5; color.r *= 1.2; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif } else { lmCoordM.x *= 0.85; #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" } } else /*if (mat < 13288)*/ { // block.13284 = blaze_rod smoothnessG = 1.0; smoothnessD = smoothnessG; // TODO try some noise thing similar to lava noise emission = 2.0; } } else /*if (mat < 13296)*/ { if (mat < 13292) { // block.13288 = clock_block if (color.b < 0.4 && color.r > 0.8 && color.g > 0.8) { // Gold Part #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } else if (color.r > 0.7 && color.b > 0.7 && color.g > 0.7) { // White Clockface #include "/lib/materials/specificMaterials/terrain/quartzBlock.glsl" } else if (color.r > 0.2) { // Wooden Part #include "/lib/materials/specificMaterials/planks/darkOakPlanks.glsl" } } else /*if (mat < 13296)*/ { // block.13292 = copper_lantern if (color.r > 0.95) { noSmoothLighting = true; lmCoordM.x = 0.77; emission = 4.3 * (color.g + color.b) * 0.5; emission += min(pow2(pow2(0.75 * dot(color.rgb, color.rgb))), 5.0); color.gb *= pow(vec2(0.8, 0.7), vec2(sqrt(emission) * 0.5)); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif } else { #include "/lib/materials/specificMaterials/terrain/copperBlock.glsl" } } } } else /*if (mat < 13312)*/ { if (mat < 13304) { if (mat < 13300) { // block.13296 = crimson_lantern if (color.r / color.g > 3.0) { noSmoothLighting = true; lmCoordM.x = 0.77; emission = 2.3 * color.r; emission += min(pow2(pow2(0.75 * dot(color.rgb, color.rgb))), 5.0); color.gb *= pow(vec2(0.8, 0.7), vec2(sqrt(emission) * 0.5)); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif } else { #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } } else /*if (mat < 13304)*/ { // block.13300 = crystal_display if (color.r > 0.7 && color.b > 0.7) { emission = 1.5 * sqrt(color.r); } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else /*if (mat < 13312)*/ { if (mat < 13308) { // block.13304 = deepslate_lamp if (color.r > 0.7) { lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(dotColor * 0.6))), 6.0) * 0.8 + 0.5; color.r *= 1.1; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif } else { lmCoordM.x *= 0.85; #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } else /*if (mat < 13312)*/ { // block.13308 = endstone_lamp if (color.g < 0.5) { lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb) / 3; color.rgb /= dotColor; emission = sqrt(color.b + 8.0); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif } else { lmCoordM.x *= 0.85; #include "/lib/materials/specificMaterials/terrain/endStone.glsl" } } } } } } } } } } else /*if (mat < 14336)*/ { if (mat < 13824) { if (mat < 13568) { if (mat < 13440) { if (mat < 13376) { if (mat < 13344) { if (mat < 13328) { if (mat < 13320) { if (mat < 13316) { // block.13312 = fire_pit if (mat % 2 == 0) { #ifdef GBUFFERS_TERRAIN vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; lmCoordM.x = pow2(pow2(smoothstep1(1.0 - 0.4 * dot(fractPos.xz, fractPos.xz)))); float campfireBrightnessFactor = mix(1.0, 0.9, clamp01(UPPER_LIGHTMAP_CURVE - 1.0)); lmCoordM.x *= campfireBrightnessFactor; #endif } if (color.r > 0.8) { #include "/lib/materials/specificMaterials/terrain/lumiseneFire.glsl" } else { #include "/lib/materials/specificMaterials/planks/sprucePlanks.glsl" } } else /*if (mat < 13320)*/ { // block.13316 = lumiere_crystal_display if (color.r > 0.7 && color.g > 0.7) { emission = 1.0 * sqrt(color.r); } else { #include "/lib/materials/specificMaterials/terrain/deepslate.glsl" } } } else /*if (mat < 13328)*/ { if (mat < 13324) { // block.13320 = crimson_lantern if (color.r / color.g > 3.0) { noSmoothLighting = true; lmCoordM.x = 0.77; emission = 2.3 * color.r; emission += min(pow2(pow2(0.75 * dot(color.rgb, color.rgb))), 5.0); color.gb *= pow(vec2(0.8, 0.7), vec2(sqrt(emission) * 0.5)); #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif } else { #include "/lib/materials/specificMaterials/terrain/goldBlock.glsl" } } else /*if (mat < 13328)*/ { // block.13324 = redstone_illuminator color.r *= color.r * 1.05; color.gb *= pow1_5(color.gb); materialMask = OSIEBCA; // Intense Fresnel smoothnessG = color.r * 0.5 + 0.2; float factor = pow2(smoothnessG); highlightMult = factor * 2.0 + 1.0; smoothnessD = min1(factor * 2.0); overlayNoiseIntensity = 0.3; if (color.r > 0.27) { emission = 3.0 * pow1_5(color.r); } } } } else /*if (mat < 13344)*/ { if (mat < 13336) { if (mat < 13332) { // block.13328 = sack #include "/lib/materials/specificMaterials/terrain/sack.glsl" } else /*if (mat < 13336)*/ { // block.13332 = soap_block smoothnessG = pow2(color.r) * 0.4; smoothnessD = smoothnessG; highlightMult = 1.5; } } else /*if (mat < 13344)*/ { if (mat < 13340) { // block.13336 = stone_lamp if (color.r > 0.7) { lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(dotColor * 0.6))), 6.0) * 0.8 + 0.5; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif overlayNoiseIntensity = 0.3; } else { lmCoordM.x *= 0.85; #include "/lib/materials/specificMaterials/terrain/stone.glsl" } } else /*if (mat < 13344)*/ { // block.13340 = sugar_cube smoothnessG = pow(color.g, 16.0) * 2.0; smoothnessD = smoothnessG * 0.7; highlightMult = 2.0; } } } } else /*if (mat < 13376)*/ { if (mat < 13360) { if (mat < 13352) { if (mat < 13348) { // block.13344 = bloodstone smoothnessG = pow2(pow2(color.b + color.r)); smoothnessD = smoothnessG; } else /*if (mat < 13352)*/ { // block.13348 = crimson_shroomlight if (color.b / color.r > 1.8) { #include "/lib/materials/specificMaterials/planks/crimsonPlanks.glsl" lmCoordM.x *= 0.88; } else { lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(dotColor * 0.6))), 6.0) * 0.8 + 0.5; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif overlayNoiseIntensity = 0.3; } } } else /*if (mat < 13360)*/ { if (mat < 13356) { // block.13352 = overgrown_blackstone if (color.r - color.b > 0.2 || color.b - color.r > 0.2) { #if defined COATED_TEXTURES && defined GBUFFERS_TERRAIN doTileRandomisation = false; #endif if (color.r > 0.91) { emission = 3.0 * color.g; color.r *= 1.2; maRecolor = vec3(0.1); } isFoliage = false; } else { #include "/lib/materials/specificMaterials/terrain/blackstone.glsl" } } else /*if (mat < 13360)*/ { // block.13356 = paper_lantern if (color.r / color.b > 1.9) { #include "/lib/materials/specificMaterials/planks/oakPlanks.glsl" lmCoordM.x *= 0.88; } else { vec2 bpos = floor(playerPos.xz + cameraPosition.xz + 0.5) + floor(playerPos.y + cameraPosition.y + 0.5); vec2 flickerNoise = texture2D(noisetex, vec2(frameTimeCounter * 0.015 + bpos.r * 0.1)).rb; noSmoothLighting = true; lmCoordM.x = 0.77; emission = 0.4 * (color.r + color.b + color.g); // motion of candle within lantern vec3 fractPos = fract(playerPos.xyz + cameraPosition.xyz) - 0.5; if (abs(NdotU) < 0.1 && max(abs(fractPos.x), abs(fractPos.z)) > 0.1) emission /= (1 + length(signMidCoordPos - 0.05 * sin(flickerNoise.gr * 5.0))); // appearance of flickering emission *= mix(1.0, min1(max(flickerNoise.r, flickerNoise.g) * 1.7), pow2(7 * 0.1)); #ifdef SOUL_SAND_VALLEY_OVERHAUL_INTERNAL color.r *= mix(max(emission, 1) + 1, 1, inSoulValley); color.b *= mix(1, pow3(max(emission, 1)) + 1, inSoulValley); color.g *= max(emission, 1) + 1; #else color.r *= pow1_5(max(emission, 1)) + 1; color.g *= max(emission, 1) + 1; #endif #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(color, vec4(1.0, 0.6, 0.2, 1.0), emission, 5.0, lViewPos); #endif } } } } else /*if (mat < 13376)*/ { if (mat < 13368) { if (mat < 13364) { // block.13360 = polished_bloodstone smoothnessG = 1.5 * pow2(pow2(color.b + color.r)) + 0.1; smoothnessD = smoothnessG; } else /*if (mat < 13368)*/ { // block.13364 = polished_rhyolite smoothnessG = 4.1 * pow3(color.r); smoothnessD = smoothnessG; } } else /*if (mat < 13376)*/ { if (mat < 13372) { // block.13368 = polished_schist smoothnessG = 0.7 * pow2(color.g) + 0.08; smoothnessD = smoothnessG; } else /*if (mat < 13376)*/ { // block.13372 = rhyolite smoothnessG = 6.2 * pow2(pow2(color.r)) + 0.2 * color.r + 0.05; smoothnessD = smoothnessG; } } } } } else /*if (mat < 13440)*/ { if (mat < 13408) { if (mat < 13392) { if (mat < 13384) { if (mat < 13380) { // block.13376 = schist smoothnessG = 1.2 * pow2(pow2(color.g)); smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } else /*if (mat < 13384)*/ { // block.13380 = warped_shroomlight if (color.b / color.r > 1.8) { #include "/lib/materials/specificMaterials/planks/warpedPlanks.glsl" lmCoordM.x *= 0.88; } else { lmCoordM = vec2(1.0, 0.0); float dotColor = dot(color.rgb, color.rgb); emission = min(pow2(pow2(pow2(dotColor * 0.6))), 6.0) * 0.8 + 0.5; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.5, lViewPos); #endif overlayNoiseIntensity = 0.3; } } } else /*if (mat < 13392)*/ { if (mat < 13388) { // block.13384 = coralstone smoothnessG = pow3(color.g) * 2.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif #ifdef GLOWING_CORALSTONE #include "/lib/materials/specificMaterials/terrain/coral.glsl" float maxDiff = max( abs(color.r - color.b), max(abs(color.b - color.g), abs(color.r - color.g)) ); if (maxDiff > 0.07) { float dotColor = dot(color.rgb, color.rgb); emission = dotColor; } #endif } else /*if (mat < 13392)*/ { // block.13388 = elder_prismarine_coral smoothnessG = pow2(color.g) * 0.8; highlightMult = 1.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif if (mat % 4 < 2) { noSmoothLighting = true; #if defined GBUFFERS_TERRAIN vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos; if (mat % 4 == 0) { blockPos = abs(fract(worldPos) - vec3(0.5)); } else { blockPos = abs(fract(worldPos) - vec3(0.5, 0.2, 0.5)); } float r = length(blockPos); emission = smoothnessG - 0.5 * pow3(color.g); emission *= pow2(max0(1.0 - r * 1.3) * color.r) * 20.0; color.r *= 1.0 - emission * 0.05; overlayNoiseIntensity = 0.5; #endif } } } } else /*if (mat < 13408)*/ { if (mat < 13400) { if (mat < 13396) { // block.13392 = luminous_prismarine emission = 1.2 * pow2(color.b); smoothnessG = pow2(color.g) * 0.8; highlightMult = 1.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif } else /*if (mat < 13400)*/ { // block.13396 = prismarine_coral smoothnessG = pow2(color.g) * 0.8; highlightMult = 1.5; smoothnessD = smoothnessG; #ifdef COATED_TEXTURES noiseFactor = 0.66; #endif if (mat % 4 < 2) { noSmoothLighting = true; #if defined GBUFFERS_TERRAIN vec3 worldPos = playerPos.xyz + cameraPosition.xyz; vec3 blockPos; if (mat % 4 == 0) { blockPos = abs(fract(worldPos) - vec3(0.5)); } else { blockPos = abs(fract(worldPos) - vec3(0.5, 0.2, 0.5)); } float r = length(blockPos); emission = smoothnessG - 0.5 * pow3(color.g); emission *= pow2(max0(1.0 - r * 1.3) * color.r) * 35.0; color.r *= 1.0 - emission * 0.05; overlayNoiseIntensity = 0.5; #endif } } } else /*if (mat < 13408)*/ { if (mat < 13404) { // block.13400 = tooth_lantern if (color.b > color.r + 0.1) { noSmoothLighting = true; emission = pow2(color.b) * 4.0; color.rgb *= color.rgb; #ifdef DISTANT_LIGHT_BOKEH DoDistantLightBokehMaterial(emission, 2.0, lViewPos); #endif } else { lmCoordM.x *= 0.88; smoothnessG = color.r * 0.2; smoothnessD = smoothnessG; #ifdef GBUFFERS_TERRAIN DoBrightBlockTweaks(color.rgb, 0.5, shadowMult, highlightMult); #endif #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif } } else /*if (mat < 13408)*/ { // block.13404 = enchanted_basin if (color.g < 0.5 && color.r + color.b > 1.3) { // Amethyst Part #include "/lib/materials/specificMaterials/terrain/amethystBlock.glsl" } else if ((color.g + color.r) / color.b > 2.4 && NdotU > 0.9) { // Experience Part highlightMult = 0.0; smoothnessD = 0.0; emission = pow1_5(color.g) * 6.0; maRecolor = vec3(0.0); color.rgb *= color.rgb; overlayNoiseIntensity = 0.0; } else if (color.r + color.b + color.g > 2.0) { // Calcite Part highlightMult = pow2(color.g) + 1.0; smoothnessG = 1.0 - color.g * 0.5; smoothnessD = smoothnessG; } } } } } else /*if (mat < 13440)*/ { if (mat < 13424) { if (mat < 13416) { if (mat < 13412) { // block.13408 = ancient_brazier [limestone] vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; float maxColor = max(color.r, max(color.g, color.b)); float minColor = min(color.r, min(color.g, color.b)); if (color.b < 0.5 && color.r < 0.3 && color.g < 0.8) { smoothnessG = color.b + 0.2; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.6; } else if ((fractPos.y > 0.24 && fractPos.y < 0.45) || maxColor - minColor > 0.1) { noDirectionalShading = true; emission = 2.9; color.rgb *= pow1_5(color.rgb); overlayNoiseIntensity = 0.0; } else { smoothnessG = pow2(color.g) * 0.4; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } } else /*if (mat < 13416)*/ { // block.13412 = aria_mushroom if (mat % 4 == 0) { emission = 2.5 * pow2(color.r) + 0.2 * pow2(color.b); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; } else { noSmoothLighting = true; vec3 worldPos = playerPos + cameraPosition; float fractPos = fract(worldPos.y); if (fractPos > 0.375) { emission = 2.5 * pow2(color.r) + 0.2 * pow2(color.b); overlayNoiseIntensity = 0.6, overlayNoiseEmission = 0.5; } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } } } else /*if (mat < 13424)*/ { if (mat < 13420) { // block.13416 = bald_cypress_door noSmoothLighting = true; #include "/lib/materials/specificMaterials/planks/baldCypressPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 13424)*/ { // block.13420 = bald_cypress_log if (color.b > 0.3) { // Bald Cypress Log:Clean Part #include "/lib/materials/specificMaterials/planks/baldCypressPlanks.glsl" } else { // Bald Cypress Log:Wood Part, Bald Cypress Wood smoothnessG = 0.4 * pow2(color.b); smoothnessD = smoothnessG; mossNoiseIntensity = 0.60; #ifdef COATED_TEXTURES noiseFactor = 0.77; #endif } } } } else /*if (mat < 13440)*/ { if (mat < 13432) { if (mat < 13428) { // block.13424 = bald_cypress_wood #include "/lib/materials/specificMaterials/planks/baldCypressPlanks.glsl" if (mat % 4 == 3) { // Powered Redstone Components redstoneIPBR(color.rgb, emission); } } else /*if (mat < 13432)*/ { // block.13428 = bloodcap_mushroom if (mat % 4 == 0) { if (color.g < 0.25) { #if GLOWING_BLOODCAP_MUSHROOM == 1 emission = color.r; overlayNoiseEmission = 0.4; #elif GLOWING_BLOODCAP_MUSHROOM == 2 emission = 1.5 * color.r; overlayNoiseEmission = 0.4; #elif GLOWING_BLOODCAP_MUSHROOM == 3 emission = 2.0 * color.r; overlayNoiseEmission = 0.4; #endif } overlayNoiseIntensity = 0.6; } else { noSmoothLighting = true; vec3 worldPos = playerPos + cameraPosition; float fractPos = fract(worldPos.y); if (fractPos > 0.375) { if (color.g < 0.25) { #if GLOWING_BLOODCAP_MUSHROOM == 1 emission = color.r; overlayNoiseEmission = 0.4; #elif GLOWING_BLOODCAP_MUSHROOM == 2 emission = 1.5 * color.r; overlayNoiseEmission = 0.4; #elif GLOWING_BLOODCAP_MUSHROOM == 3 emission = 2.0 * color.r; overlayNoiseEmission = 0.4; #endif } overlayNoiseIntensity = 0.6; } sandNoiseIntensity = 0.3, mossNoiseIntensity = 0.0; } } } else /*if (mat < 13440)*/ { if (mat < 13436) { // block.13432 = brazier [limestone] vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; #ifdef GBUFFERS_TERRAIN lmCoordM.x *= 0.88; if (NdotU > 0.9 && length(fractPos) < 0.8) { lmCoordM.x += 0.8 * pow2(0.8 - length(fractPos)); } #endif float dotColor = dot(color.rgb, color.rgb); if ((fractPos.y > -0.24 && fractPos.y < 0.45) || color.r - color.b > 0.1) { noDirectionalShading = true; emission = 3.5; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; #if defined SOUL_SAND_VALLEY_OVERHAUL_INTERNAL || defined PURPLE_END_FIRE_INTERNAL float uniformValue = 1.0; vec3 colorFire = vec3(0.0); float gradient = 0.0; #if defined NETHER uniformValue = inSoulValley; colorFire = colorSoul; #ifdef GBUFFERS_TERRAIN gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.5 * blockUV.y)); #elif defined GBUFFERS_HAND float handUV = gl_FragCoord.y / viewHeight; gradient = mix(1.0, 0.0, handUV + 0.4); #endif #endif #ifdef END colorFire = colorEndBreath; #ifdef GBUFFERS_TERRAIN gradient = mix(1.0, 0.0, clamp01(blockUV.y + 0.07 - 1.1 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * blockUV.y))); #elif defined GBUFFERS_HAND float handUV = gl_FragCoord.y / viewHeight; gradient = mix(1.0, 0.0, clamp01(handUV + 0.3 - 1.3 * clamp01(sin(texture2D(noisetex, vec2(frameTimeCounter * 0.01)).r) * handUV))); #endif #endif color.rgb = mix(color.rgb, mix(color.rgb, vec3(GetLuminance(color.rgb)), 0.88), uniformValue * gradient); color.rgb *= mix(vec3(1.0), colorFire * 2.0, uniformValue * gradient); #endif } else { smoothnessG = pow2(color.g) * 0.4; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } } else /*if (mat < 13440)*/ { // block.13436 = cupric_brazier [limestone] vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; #ifdef GBUFFERS_TERRAIN lmCoordM.x *= 0.88; if (NdotU > 0.9 && length(fractPos) < 0.8) { lmCoordM.x += 0.8 * pow2(0.8 - length(fractPos)); } #endif if ((fractPos.y > -0.24 && fractPos.y < 0.45) || (color.r > 0.6 && color.g > color.r)) { noDirectionalShading = true; emission = 2.50; color.rgb *= sqrt1(GetLuminance(color.rgb)); overlayNoiseIntensity = 0.0; } else { smoothnessG = pow2(color.g) * 0.4; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } } } } } } } else /*if (mat < 13568)*/ { if (mat < 13504) { if (mat < 13472) { if (mat < 13456) { if (mat < 13448) { if (mat < 13444) { // block.13440 = ender_brazier [limestone] vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; #ifdef GBUFFERS_TERRAIN lmCoordM.x *= 0.88; if (NdotU > 0.9 && length(fractPos) < 0.8) { lmCoordM.x += 0.8 * pow2(0.8 - length(fractPos)); } #endif float dotColor = dot(color.rgb, color.rgb); if ((fractPos.y > -0.24 && fractPos.y < 0.45) || (color.r - color.g > 0.1 && color.b - color.g > 0.1)) { noDirectionalShading = true; emission = 3.50; color.rgb *= color.rgb; } else { smoothnessG = pow2(color.g) * 0.4; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } } else /*if (mat < 13448)*/ { // block.13444 = limestone [wetland_whimsy] smoothnessG = pow2(color.g) * (mat % 4 == 0 ? 0.2 : 0.4); smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } } else /*if (mat < 13456)*/ { if (mat < 13452) { // block.13448 = soul_brazier [limestone] vec3 fractPos = fract(playerPos + cameraPosition) - 0.5; if ((fractPos.y > -0.24 && fractPos.y < 0.45) || color.b - color.r > 0.05) { noDirectionalShading = true; emission = 2.5; color.rgb *= pow1_5(color.rgb); overlayNoiseIntensity = 0.0; } else { smoothnessG = pow2(color.g) * 0.4; smoothnessD = smoothnessG; overlayNoiseIntensity = 0.7; } } else /*if (mat < 13456)*/ { // block.13452 = enchanted_ice // TODO make shader actually work materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.g); float factor2 = pow2(factor); smoothnessG = 1.0 - 0.5 * factor; highlightMult = factor2 * 3.5; smoothnessD = factor; emission = color.r > 0.6 ? 1.6 * pow2(color.r) : 0.0; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif #ifdef SSS_SNOW_ICE subsurfaceMode = 3, noSmoothLighting = true, noDirectionalShading = true; #endif } } } else /*if (mat < 13472)*/ { if (mat < 13464) { if (mat < 13460) { // block.13456 = frost_lily materialMask = OSIEBCA; // Intense Fresnel float factor = pow2(color.g); float factor2 = pow2(factor); smoothnessG = 1.0 - 0.5 * factor; highlightMult = factor2 * 3.5; smoothnessD = factor; #ifdef COATED_TEXTURES noiseFactor = 0.33; #endif #ifdef SSS_SNOW_ICE subsurfaceMode = 3, noSmoothLighting = true, noDirectionalShading = true; #endif noSmoothLighting = true; lmCoordM.x *= 0.85; emission = 1.3 * pow2(color.r); overlayNoiseIntensity = 0.5; } else /*if (mat < 13464)*/ { // block.13460 = prickly_vines subsurfaceMode = 1; isFoliage = true; sandNoiseIntensity = 0.2, mossNoiseIntensity = 0.0; } } else /*if (mat < 13472)*/ { if (mat < 13468) { // block.13464 } else /*if (mat < 13472)*/ { // block.13468 } } } } else /*if (mat < 13504)*/ { if (mat < 13488) { if (mat < 13480) { if (mat < 13476) { // block.13472 } else /*if (mat < 13480)*/ { // block.13476 } } else /*if (mat < 13488)*/ { if (mat < 13484) { // block.13480 } else /*if (mat < 13488)*/ { // block.13484 } } } else /*if (mat < 13504)*/ { if (mat < 13496) { if (mat < 13492) { // block.13488 } else /*if (mat < 13496)*/ { // block.13492 } } else /*if (mat < 13504)*/ { if (mat < 13500) { // block.13496 } else /*if (mat < 13504)*/ { // block.13500 } } } } } else /*if (mat < 13568)*/ { if (mat < 13536) { if (mat < 13520) { if (mat < 13512) { if (mat < 13508) { // block.13504 } else /*if (mat < 13512)*/ { // block.13508 } } else /*if (mat < 13520)*/ { if (mat < 13516) { // block.13512 } else /*if (mat < 13520)*/ { // block.13516 } } } else /*if (mat < 13536)*/ { if (mat < 13528) { if (mat < 13524) { // block.13520 } else /*if (mat < 13528)*/ { // block.13524 } } else /*if (mat < 13536)*/ { if (mat < 13532) { // block.13528 } else /*if (mat < 13536)*/ { // block.13532 } } } } else /*if (mat < 13568)*/ { if (mat < 13552) { if (mat < 13544) { if (mat < 13540) { // block.13536 } else /*if (mat < 13544)*/ { // block.13540 } } else /*if (mat < 13552)*/ { if (mat < 13548) { // block.13544 } else /*if (mat < 13552)*/ { // block.13548 } } } else /*if (mat < 13568)*/ { if (mat < 13560) { if (mat < 13556) { // block.13552 } else /*if (mat < 13560)*/ { // block.13556 } } else /*if (mat < 13568)*/ { if (mat < 13564) { // block.13560 } else /*if (mat < 13568)*/ { // block.13564 } } } } } } } else /*if (mat < 13824)*/ { if (mat < 13696) { if (mat < 13632) { if (mat < 13600) { if (mat < 13584) { if (mat < 13576) { if (mat < 13572) { // block.13568 } else /*if (mat < 13576)*/ { // block.13572 } } else /*if (mat < 13584)*/ { if (mat < 13580) { // block.13576 } else /*if (mat < 13584)*/ { // block.13580 } } } else /*if (mat < 13600)*/ { if (mat < 13592) { if (mat < 13588) { // block.13584 } else /*if (mat < 13592)*/ { // block.13588 } } else /*if (mat < 13600)*/ { if (mat < 13596) { // block.13592 } else /*if (mat < 13600)*/ { // block.13596 } } } } else /*if (mat < 13632)*/ { if (mat < 13616) { if (mat < 13608) { if (mat < 13604) { // block.13600 } else /*if (mat < 13608)*/ { // block.13604 } } else /*if (mat < 13616)*/ { if (mat < 13612) { // block.13608 } else /*if (mat < 13616)*/ { // block.13612 } } } else /*if (mat < 13632)*/ { if (mat < 13624) { if (mat < 13620) { // block.13616 } else /*if (mat < 13624)*/ { // block.13620 } } else /*if (mat < 13632)*/ { if (mat < 13628) { // block.13624 } else /*if (mat < 13632)*/ { // block.13628 } } } } } else /*if (mat < 13696)*/ { if (mat < 13664) { if (mat < 13648) { if (mat < 13640) { if (mat < 13636) { // block.13632 } else /*if (mat < 13640)*/ { // block.13636 } } else /*if (mat < 13648)*/ { if (mat < 13644) { // block.13640 } else /*if (mat < 13648)*/ { // block.13644 } } } else /*if (mat < 13664)*/ { if (mat < 13656) { if (mat < 13652) { // block.13648 } else /*if (mat < 13656)*/ { // block.13652 } } else /*if (mat < 13664)*/ { if (mat < 13660) { // block.13656 } else /*if (mat < 13664)*/ { // block.13660 } } } } else /*if (mat < 13696)*/ { if (mat < 13680) { if (mat < 13672) { if (mat < 13668) { // block.13664 } else /*if (mat < 13672)*/ { // block.13668 } } else /*if (mat < 13680)*/ { if (mat < 13676) { // block.13672 } else /*if (mat < 13680)*/ { // block.13676 } } } else /*if (mat < 13696)*/ { if (mat < 13688) { if (mat < 13684) { // block.13680 } else /*if (mat < 13688)*/ { // block.13684 } } else /*if (mat < 13696)*/ { if (mat < 13692) { // block.13688 } else /*if (mat < 13696)*/ { // block.13692 } } } } } } else /*if (mat < 13824)*/ { if (mat < 13760) { if (mat < 13728) { if (mat < 13712) { if (mat < 13704) { if (mat < 13700) { // block.13696 } else /*if (mat < 13704)*/ { // block.13700 } } else /*if (mat < 13712)*/ { if (mat < 13708) { // block.13704 } else /*if (mat < 13712)*/ { // block.13708 } } } else /*if (mat < 13728)*/ { if (mat < 13720) { if (mat < 13716) { // block.13712 } else /*if (mat < 13720)*/ { // block.13716 } } else /*if (mat < 13728)*/ { if (mat < 13724) { // block.13720 } else /*if (mat < 13728)*/ { // block.13724 } } } } else /*if (mat < 13760)*/ { if (mat < 13744) { if (mat < 13736) { if (mat < 13732) { // block.13728 } else /*if (mat < 13736)*/ { // block.13732 } } else /*if (mat < 13744)*/ { if (mat < 13740) { // block.13736 } else /*if (mat < 13744)*/ { // block.13740 } } } else /*if (mat < 13760)*/ { if (mat < 13752) { if (mat < 13748) { // block.13744 } else /*if (mat < 13752)*/ { // block.13748 } } else /*if (mat < 13760)*/ { if (mat < 13756) { // block.13752 } else /*if (mat < 13760)*/ { // block.13756 } } } } } else /*if (mat < 13824)*/ { if (mat < 13792) { if (mat < 13776) { if (mat < 13768) { if (mat < 13764) { // block.13760 } else /*if (mat < 13768)*/ { // block.13764 } } else /*if (mat < 13776)*/ { if (mat < 13772) { // block.13768 } else /*if (mat < 13776)*/ { // block.13772 } } } else /*if (mat < 13792)*/ { if (mat < 13784) { if (mat < 13780) { // block.13776 } else /*if (mat < 13784)*/ { // block.13780 } } else /*if (mat < 13792)*/ { if (mat < 13788) { // block.13784 } else /*if (mat < 13792)*/ { // block.13788 } } } } else /*if (mat < 13824)*/ { if (mat < 13808) { if (mat < 13800) { if (mat < 13796) { // block.13792 } else /*if (mat < 13800)*/ { // block.13796 } } else /*if (mat < 13808)*/ { if (mat < 13804) { // block.13800 } else /*if (mat < 13808)*/ { // block.13804 } } } else /*if (mat < 13824)*/ { if (mat < 13816) { if (mat < 13812) { // block.13808 } else /*if (mat < 13816)*/ { // block.13812 } } else /*if (mat < 13824)*/ { if (mat < 13820) { // block.13816 } else /*if (mat < 13824)*/ { // block.13820 } } } } } } } } else /*if (mat < 14336)*/ { if (mat < 14080) { if (mat < 13952) { if (mat < 13888) { if (mat < 13856) { if (mat < 13840) { if (mat < 13832) { if (mat < 13828) { // block.13824 } else /*if (mat < 13832)*/ { // block.13828 } } else /*if (mat < 13840)*/ { if (mat < 13836) { // block.13832 } else /*if (mat < 13840)*/ { // block.13836 } } } else /*if (mat < 13856)*/ { if (mat < 13848) { if (mat < 13844) { // block.13840 } else /*if (mat < 13848)*/ { // block.13844 } } else /*if (mat < 13856)*/ { if (mat < 13852) { // block.13848 } else /*if (mat < 13856)*/ { // block.13852 } } } } else /*if (mat < 13888)*/ { if (mat < 13872) { if (mat < 13864) { if (mat < 13860) { // block.13856 } else /*if (mat < 13864)*/ { // block.13860 } } else /*if (mat < 13872)*/ { if (mat < 13868) { // block.13864 } else /*if (mat < 13872)*/ { // block.13868 } } } else /*if (mat < 13888)*/ { if (mat < 13880) { if (mat < 13876) { // block.13872 } else /*if (mat < 13880)*/ { // block.13876 } } else /*if (mat < 13888)*/ { if (mat < 13884) { // block.13880 } else /*if (mat < 13888)*/ { // block.13884 } } } } } else /*if (mat < 13952)*/ { if (mat < 13920) { if (mat < 13904) { if (mat < 13896) { if (mat < 13892) { // block.13888 } else /*if (mat < 13896)*/ { // block.13892 } } else /*if (mat < 13904)*/ { if (mat < 13900) { // block.13896 } else /*if (mat < 13904)*/ { // block.13900 } } } else /*if (mat < 13920)*/ { if (mat < 13912) { if (mat < 13908) { // block.13904 } else /*if (mat < 13912)*/ { // block.13908 } } else /*if (mat < 13920)*/ { if (mat < 13916) { // block.13912 } else /*if (mat < 13920)*/ { // block.13916 } } } } else /*if (mat < 13952)*/ { if (mat < 13936) { if (mat < 13928) { if (mat < 13924) { // block.13920 } else /*if (mat < 13928)*/ { // block.13924 } } else /*if (mat < 13936)*/ { if (mat < 13932) { // block.13928 } else /*if (mat < 13936)*/ { // block.13932 } } } else /*if (mat < 13952)*/ { if (mat < 13944) { if (mat < 13940) { // block.13936 } else /*if (mat < 13944)*/ { // block.13940 } } else /*if (mat < 13952)*/ { if (mat < 13948) { // block.13944 } else /*if (mat < 13952)*/ { // block.13948 } } } } } } else /*if (mat < 14080)*/ { if (mat < 14016) { if (mat < 13984) { if (mat < 13968) { if (mat < 13960) { if (mat < 13956) { // block.13952 } else /*if (mat < 13960)*/ { // block.13956 } } else /*if (mat < 13968)*/ { if (mat < 13964) { // block.13960 } else /*if (mat < 13968)*/ { // block.13964 } } } else /*if (mat < 13984)*/ { if (mat < 13976) { if (mat < 13972) { // block.13968 } else /*if (mat < 13976)*/ { // block.13972 } } else /*if (mat < 13984)*/ { if (mat < 13980) { // block.13976 } else /*if (mat < 13984)*/ { // block.13980 } } } } else /*if (mat < 14016)*/ { if (mat < 14000) { if (mat < 13992) { if (mat < 13988) { // block.13984 } else /*if (mat < 13992)*/ { // block.13988 } } else /*if (mat < 14000)*/ { if (mat < 13996) { // block.13992 } else /*if (mat < 14000)*/ { // block.13996 } } } else /*if (mat < 14016)*/ { if (mat < 14008) { if (mat < 14004) { // block.14000 } else /*if (mat < 14008)*/ { // block.14004 } } else /*if (mat < 14016)*/ { if (mat < 14012) { // block.14008 } else /*if (mat < 14016)*/ { // block.14012 } } } } } else /*if (mat < 14080)*/ { if (mat < 14048) { if (mat < 14032) { if (mat < 14024) { if (mat < 14020) { // block.14016 } else /*if (mat < 14024)*/ { // block.14020 } } else /*if (mat < 14032)*/ { if (mat < 14028) { // block.14024 } else /*if (mat < 14032)*/ { // block.14028 } } } else /*if (mat < 14048)*/ { if (mat < 14040) { if (mat < 14036) { // block.14032 } else /*if (mat < 14040)*/ { // block.14036 } } else /*if (mat < 14048)*/ { if (mat < 14044) { // block.14040 } else /*if (mat < 14048)*/ { // block.14044 } } } } else /*if (mat < 14080)*/ { if (mat < 14064) { if (mat < 14056) { if (mat < 14052) { // block.14048 } else /*if (mat < 14056)*/ { // block.14052 } } else /*if (mat < 14064)*/ { if (mat < 14060) { // block.14056 } else /*if (mat < 14064)*/ { // block.14060 } } } else /*if (mat < 14080)*/ { if (mat < 14072) { if (mat < 14068) { // block.14064 } else /*if (mat < 14072)*/ { // block.14068 } } else /*if (mat < 14080)*/ { if (mat < 14076) { // block.14072 } else /*if (mat < 14080)*/ { // block.14076 } } } } } } } else /*if (mat < 14336)*/ { if (mat < 14208) { if (mat < 14144) { if (mat < 14112) { if (mat < 14096) { if (mat < 14088) { if (mat < 14084) { // block.14080 } else /*if (mat < 14088)*/ { // block.14084 } } else /*if (mat < 14096)*/ { if (mat < 14092) { // block.14088 } else /*if (mat < 14096)*/ { // block.14092 } } } else /*if (mat < 14112)*/ { if (mat < 14104) { if (mat < 14100) { // block.14096 } else /*if (mat < 14104)*/ { // block.14100 } } else /*if (mat < 14112)*/ { if (mat < 14108) { // block.14104 } else /*if (mat < 14112)*/ { // block.14108 } } } } else /*if (mat < 14144)*/ { if (mat < 14128) { if (mat < 14120) { if (mat < 14116) { // block.14112 } else /*if (mat < 14120)*/ { // block.14116 } } else /*if (mat < 14128)*/ { if (mat < 14124) { // block.14120 } else /*if (mat < 14128)*/ { // block.14124 } } } else /*if (mat < 14144)*/ { if (mat < 14136) { if (mat < 14132) { // block.14128 } else /*if (mat < 14136)*/ { // block.14132 } } else /*if (mat < 14144)*/ { if (mat < 14140) { // block.14136 } else /*if (mat < 14144)*/ { // block.14140 } } } } } else /*if (mat < 14208)*/ { if (mat < 14176) { if (mat < 14160) { if (mat < 14152) { if (mat < 14148) { // block.14144 } else /*if (mat < 14152)*/ { // block.14148 } } else /*if (mat < 14160)*/ { if (mat < 14156) { // block.14152 } else /*if (mat < 14160)*/ { // block.14156 } } } else /*if (mat < 14176)*/ { if (mat < 14168) { if (mat < 14164) { // block.14160 } else /*if (mat < 14168)*/ { // block.14164 } } else /*if (mat < 14176)*/ { if (mat < 14172) { // block.14168 } else /*if (mat < 14176)*/ { // block.14172 } } } } else /*if (mat < 14208)*/ { if (mat < 14192) { if (mat < 14184) { if (mat < 14180) { // block.14176 } else /*if (mat < 14184)*/ { // block.14180 } } else /*if (mat < 14192)*/ { if (mat < 14188) { // block.14184 } else /*if (mat < 14192)*/ { // block.14188 } } } else /*if (mat < 14208)*/ { if (mat < 14200) { if (mat < 14196) { // block.14192 } else /*if (mat < 14200)*/ { // block.14196 } } else /*if (mat < 14208)*/ { if (mat < 14204) { // block.14200 } else /*if (mat < 14208)*/ { // block.14204 } } } } } } else /*if (mat < 14336)*/ { if (mat < 14272) { if (mat < 14240) { if (mat < 14224) { if (mat < 14216) { if (mat < 14212) { // block.14208 } else /*if (mat < 14216)*/ { // block.14212 } } else /*if (mat < 14224)*/ { if (mat < 14220) { // block.14216 } else /*if (mat < 14224)*/ { // block.14220 } } } else /*if (mat < 14240)*/ { if (mat < 14232) { if (mat < 14228) { // block.14224 } else /*if (mat < 14232)*/ { // block.14228 } } else /*if (mat < 14240)*/ { if (mat < 14236) { // block.14232 } else /*if (mat < 14240)*/ { // block.14236 } } } } else /*if (mat < 14272)*/ { if (mat < 14256) { if (mat < 14248) { if (mat < 14244) { // block.14240 } else /*if (mat < 14248)*/ { // block.14244 } } else /*if (mat < 14256)*/ { if (mat < 14252) { // block.14248 } else /*if (mat < 14256)*/ { // block.14252 } } } else /*if (mat < 14272)*/ { if (mat < 14264) { if (mat < 14260) { // block.14256 } else /*if (mat < 14264)*/ { // block.14260 } } else /*if (mat < 14272)*/ { if (mat < 14268) { // block.14264 } else /*if (mat < 14272)*/ { // block.14268 } } } } } else /*if (mat < 14336)*/ { if (mat < 14304) { if (mat < 14288) { if (mat < 14280) { if (mat < 14276) { // block.14272 } else /*if (mat < 14280)*/ { // block.14276 } } else /*if (mat < 14288)*/ { if (mat < 14284) { // block.14280 } else /*if (mat < 14288)*/ { // block.14284 } } } else /*if (mat < 14304)*/ { if (mat < 14296) { if (mat < 14292) { // block.14288 } else /*if (mat < 14296)*/ { // block.14292 } } else /*if (mat < 14304)*/ { if (mat < 14300) { // block.14296 } else /*if (mat < 14304)*/ { // block.14300 } } } } else /*if (mat < 14336)*/ { if (mat < 14320) { if (mat < 14312) { if (mat < 14308) { // block.14304 } else /*if (mat < 14312)*/ { // block.14308 } } else /*if (mat < 14320)*/ { if (mat < 14316) { // block.14312 } else /*if (mat < 14320)*/ { // block.14316 } } } else /*if (mat < 14336)*/ { if (mat < 14328) { if (mat < 14324) { // block.14320 } else /*if (mat < 14328)*/ { // block.14324 } } else /*if (mat < 14336)*/ { if (mat < 14332) { // block.14328 } else /*if (mat < 14336)*/ { // block.14332 } } } } } } } } } } } #ifdef GBUFFERS_TERRAIN else { // mat < 10000 // Support for the Enhanced Block Entities mod. The mod makes block entities render in gbuffers_terrain int blockEntityId = mat; #include "/lib/materials/materialHandling/blockEntityMaterials.glsl" } #endif